3D Periodic Editor 3D Molecular And Reaction Editor Expert Editor Microsoft Quantum Editor EMSL Aerosol Workshop Editor Manual 3D Periodic Editor 3D Molecular And Reaction Editor Expert Editor Microsoft Quantum Editor EMSL Aerosol Workshop Editor Manual Results from an EMSL Arrows Calculation
| EMSL Arrows is a revolutionary approach to materials and chemical simulations that uses NWChem and chemical computational databases to make materials and chemical modeling accessible via a broad spectrum of digital communications including posts to web APIs, social networks, and traditional email. |
Molecular modeling software has previously been extremely complex, making it prohibative to all but experts in the field, yet even experts can struggle to perform calculations. This service is designed to be used by experts and non-experts alike. Experts can carry out and keep track of large numbers of complex calculations with diverse levels of theories present in their workflows. Additionally, due to a streamlined and easy-to-use input, non-experts can carry out a wide variety of molecular modeling calculations previously not accessible to them.
The id(s) for emsiles = CC1=C(C=C(C=C1[N+](=O)[O-])O)[N+](=O)[O-] ^{0} are: 2674
Use id=% instead of esmiles to print other entries.
mformula = C7H6N2O5
iupac = 4-methyl-3,5-dinitrophenol
PubChem = 46156
PubChem LCSS = 46156
Search Links to Other Online Resources (may not be available):
- Google Structure Search
- EPA CompTox Database
- Chemical Entities of Biological Interest (ChEBI)
+==================================================+
|| Molecular Calculation ||
+==================================================+
Id = 2674
NWOutput = Link to NWChem Output (download)
Datafiles:
mo_orbital_nwchemarrows.out-589604-2020-6-18-6:37:1 (download)
homo-restricted.cube-589604-2020-6-18-6:37:1 (download)
lumo-restricted.cube-589604-2020-6-18-6:37:1 (download)
cosmo.xyz-589604-2020-6-18-6:37:1 (download)
image_resset: api/image_reset/2674
Calculation performed by node0281.local
Numbers of cpus used for calculation = 64
Calculation walltime = 25431.600000 seconds (0 days 7 hours 3 minutes 51 seconds)
+----------------+
| Energetic Data |
+----------------+
Id = 2674
iupac = 4-methyl-3,5-dinitrophenol
mformula = C7H6N2O5
inchi = InChI=1S/C7H6N2O5/c1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h2-3,10H,1H3
inchikey = HTAMNOAYOHLVPQ-UHFFFAOYSA-N
esmiles = CC1=C(C=C(C=C1[N+](=O)[O-])O)[N+](=O)[O-] ^{0}
calculation_type = ovc
theory = dft
xc = lda
basis = 6-311++G(2d,2p)
charge,mult = 0 1
energy = -750.155170 Hartrees
enthalpy correct.= 0.147053 Hartrees
entropy = 109.841 cal/mol-K
solvation energy = -14.358 kcal/mol solvation_type = COSMO
Sitkoff cavity dispersion = 2.602 kcal/mol
Honig cavity dispersion = 8.712 kcal/mol
ASA solvent accesible surface area = 348.485 Angstrom2
ASA solvent accesible volume = 331.439 Angstrom3
+-----------------+
| Structural Data |
+-----------------+
JSmol: an open-source HTML5 viewer for chemical structures in 3D
Number of Atoms = 20
Units are Angstrom for bonds and degrees for angles
Type I J K L M Value
----------- ----- ----- ----- ----- ----- ----------
1 Stretch H1 C2 1.09238
2 Stretch C2 C3 1.38432
3 Stretch C2 C8 1.37902
4 Stretch C3 C4 1.38250
5 Stretch C3 O19 1.34284
6 Stretch C4 H5 1.09475
7 Stretch C4 C6 1.38271
8 Stretch C6 C7 1.39755
9 Stretch C6 N16 1.45853
10 Stretch C7 C8 1.39976
11 Stretch C7 C9 1.48243
12 Stretch C8 N13 1.45942
13 Stretch C9 H10 1.10140
14 Stretch C9 H11 1.09737
15 Stretch C9 H12 1.09712
16 Stretch N13 O14 1.22142
17 Stretch N13 O15 1.22184
18 Stretch N16 O17 1.22334
19 Stretch N16 O18 1.22153
20 Stretch O19 H20 0.97404
21 Bend H1 C2 C3 121.12997
22 Bend H1 C2 C8 119.27819
23 Bend C3 C2 C8 119.59046
24 Bend C2 C3 C4 118.56331
25 Bend C2 C3 O19 117.98766
26 Bend C4 C3 O19 123.44871
27 Bend C3 C4 H5 122.45770
28 Bend C3 C4 C6 119.87871
29 Bend H5 C4 C6 117.66134
30 Bend C4 C6 C7 124.33592
31 Bend C4 C6 N16 114.73879
32 Bend C7 C6 N16 120.92512
33 Bend C6 C7 C8 112.90966
34 Bend C6 C7 C9 123.68663
35 Bend C8 C7 C9 123.24370
36 Bend C2 C8 C7 124.70369
37 Bend C2 C8 N13 114.85263
38 Bend C7 C8 N13 120.44315
39 Bend C7 C9 H10 110.96201
40 Bend C7 C9 H11 111.08192
41 Bend C7 C9 H12 111.13929
42 Bend H10 C9 H11 106.45139
43 Bend H10 C9 H12 106.73631
44 Bend H11 C9 H12 110.28079
45 Bend C8 N13 O14 117.20061
46 Bend C8 N13 O15 117.37744
47 Bend O14 N13 O15 125.40695
48 Bend C6 N16 O17 117.17258
49 Bend C6 N16 O18 117.67854
50 Bend O17 N16 O18 125.13296
51 Bend C3 O19 H20 110.10139
52 Dihedral H1 C2 C3 C4 178.43160
53 Dihedral H1 C2 C3 O19 -1.37065
54 Dihedral H1 C2 C8 C7 -178.31756
55 Dihedral H1 C2 C8 N13 1.94835
56 Dihedral C2 C3 C4 H5 -178.41089
57 Dihedral C2 C3 C4 C6 1.03080
58 Dihedral C2 C3 O19 H20 179.43892
59 Dihedral C2 C8 C7 C6 -1.12666
60 Dihedral C2 C8 C7 C9 174.42406
61 Dihedral C2 C8 N13 O14 -30.27669
62 Dihedral C2 C8 N13 O15 148.39192
63 Dihedral C3 C2 C8 C7 1.25992
64 Dihedral C3 C2 C8 N13 -178.47417
65 Dihedral C3 C4 C6 C7 -1.02533
66 Dihedral C3 C4 C6 N16 178.82498
67 Dihedral C4 C3 C2 C8 -1.13785
68 Dihedral C4 C3 O19 H20 -0.35293
69 Dihedral C4 C6 C7 C8 1.00354
70 Dihedral C4 C6 C7 C9 -174.52433
71 Dihedral C4 C6 N16 O17 25.18739
72 Dihedral C4 C6 N16 O18 -153.43676
73 Dihedral H5 C4 C3 O19 1.37983
74 Dihedral H5 C4 C6 C7 178.44278
75 Dihedral H5 C4 C6 N16 -1.70691
76 Dihedral C6 C4 C3 O19 -179.17848
77 Dihedral C6 C7 C8 N13 178.59348
78 Dihedral C6 C7 C9 H10 -90.83663
79 Dihedral C6 C7 C9 H11 27.37414
80 Dihedral C6 C7 C9 H12 150.55927
81 Dihedral C7 C6 N16 O17 -154.95671
82 Dihedral C7 C6 N16 O18 26.41914
83 Dihedral C7 C8 N13 O14 149.97687
84 Dihedral C7 C8 N13 O15 -31.35452
85 Dihedral C8 C2 C3 O19 179.05989
86 Dihedral C8 C7 C6 N16 -178.83797
87 Dihedral C8 C7 C9 H10 94.08986
88 Dihedral C8 C7 C9 H11 -147.69936
89 Dihedral C8 C7 C9 H12 -24.51424
90 Dihedral C9 C7 C6 N16 5.63415
91 Dihedral C9 C7 C8 N13 -5.85580
+-----------------+
| Eigenvalue Data |
+-----------------+
Id = 2674
iupac = 4-methyl-3,5-dinitrophenol
mformula = C7H6N2O5
InChI = InChI=1S/C7H6N2O5/c1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h2-3,10H,1H3
smiles = c1c(cc(c(c1N(=O)=O)C)N(=O)=O)O
esmiles = CC1=C(C=C(C=C1[N+](=O)[O-])O)[N+](=O)[O-] ^{0}
theory = dft
xc = lda
basis = 6-311++G(2d,2p)
charge = 0
mult = 1
solvation_type = COSMO
twirl webpage = TwirlMol Link
image webpage = GIF Image Link
Eigevalue Spectra
---- ---- 13.74 eV
- - - - --
-- -- -- -
--- -- ---
-- -- -- -
7 - - - -
6 - - - -
7 - - - -
- - - - --
7 - - - -
8 - - - -
7 - - - -
8 - - - -
- - - - --
- - - - --
--- -- ---
---- ----
---- ---- LUMO= -4.19 eV
HOMO= -6.47 eV ++++++++++
+++ ++ +++
++ ++ ++ +
+++ ++ +++
+++ ++ +++
++++++++++
++++ ++++
+++ ++ +++
+++ ++ +++
++++ ++++
++++++++++
++++++++++
++++++++++
++++++++++
++++++++++
++++++++++
++++++++++
+++ ++ +++
-31.89 eV ++++ ++++
spin eig occ ---------------------------- restricted -31.89 2.00 restricted -31.85 2.00 restricted -27.43 2.00 restricted -27.38 2.00 restricted -27.21 2.00 restricted -23.09 2.00 restricted -21.33 2.00 restricted -20.26 2.00 restricted -19.13 2.00 restricted -17.95 2.00 restricted -17.25 2.00 restricted -15.82 2.00 restricted -15.26 2.00 restricted -14.82 2.00 restricted -14.47 2.00 restricted -14.31 2.00 restricted -13.83 2.00 restricted -13.71 2.00 restricted -13.46 2.00 restricted -13.06 2.00 restricted -12.67 2.00 restricted -12.25 2.00 restricted -11.29 2.00 restricted -10.69 2.00 restricted -10.59 2.00 restricted -10.21 2.00 restricted -9.79 2.00 restricted -9.64 2.00 restricted -9.10 2.00 restricted -8.69 2.00 restricted -8.55 2.00 restricted -8.34 2.00 restricted -8.22 2.00 restricted -7.91 2.00 restricted -7.71 2.00 restricted -7.28 2.00 restricted -6.47 2.00 restricted -4.19 0.00 restricted -4.10 0.00 restricted -1.74 0.00 restricted -1.69 0.00 restricted -0.54 0.00 restricted -0.18 0.00 restricted 0.11 0.00 restricted 0.31 0.00 restricted 0.59 0.00 restricted 0.68 0.00 restricted 0.87 0.00 restricted 1.09 0.00 restricted 1.46 0.00 restricted 1.61 0.00 restricted 1.86 0.00 restricted 1.91 0.00 restricted 2.03 0.00 restricted 2.15 0.00 restricted 2.34 0.00 restricted 2.54 0.00 restricted 2.57 0.00 restricted 2.60 0.00 restricted 2.70 0.00 restricted 2.80 0.00 restricted 2.92 0.00 restricted 3.04 0.00 restricted 3.23 0.00 restricted 3.42 0.00 restricted 3.61 0.00 restricted 3.78 0.00 restricted 3.82 0.00 restricted 3.95 0.00 restricted 4.07 0.00 restricted 4.12 0.00 restricted 4.24 0.00 restricted 4.28 0.00 restricted 4.35 0.00 restricted 4.50 0.00 restricted 4.77 0.00 restricted 4.86 0.00 restricted 5.04 0.00 restricted 5.09 0.00 restricted 5.19 0.00 restricted 5.35 0.00 restricted 5.66 0.00 restricted 5.80 0.00 restricted 5.81 0.00 restricted 5.97 0.00 restricted 6.04 0.00 restricted 6.33 0.00 restricted 6.57 0.00 restricted 6.70 0.00 restricted 6.93 0.00 restricted 7.11 0.00 restricted 7.17 0.00 restricted 7.22 0.00 restricted 7.27 0.00 restricted 7.39 0.00 restricted 7.54 0.00 restricted 7.74 0.00 restricted 7.78 0.00 restricted 7.85 0.00 restricted 8.02 0.00 restricted 8.45 0.00 restricted 8.49 0.00 restricted 8.69 0.00 restricted 8.80 0.00 restricted 8.90 0.00 restricted 9.03 0.00 restricted 9.16 0.00 restricted 9.40 0.00 restricted 9.46 0.00 restricted 9.67 0.00 restricted 9.89 0.00 restricted 10.03 0.00 restricted 10.32 0.00 restricted 10.84 0.00 restricted 11.17 0.00 restricted 11.37 0.00 restricted 11.49 0.00 restricted 11.72 0.00 restricted 12.02 0.00 restricted 12.31 0.00 restricted 12.43 0.00 restricted 12.54 0.00 restricted 12.76 0.00 restricted 12.85 0.00 restricted 12.90 0.00 restricted 13.55 0.00 restricted 13.74 0.00
+----------------------------------------+ | Vibrational Density of States Analysis | +----------------------------------------+ Total number of frequencies = 60 Total number of negative frequencies = 0 Number of lowest frequencies = 17 (frequency threshold = 500 ) Exact dos norm = 54.000 Generating vibrational DOS Generating model vibrational DOS to have a proper norm 10.00 54.00 17.00 54.00 50.00 53.66 16.66 54.00 100.00 53.06 16.06 54.00 Generating IR Spectra Writing vibrational density of states (DOS) to vdos.dat Writing model vibrational density of states (DOS_FIXED) to vdos-model.dat Writing IR spectra to irdos.dat Temperature= 298.15 zero-point correction to energy = 84.030 kcal/mol ( 0.133910) vibrational contribution to enthalpy correction = 89.908 kcal/mol ( 0.143278) vibrational contribution to Entropy = 36.447 cal/mol-k hindered rotor enthalpy correction = 0.000 kcal/mol ( 0.000000) hindered rotor entropy correction = 0.000 cal/mol-k
DOS sigma = 10.000000
- vibrational DOS enthalpy correction = 0.143281 kcal/mol ( 89.910 kcal/mol)
- model vibrational DOS enthalpy correction = 0.143283 kcal/mol ( 89.912 kcal/mol)
- vibrational DOS Entropy = 0.000058 ( 36.569 cal/mol-k)
- model vibrational DOS Entropy = 0.000058 ( 36.572 cal/mol-k)
- original gas Energy = -750.155170 (-470729.473 kcal/mol)
- original gas Enthalpy = -750.008117 (-470637.195 kcal/mol, delta= 0.000)
- unajusted DOS gas Enthalpy = -750.008114 (-470637.193 kcal/mol, delta= 0.002)
- model DOS gas Enthalpy = -750.008112 (-470637.192 kcal/mol, delta= 0.003)
- original gas Entropy = 0.000175 ( 109.841 cal/mol-k,delta= 0.000)
- unajusted DOS gas Entropy = 0.000175 ( 109.963 cal/mol-k,delta= 0.122)
- model DOS gas Entropy = 0.000175 ( 109.966 cal/mol-k,delta= 0.125)
- original gas Free Energy = -750.060306 (-470669.945 kcal/mol, delta= 0.000)
- unadjusted DOS gas Free Energy = -750.060361 (-470669.979 kcal/mol, delta= -0.034)
- model DOS gas Free Energy = -750.060361 (-470669.979 kcal/mol, delta= -0.034)
- original sol Free Energy = -750.083187 (-470684.302 kcal/mol)
- unadjusted DOS sol Free Energy = -750.083241 (-470684.336 kcal/mol)
- model DOS sol Free Energy = -750.083241 (-470684.336 kcal/mol)
DOS sigma = 50.000000
- vibrational DOS enthalpy correction = 0.143083 kcal/mol ( 89.786 kcal/mol)
- model vibrational DOS enthalpy correction = 0.143468 kcal/mol ( 90.027 kcal/mol)
- vibrational DOS Entropy = 0.000059 ( 36.955 cal/mol-k)
- model vibrational DOS Entropy = 0.000060 ( 37.638 cal/mol-k)
- original gas Energy = -750.155170 (-470729.473 kcal/mol)
- original gas Enthalpy = -750.008117 (-470637.195 kcal/mol, delta= 0.000)
- unajusted DOS gas Enthalpy = -750.008312 (-470637.318 kcal/mol, delta= -0.122)
- model DOS gas Enthalpy = -750.007927 (-470637.076 kcal/mol, delta= 0.119)
- original gas Entropy = 0.000175 ( 109.841 cal/mol-k,delta= 0.000)
- unajusted DOS gas Entropy = 0.000176 ( 110.349 cal/mol-k,delta= 0.508)
- model DOS gas Entropy = 0.000177 ( 111.033 cal/mol-k,delta= 1.192)
- original gas Free Energy = -750.060306 (-470669.945 kcal/mol, delta= 0.000)
- unadjusted DOS gas Free Energy = -750.060743 (-470670.218 kcal/mol, delta= -0.274)
- model DOS gas Free Energy = -750.060682 (-470670.181 kcal/mol, delta= -0.236)
- original sol Free Energy = -750.083187 (-470684.302 kcal/mol)
- unadjusted DOS sol Free Energy = -750.083623 (-470684.576 kcal/mol)
- model DOS sol Free Energy = -750.083563 (-470684.538 kcal/mol)
DOS sigma = 100.000000
- vibrational DOS enthalpy correction = 0.142769 kcal/mol ( 89.589 kcal/mol)
- model vibrational DOS enthalpy correction = 0.143848 kcal/mol ( 90.266 kcal/mol)
- vibrational DOS Entropy = 0.000056 ( 35.302 cal/mol-k)
- model vibrational DOS Entropy = 0.000059 ( 37.149 cal/mol-k)
- original gas Energy = -750.155170 (-470729.473 kcal/mol)
- original gas Enthalpy = -750.008117 (-470637.195 kcal/mol, delta= 0.000)
- unajusted DOS gas Enthalpy = -750.008626 (-470637.515 kcal/mol, delta= -0.319)
- model DOS gas Enthalpy = -750.007547 (-470636.838 kcal/mol, delta= 0.358)
- original gas Entropy = 0.000175 ( 109.841 cal/mol-k,delta= 0.000)
- unajusted DOS gas Entropy = 0.000173 ( 108.696 cal/mol-k,delta= -1.145)
- model DOS gas Entropy = 0.000176 ( 110.543 cal/mol-k,delta= 0.702)
- original gas Free Energy = -750.060306 (-470669.945 kcal/mol, delta= 0.000)
- unadjusted DOS gas Free Energy = -750.060272 (-470669.923 kcal/mol, delta= 0.022)
- model DOS gas Free Energy = -750.060070 (-470669.796 kcal/mol, delta= 0.148)
- original sol Free Energy = -750.083187 (-470684.302 kcal/mol)
- unadjusted DOS sol Free Energy = -750.083152 (-470684.280 kcal/mol)
- model DOS sol Free Energy = -750.082950 (-470684.154 kcal/mol)
Normal Mode Frequency (cm-1) IR Intensity (arbitrary)
----------- ---------------- ------------------------
1 0.000 0.140
2 0.000 0.092
3 0.000 0.055
4 0.000 0.042
5 0.000 0.003
6 0.000 0.146
7 45.650 0.286
8 55.180 0.523
9 99.830 0.503
10 153.790 0.189
11 174.620 0.336
12 180.600 0.504
13 206.980 1.727
14 242.900 0.748
15 323.940 0.131
16 327.310 0.160
17 362.180 0.408
18 388.480 25.405
19 391.940 4.121
20 435.670 1.565
21 464.090 0.720
22 479.220 0.338
23 480.990 0.138
24 581.630 3.909
25 645.530 1.097
26 665.570 0.101
27 734.580 9.857
28 756.840 5.181
29 773.880 0.236
30 786.730 3.613
31 812.570 3.842
32 856.830 4.958
33 880.380 2.391
34 911.400 12.273
35 993.600 0.497
36 997.030 4.013
37 999.640 5.610
38 1079.020 0.452
39 1136.520 25.572
40 1187.300 26.155
41 1198.300 7.960
42 1308.480 22.332
43 1340.950 7.354
44 1357.600 43.053
45 1368.670 73.367
46 1374.120 29.506
47 1395.280 1.573
48 1419.960 11.630
49 1452.140 3.074
50 1499.640 27.133
51 1576.740 34.524
52 1586.050 133.314
53 1603.690 5.346
54 1662.710 10.080
55 2984.370 0.643
56 3045.830 0.543
57 3079.100 0.644
58 3098.420 3.640
59 3130.390 4.548
60 3712.930 31.699
No Hindered Rotor Data
+-------------------------------------+
| Reactions Contained in the Database |
+-------------------------------------+
Reactions Containing INCHIKEY = HTAMNOAYOHLVPQ-UHFFFAOYSA-N
Reactionid Erxn(gas) Hrxn(gas) Grxn(gas) delta_Solv Grxn(aq) ReactionType Reaction
21620 327.659 320.477 313.638 -295.145 18.493 AB --> A + B "TNT-4-OH --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C ^{-1} + [H] ^{1}"
21619 327.659 320.477 313.638 -295.145 18.493 AB --> A + B "TNT-4-OH --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C ^{-1} + [H] ^{1}"
20716 -1.968 -1.960 -3.629 0.000 -3.629 EA + BCD --> AB + CDE "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
20480 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20479 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20478 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20477 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20359 -53.135 -52.859 -55.729 14.850 -40.879 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> TNT-4-OH solvation_type{COSMO-SMD:acetone} + nitrite solvation_type{COSMO-SMD:acetone}"
20358 -47.358 -46.917 -49.701 0.000 -49.701 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw} + O=N[O-] theory{pspw}"
20322 -50.850 -50.577 -52.654 23.427 -29.226 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
20233 -54.421 -54.152 -57.022 24.340 -32.682 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> TNT-4-OH solvation_type{COSMO-SMD:o-cresol} + nitrite solvation_type{COSMO-SMD:o-cresol}"
20207 -2.221 -2.219 -3.963 -0.074 -4.038 EA + BCD --> AB + CDE "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
20171 -1.190 -1.279 -2.131 4.538 2.407 EA + BCD --> AB + CDE "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
20152 -51.490 -51.274 -53.683 27.010 -26.673 AB + C --> AC + B "TNT xc{pbe} solvation_type{COSMO-SMD:methanol} + hydroxide xc{pbe} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD:methanol} + nitrite xc{pbe} solvation_type{COSMO-SMD:methanol}"
20149 -54.632 -54.405 -56.421 31.856 -24.565 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
20148 -61.488 -61.419 -64.231 24.117 -40.114 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
20147 -51.017 -50.737 -53.291 0.000 -53.291 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{pspw4} + hydroxide ^{-1} theory{pspw4} --> Oc1cc(O)c(c(c1)N(=O)=O)C theory{pspw4} + O=[N]=O ^{-1} theory{pspw4}"
20113 -50.850 -50.577 -52.654 30.597 -22.056 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
20112 -0.803 -0.742 -2.687 0.000 -2.687 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
20111 -47.895 -47.456 -50.524 0.000 -50.524 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + [OH-] theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=N[O-] theory{pspw4}"
20110 -54.421 -54.153 -57.023 28.340 -28.683 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O solvation_type{COSMO-SMD} + [OH-] solvation_type{COSMO-SMD} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O solvation_type{COSMO-SMD} + O=N[O-] solvation_type{COSMO-SMD}"
20013 -2.828 -2.854 -4.012 0.000 -4.012 EA + BCD --> AB + CDE "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
19902 -52.474 -52.848 -54.908 45.934 -8.974 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
19896 -2.968 -3.470 -5.156 1.224 -3.932 EA + BCD --> AB + CDE "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
19851 -4.053 -4.219 -6.003 1.365 -4.638 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
19758 -64.482 -62.739 -51.927 51.388 -0.539 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
19711 -70.571 -68.041 -57.292 51.724 -5.568 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{m06-2x}"
19690 -57.697 -58.024 -60.957 21.754 -39.203 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O=N[O-] xc{m06-2x}"
19612 -51.490 -51.275 -53.685 29.590 -24.094 AB + C --> AC + B "TNT xc{pbe} + [OH-] xc{pbe} --> TNT-4-OH xc{pbe} + nitrite xc{pbe}"
18718 20.367 19.746 19.852 -1.712 18.140 EA + BCD --> AB + CDE "TNT-4-OH --> [O][CH]1=CC(=C(C(=C1)N(=O)=O)C)N(=O)=O"
18294 -48.434 -48.154 -50.230 30.537 -19.693 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
17493 53.390 53.134 55.156 -29.926 25.230 AB + C --> AC + B "Cc1c(O)cc(O)cc1N(=O)=O + O=N[O-] --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-]"
17202 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17201 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17200 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17199 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17184 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
17183 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
17182 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
17181 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
16512 -58.235 -58.032 -60.692 28.350 -32.342 AB + C --> AC + B "TNT xc{pbe0} solvation_type{COSMO-SMD} + hydroxide xc{pbe0} solvation_type{COSMO-SMD} --> TNT-4-OH xc{pbe0} solvation_type{COSMO-SMD} + nitrite xc{pbe0} solvation_type{COSMO-SMD}"
16431 -59.037 -58.822 -61.390 27.550 -33.840 AB + C --> AC + B "TNT xc{pbe} solvation_type{COSMO-SMD} + hydroxide xc{pbe} solvation_type{COSMO-SMD} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD} + nitrite xc{pbe} solvation_type{COSMO-SMD}"
14760 20.367 19.746 19.852 -1.712 18.140 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O --> CC1=C(N(=O)=O)CC(=O)C=C1N(=O)=O"
14717 -53.156 -52.796 -54.296 26.265 -28.031 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + [OH-] theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=N[O-] theory{ccsd(t)}"
13478 -53.390 -53.134 -55.156 29.926 -25.230 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(O)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
13473 -4.059 -4.188 -5.876 1.293 -4.583 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
13462 -1.190 -1.279 -2.131 4.468 2.337 EA + BCD --> AB + CDE "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
12445 -56.957 -56.636 -58.320 28.835 -29.485 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe0} + O=[N]=O ^{-1} xc{pbe0}"
12417 -61.996 -60.282 -49.145 53.623 4.478 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe0}"
11672 -52.318 -52.705 -53.948 49.770 -4.178 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O xc{pbe0}"
11669 -54.955 -54.687 -57.040 26.204 -30.836 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O=N[O-] xc{pbe0}"
11640 -67.282 -64.755 -53.837 55.961 2.124 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe0}"
11579 -30.647 -30.979 -32.709 45.832 13.123 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe0} + O xc{pbe0}"
11519 -54.421 -54.152 -57.022 25.370 -31.652 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:ethanol} + hydroxide solvation_type{COSMO-SMD:ethanol} --> TNT-4-OH solvation_type{COSMO-SMD:ethanol} + nitrite solvation_type{COSMO-SMD:ethanol}"
11354 -54.421 -54.152 -57.022 15.290 -41.732 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:edc12} + hydroxide solvation_type{COSMO-SMD:edc12} --> TNT-4-OH solvation_type{COSMO-SMD:edc12} + nitrite solvation_type{COSMO-SMD:edc12}"
11238 -53.565 -53.292 -56.162 24.340 -31.822 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> TNT-4-OH solvation_type{COSMO-SMD:o-cresol} + nitrite solvation_type{COSMO-SMD:o-cresol}"
11237 -53.565 -53.292 -56.162 14.850 -41.312 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> TNT-4-OH solvation_type{COSMO-SMD:acetone} + nitrite solvation_type{COSMO-SMD:acetone}"
10902 -62.518 -60.919 -49.619 52.924 3.305 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe}"
10866 -61.488 -61.419 -64.231 29.967 -34.264 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
10864 -69.399 -69.726 -70.391 53.901 -16.490 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc([O-])cc1N(=O)=O + O"
10817 -70.572 -68.042 -57.292 57.574 0.282 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{m06-2x}"
10701 -66.425 -64.151 -53.032 55.672 2.640 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe}"
10693 -51.490 -51.269 -53.733 24.790 -28.944 AB + C --> AC + B "TNT xc{pbe} + [OH-] xc{pbe} --> TNT-4-OH xc{pbe} + nitrite xc{pbe}"
10692 -57.701 -57.963 -61.028 27.194 -33.834 AB + C --> AC + B "TNT xc{m06-2x} + [OH-] xc{m06-2x} --> TNT-4-OH xc{m06-2x} + nitrite xc{m06-2x}"
10691 -54.632 -54.404 -56.421 29.005 -27.415 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
10655 -64.483 -62.739 -51.927 57.238 5.311 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
10451 -2.970 -3.408 -5.229 0.734 -4.495 EA + BCD --> AB + CDE "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
9709 -55.347 -55.709 -56.516 49.169 -7.347 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + O xc{pbe}"
9645 -52.474 -52.848 -54.908 51.784 -3.124 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
9637 -67.282 -64.755 -53.837 56.021 2.184 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe0}"
9378 -30.072 -30.528 -31.548 46.724 15.176 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
8953 -59.555 -57.237 -47.295 0.000 -47.295 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O theory{pspw4} xc(pbe}"
7872 -29.376 -29.915 -31.360 45.991 14.631 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
7823 -30.647 -30.979 -32.709 45.892 13.183 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe0} + O xc{pbe0}"
7822 -29.376 -29.917 -31.361 46.041 14.680 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
7821 -52.477 -52.839 -54.878 51.785 -3.094 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
7816 -52.318 -52.705 -53.948 49.830 -4.118 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O xc{pbe0}"
7764 -65.729 -63.537 -52.843 54.938 2.095 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe}"
7688 -25.000 -25.513 -27.595 0.000 -27.595 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O theory{pspw4} xc(pbe} + O theory{pspw4} xc(pbe}"
7687 -51.283 -52.052 -53.963 0.000 -53.963 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + O theory{pspw4} xc(pbe}"
7646 -55.616 -53.708 -43.300 0.000 -43.300 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> CC1(O)C(N(=O)=O)=CC(O)=C[C-]1N(=O)=O theory{pspw4} xc(pbe}"
7623 -5.741 -5.819 -5.704 4.228 -1.476 EA + BCD --> AB + CDE "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
7558 -1.025 -1.052 -2.187 0.184 -2.003 EA + BCD --> AB + CDE "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
6923 -54.421 -54.169 -56.623 28.810 -27.813 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O solvation_type{COSMO-SMD} + [OH-] solvation_type{COSMO-SMD} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O solvation_type{COSMO-SMD} + O=N[O-] solvation_type{COSMO-SMD}"
6577 -39.920 -38.700 -38.749 22.697 -16.052 AB + C --> AC + B "Sc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + [SH] ^{-1}"
6496 -61.491 -61.410 -64.202 29.968 -34.234 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
6495 -56.957 -56.636 -58.320 28.895 -29.425 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe0} + O=[N]=O ^{-1} xc{pbe0}"
6494 -53.936 -53.791 -56.232 28.272 -27.960 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
6493 -64.485 -62.730 -51.897 57.239 5.341 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
6492 -61.753 -59.977 -48.904 53.494 4.590 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe0}"
6491 -61.822 -60.306 -49.430 52.191 2.761 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe}"
6412 -2.968 -3.473 -5.161 1.870 -3.291 EA + BCD --> AB + CDE "TNT xc{m06-2x} solvation_type{COSMO-SMD:methanol} + water xc{m06-2x} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{m06-2x} solvation_type{COSMO-SMD:methanol} + nitrous acid xc{m06-2x} solvation_type{COSMO-SMD:methanol}"
6411 -2.221 -2.297 -3.997 2.740 -1.257 EA + BCD --> AB + CDE "TNT xc{b3lyp} solvation_type{COSMO-SMD:methanol} + water xc{b3lyp} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{b3lyp} solvation_type{COSMO-SMD:methanol} + nitrous acid xc{b3lyp} solvation_type{COSMO-SMD:methanol}"
6390 -57.697 -58.024 -60.957 28.170 -32.787 AB + C --> AC + B "TNT xc{m06-2x} solvation_type{COSMO-SMD:methanol} + hydroxide xc{m06-2x} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{m06-2x} solvation_type{COSMO-SMD:methanol} + nitrite xc{m06-2x} solvation_type{COSMO-SMD:methanol}"
6389 -51.490 -51.274 -53.683 27.110 -26.573 AB + C --> AC + B "TNT xc{pbe} solvation_type{COSMO-SMD:methanol} + hydroxide xc{pbe} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD:methanol} + nitrite xc{pbe} solvation_type{COSMO-SMD:methanol}"
6209 -54.421 -54.152 -57.022 8.950 -48.072 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:toluene} + hydroxide solvation_type{COSMO-SMD:toluene} --> TNT-4-OH solvation_type{COSMO-SMD:toluene} + nitrite solvation_type{COSMO-SMD:toluene}"
6206 -54.421 -54.152 -57.022 27.980 -29.042 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:methanol} + hydroxide solvation_type{COSMO-SMD:methanol} --> TNT-4-OH solvation_type{COSMO-SMD:methanol} + nitrite solvation_type{COSMO-SMD:methanol}"
5969 -61.247 -58.827 -47.398 56.483 9.084 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O"
5935 -29.909 -30.400 -30.743 47.393 16.650 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O + O"
5817 -57.941 -57.674 -58.729 29.686 -29.043 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(O)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
5727 -0.369 -0.434 -2.854 0.000 -2.854 EA + BCD --> AB + CDE "TNT theory{pspw4} xc{pbe0} + water theory{pspw4} xc{pbe0} --> TNT-4-OH theory{pspw4} xc{pbe0} + nitrous acid theory{pspw4} xc{pbe0}"
5689 -15.921 -17.075 -19.446 5.314 -14.132 AB + C --> AC + B "TNT-4-OH + [SH-] ^{-1} --> Oc1cc(S)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
5097 408.443 401.540 394.998 -257.634 38.764 AB --> A + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C mult{2} + [H] ^{1} + [SHE]"
5096 408.443 401.540 394.998 -257.634 38.764 AB --> A + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C mult{2} + [H] ^{1} + [SHE]"
5056 -2.809 -2.853 -4.021 0.000 -4.021 EA + BCD --> AB + CDE "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
5043 -1.831 -1.817 -2.147 0.767 -1.380 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + O theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=NO theory{ccsd(t)}"
5042 -0.663 -0.662 -2.359 0.000 -2.359 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
5038 2.758 2.772 2.442 0.767 3.209 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + O theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=NO theory{mp2}"
5002 -52.557 -53.011 -53.497 50.228 -3.269 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)[CH2] ^{-1} + O"
4997 48.139 46.875 48.199 -8.330 39.869 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc([N](=O)O)c(c(c1)N(=O)=O)C"
4281 -2.967 -3.417 -5.258 0.733 -4.526 EA + BCD --> AB + CDE "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
3940 -52.102 -51.850 -55.468 0.000 -55.468 AB + C --> AC + B "TNT theory{pspw4} xc{pbe0} + hydroxide theory{pspw4} xc{pbe0} --> TNT-4-OH theory{pspw4} xc{pbe0} + nitrite theory{pspw4} xc{pbe0}"
3081 -56.170 -54.497 -42.973 53.382 10.410 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1}"
2419 -0.637 -0.591 -2.169 0.000 -2.169 EA + BCD --> AB + CDE "TNT theory{pspw} xc{pbe0} + water theory{pspw} xc{pbe0} --> TNT-4-OH theory{pspw} xc{pbe0} + nitrous acid theory{pspw} xc{pbe0}"
2418 -2.447 9.507 15.426 3.595 19.020 EA + BCD --> AB + CDE "TNT xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> TNT-4-OH xc{pbe0} basis{6-31G*} + nitrous acid xc{pbe0} basis{6-31G*}"
2304 -4.059 -4.187 -5.875 1.313 -4.562 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
2179 -1.025 -1.051 -2.186 0.143 -2.043 EA + BCD --> AB + CDE "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
1962 -2.221 -2.219 -3.963 -0.144 -4.108 EA + BCD --> AB + CDE "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
1264 -51.157 -50.817 -53.618 0.000 -53.618 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{pspw4} + hydroxide ^{-1} theory{pspw4} --> Oc1cc(O)c(c(c1)N(=O)=O)C theory{pspw4} + O=[N]=O ^{-1} theory{pspw4}"
1214 -48.218 -47.811 -50.084 0.000 -50.084 AB + C --> AC + B "TNT theory{pspw} + hydroxide theory{pspw} --> TNT-4-OH theory{pspw} + nitrite theory{pspw}"
1183 -52.545 -52.314 -54.886 27.482 -27.404 AB + C --> AC + B "TNT theory{dft} xc{blyp} parse_output{grxn(gas)} + hydroxide theory{dft} xc{blyp} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{blyp} parse_output{grxn(gas)} + nitrite theory{dft} xc{blyp} parse_output{grxn(gas)}"
1164 -2.967 -3.417 -5.258 0.733 -4.526 EA + BCD --> AB + CDE "TNT xc{m06-2x} parse_output{grxn(aq)} + water xc{m06-2x} parse_output{grxn(aq)} --> TNT-4-OH xc{m06-2x} parse_output{grxn(aq)} + N(=O)O xc{m06-2x} parse_output{grxn(aq)}"
1163 -2.809 -2.853 -4.021 0.000 -4.021 EA + BCD --> AB + CDE "TNT theory{pspw} parse_output{grxn(aq)} + water theory{pspw} parse_output{grxn(aq)} --> TNT-4-OH theory{pspw} parse_output{grxn(aq)} + N(=O)O theory{pspw} parse_output{grxn(aq)}"
1155 -57.698 -57.972 -61.057 27.193 -33.864 AB + C --> AC + B "TNT theory{dft} xc{m06-2x} parse_output{grxn(gas)} + hydroxide theory{dft} xc{m06-2x} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{m06-2x} parse_output{grxn(gas)} + nitrite theory{dft} xc{m06-2x} parse_output{grxn(gas)}"
1154 -52.186 -51.883 -53.922 25.523 -28.399 AB + C --> AC + B "TNT theory{dft} xc{pbe} parse_output{grxn(gas)} + hydroxide theory{dft} xc{pbe} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{pbe} parse_output{grxn(gas)} + nitrite theory{dft} xc{pbe} parse_output{grxn(gas)}"
370 -2.887 -3.709 -6.472 1.215 -5.257 EA + BCD --> AB + CDE "TNT xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> TNT-4-OH xc{pbe0} basis{6-31G*} + nitrous acid xc{pbe0} basis{6-31G*}"
348 -4.059 -4.187 -5.875 1.313 -4.562 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
336 -1.025 -1.051 -2.186 0.143 -2.043 EA + BCD --> AB + CDE "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
335 -0.637 -0.591 -2.169 0.000 -2.169 EA + BCD --> AB + CDE "TNT theory{pspw} xc{pbe0} + water theory{pspw} xc{pbe0} --> TNT-4-OH theory{pspw} xc{pbe0} + nitrous acid theory{pspw} xc{pbe0}"
138 -53.156 -52.795 -54.296 26.345 -27.950 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + [OH-] theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=N[O-] theory{ccsd(t)}"
137 -1.831 -1.817 -2.147 0.767 -1.380 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + O theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=NO theory{ccsd(t)}"
136 2.758 2.772 2.442 0.767 3.209 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + O theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=NO theory{mp2}"
135 -0.663 -0.662 -2.359 0.000 -2.359 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
134 -47.755 -47.375 -50.196 0.000 -50.196 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + [OH-] theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=N[O-] theory{pspw4}"
133 -15.375 -14.981 -17.251 0.000 -17.251 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw} + O=N[O-] theory{pspw}"
132 -65.996 -65.741 -69.320 966.667 897.347 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pm3} + [OH-] theory{pm3} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pm3} + O=N[O-] theory{pm3}"
131 -52.186 -51.883 -53.922 25.534 -28.388 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + O=N[O-] xc{pbe}"
130 -57.696 -57.969 -61.054 27.133 -33.921 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O=N[O-] xc{m06-2x}"
129 -49.153 -48.792 -50.293 26.345 -23.947 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + [OH-] theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=N[O-] theory{mp2}"
128 -54.955 -54.688 -57.042 26.274 -30.768 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O=N[O-] xc{pbe0}"
127 -50.850 -50.577 -52.653 27.886 -24.767 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
15 -54.422 -54.074 -56.988 25.304 -31.685 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + O=N[O-]"
1 -2.221 -2.219 -3.963 -0.144 -4.108 EA + BCD --> AB + CDE "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
All requests to Arrows were successful.
KEYWORDs -
reaction: :reaction
chinese_room: :chinese_room
molecule: :molecule
nmr: :nmr
predict: :predict
submitesmiles: :submitesmiles
nosubmitmissingesmiles
resubmitmissingesmiles
submitmachines: :submitmachines
useallentries
nomodelcorrect
eigenvalues: :eigenvalues
frequencies: :frequencies
nwoutput: :nwoutput
xyzfile: :xyzfile
alleigs: :alleigs
allfreqs: :allfreqs
reactionenumerate:
energytype:[erxn(gas) hrxn(gas) grxn(gas) delta_solvation grxn(aq)] :energytype
energytype:[kcal/mol kj/mol ev cm-1 ry hartree au] :energytype
tablereactions:
reaction: ... :reaction
reaction: ... :reaction
...
:tablereactions
tablemethods:
method: ... :method
method: ... :method
...
:tablemethods
:reactionenumerate
rotatebonds
xyzinput:
label: :label
xyzdata:
... xyz data ...
:xyzdata
:xyzinput
submitHf: :submitHf
nmrexp: :nmrexp
findreplace: old text | new text :findreplace
listnwjobs
fetchnwjob: :fetchnwjob
pushnwjob: :pushnwjob
printcsv: :printcsv
printeig: :printeig
printfreq: :printfreq
printxyz: :printxyz
printjobinfo: :printjobinfo
printnwout: :printnwout
badids: :badids
hup_string:
database:
table:
request_table:
listallesmiles
queuecheck
This software service and its documentation were developed at the Environmental Molecular Sciences Laboratory (EMSL) at Pacific Northwest National Laboratory, a multiprogram national laboratory, operated for the U.S. Department of Energy by Battelle under Contract Number DE-AC05-76RL01830. Support for this work was provided by the Department of Energy Office of Biological and Environmental Research, and Department of Defense environmental science and technology program (SERDP). THE SOFTWARE SERVICE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE SERVICE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE SERVICE.