3D Periodic Editor 3D Molecular And Reaction Editor Expert Editor Microsoft Quantum Editor EMSL Aerosol Workshop Editor Manual 3D Periodic Editor 3D Molecular And Reaction Editor Expert Editor Microsoft Quantum Editor EMSL Aerosol Workshop Editor Manual Results from an EMSL Arrows Calculation
| EMSL Arrows is a revolutionary approach to materials and chemical simulations that uses NWChem and chemical computational databases to make materials and chemical modeling accessible via a broad spectrum of digital communications including posts to web APIs, social networks, and traditional email. |
Molecular modeling software has previously been extremely complex, making it prohibative to all but experts in the field, yet even experts can struggle to perform calculations. This service is designed to be used by experts and non-experts alike. Experts can carry out and keep track of large numbers of complex calculations with diverse levels of theories present in their workflows. Additionally, due to a streamlined and easy-to-use input, non-experts can carry out a wide variety of molecular modeling calculations previously not accessible to them.
The id(s) for emsiles = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{dft} xc{pbe} basis{6-31G*} solvation_type{COSMO} ^{0} are: 11633
Use id=% instead of esmiles to print other entries.
mformula = C7H6N2O5
iupac = 4-methyl-3,5-dinitrophenol
PubChem = 46156
PubChem LCSS = 46156
cas = 264-594-5
synonyms = 3,5-Dinitro-p-cresol; p-CRESOL, 3,5-DINITRO-; EINECS 264-594-5; 63989-82-2; AC1L2FH3; 4-methyl-3,5-dinitrophenol; SCHEMBL11273954; CTK8J7965; MolPort-006-133-202; AKOS004121770; MCULE-6898436842; LS-55391; OR049346; OR118703
Search Links to Other Online Resources (may not be available):
- Google Structure Search
- EPA CompTox Database
- Chemical Entities of Biological Interest (ChEBI)
- NIH ChemIDplus - A TOXNET DATABASE
- The Human Metabolome Database (HMDB)
- OECD eChemPortal
- Google Scholar
+==================================================+
|| Molecular Calculation ||
+==================================================+
Id = 11633
NWOutput = Link to NWChem Output (download)
Datafiles:
mo_orbital_nwchemarrows-2020-11-16-21-28-108384.out-228880-2020-11-16-21:37:2 (download)
homo-restricted.cube-228880-2020-11-16-21:37:2 (download)
lumo-restricted.cube-228880-2020-11-16-21:37:2 (download)
cosmo.xyz-228880-2020-11-16-21:37:2 (download)
image_resset: api/image_reset/11633
Calculation performed by node003.local
Numbers of cpus used for calculation = 24
Calculation walltime = 1260.100000 seconds (0 days 0 hours 21 minutes 0 seconds)
+----------------+
| Energetic Data |
+----------------+
Id = 11633
iupac = 4-methyl-3,5-dinitrophenol
mformula = C7H6N2O5
inchi = InChI=1S/C7H6N2O5/c1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h2-3,10H,1H3
inchikey = HTAMNOAYOHLVPQ-UHFFFAOYSA-N
esmiles = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{dft} xc{pbe} basis{6-31G*} solvation_type{COSMO} ^{0}
calculation_type = ovc
theory = dft
xc = pbe
basis = 6-31G*
charge,mult = 0 1
energy = -754.983730 Hartrees
enthalpy correct.= 0.147020 Hartrees
entropy = 112.015 cal/mol-K
solvation energy = -13.566 kcal/mol solvation_type = COSMO
Sitkoff cavity dispersion = 2.634 kcal/mol
Honig cavity dispersion = 8.870 kcal/mol
ASA solvent accesible surface area = 354.804 Angstrom2
ASA solvent accesible volume = 337.489 Angstrom3
+-----------------+
| Structural Data |
+-----------------+
JSmol: an open-source HTML5 viewer for chemical structures in 3D
Number of Atoms = 20
Units are Angstrom for bonds and degrees for angles
Type I J K L M Value
----------- ----- ----- ----- ----- ----- ----------
1 Stretch C1 C2 1.50989
2 Stretch C1 H15 1.10160
3 Stretch C1 H16 1.10140
4 Stretch C1 H17 1.09539
5 Stretch C2 C3 1.41738
6 Stretch C2 C7 1.41798
7 Stretch C3 C4 1.40085
8 Stretch C3 N12 1.48808
9 Stretch C4 C5 1.39945
10 Stretch C4 H18 1.09354
11 Stretch C5 C6 1.40220
12 Stretch C5 O11 1.36224
13 Stretch C6 C7 1.39679
14 Stretch C6 H19 1.09173
15 Stretch C7 N8 1.48879
16 Stretch N8 O9 1.23948
17 Stretch N8 O10 1.23876
18 Stretch O11 H20 0.97955
19 Stretch N12 O13 1.23915
20 Stretch N12 O14 1.24161
21 Bend C2 C1 H15 111.10663
22 Bend C2 C1 H16 110.26002
23 Bend C2 C1 H17 111.07744
24 Bend H15 C1 H16 106.08312
25 Bend H15 C1 H17 108.35178
26 Bend H16 C1 H17 109.82223
27 Bend C1 C2 C3 123.82932
28 Bend C1 C2 C7 123.14724
29 Bend C3 C2 C7 112.99140
30 Bend C2 C3 C4 124.19989
31 Bend C2 C3 N12 121.48042
32 Bend C4 C3 N12 114.31887
33 Bend C3 C4 C5 119.83060
34 Bend C3 C4 H18 118.12356
35 Bend C5 C4 H18 122.04584
36 Bend C4 C5 C6 118.75530
37 Bend C4 C5 O11 123.63508
38 Bend C6 C5 O11 117.60963
39 Bend C5 C6 C7 119.45793
40 Bend C5 C6 H19 120.48279
41 Bend C7 C6 H19 120.05660
42 Bend C2 C7 C6 124.67277
43 Bend C2 C7 N8 121.55485
44 Bend C6 C7 N8 113.77234
45 Bend C7 N8 O9 117.91655
46 Bend C7 N8 O10 116.68144
47 Bend O9 N8 O10 125.35500
48 Bend C5 O11 H20 108.67354
49 Bend C3 N12 O13 118.38877
50 Bend C3 N12 O14 117.01441
51 Bend O13 N12 O14 124.59178
52 Dihedral C1 C2 C3 C4 178.77233
53 Dihedral C1 C2 C3 N12 -1.57678
54 Dihedral C1 C2 C7 C6 -175.88400
55 Dihedral C1 C2 C7 N8 4.18965
56 Dihedral C2 C3 C4 C5 -2.39706
57 Dihedral C2 C3 C4 H18 177.60745
58 Dihedral C2 C3 N12 O13 22.24830
59 Dihedral C2 C3 N12 O14 -158.53044
60 Dihedral C2 C7 C6 C5 -3.35561
61 Dihedral C2 C7 C6 H19 177.23632
62 Dihedral C2 C7 N8 O9 44.24596
63 Dihedral C2 C7 N8 O10 -138.11283
64 Dihedral C3 C2 C1 H15 50.97098
65 Dihedral C3 C2 C1 H16 -66.35275
66 Dihedral C3 C2 C1 H17 171.66555
67 Dihedral C3 C2 C7 C6 2.12664
68 Dihedral C3 C2 C7 N8 -177.79971
69 Dihedral C3 C4 C5 C6 1.14190
70 Dihedral C3 C4 C5 O11 -178.86306
71 Dihedral C4 C3 C2 C7 0.77743
72 Dihedral C4 C3 N12 O13 -158.06857
73 Dihedral C4 C3 N12 O14 21.15270
74 Dihedral C4 C5 C6 C7 1.55620
75 Dihedral C4 C5 C6 H19 -179.03831
76 Dihedral C4 C5 O11 H20 -0.04717
77 Dihedral C5 C4 C3 N12 177.92966
78 Dihedral C5 C6 C7 N8 176.57581
79 Dihedral C6 C5 C4 H18 -178.86279
80 Dihedral C6 C5 O11 H20 179.94792
81 Dihedral C6 C7 N8 O9 -135.68785
82 Dihedral C6 C7 N8 O10 41.95336
83 Dihedral C7 C2 C1 H15 -131.23369
84 Dihedral C7 C2 C1 H16 111.44258
85 Dihedral C7 C2 C1 H17 -10.53912
86 Dihedral C7 C2 C3 N12 -179.57168
87 Dihedral C7 C6 C5 O11 -178.43913
88 Dihedral N8 C7 C6 H19 -2.83226
89 Dihedral O11 C5 C4 H18 1.13225
90 Dihedral O11 C5 C6 H19 0.96635
91 Dihedral N12 C3 C4 H18 -2.06583
+-----------------+
| Eigenvalue Data |
+-----------------+
Id = 11633
iupac = 4-methyl-3,5-dinitrophenol
mformula = C7H6N2O5
InChI = InChI=1S/C7H6N2O5/c1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h2-3,10H,1H3
smiles = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C
esmiles = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{dft} xc{pbe} basis{6-31G*} solvation_type{COSMO} ^{0}
theory = dft
xc = pbe
basis = 6-31G*
charge = 0
mult = 1
solvation_type = COSMO
twirl webpage = TwirlMol Link
image webpage = GIF Image Link
Eigevalue Spectra
---- ---- 13.84 eV
---- ----
---- ----
---- ----
----------
----------
---- ----
---- ----
---- ----
-- -- -- -
----------
--- -- ---
---- ----
----------
---- ----
---- ---- LUMO= -3.48 eV
HOMO= -5.80 eV ++++++++++
++++++++++
++ ++ ++ +
+++ ++ +++
++++ ++++
+++ ++ +++
++++++++++
++++ ++++
++ ++ ++ +
++++ ++++
++++ ++++
++++++++++
++++++++++
++++++++++
++++++++++
++++++++++
++++++++++
++++++++++
+++ ++ +++
-31.05 eV ++++ ++++
spin eig occ ---------------------------- restricted -31.05 2.00 restricted -30.93 2.00 restricted -26.69 2.00 restricted -26.67 2.00 restricted -26.52 2.00 restricted -22.38 2.00 restricted -20.61 2.00 restricted -19.68 2.00 restricted -18.51 2.00 restricted -17.41 2.00 restricted -16.76 2.00 restricted -15.24 2.00 restricted -14.72 2.00 restricted -14.13 2.00 restricted -13.57 2.00 restricted -13.28 2.00 restricted -13.04 2.00 restricted -12.96 2.00 restricted -12.74 2.00 restricted -12.40 2.00 restricted -12.00 2.00 restricted -11.62 2.00 restricted -10.54 2.00 restricted -10.21 2.00 restricted -9.96 2.00 restricted -9.61 2.00 restricted -9.31 2.00 restricted -9.05 2.00 restricted -8.38 2.00 restricted -7.90 2.00 restricted -7.78 2.00 restricted -7.61 2.00 restricted -7.42 2.00 restricted -7.20 2.00 restricted -6.78 2.00 restricted -6.63 2.00 restricted -5.80 2.00 restricted -3.48 0.00 restricted -3.37 0.00 restricted -1.21 0.00 restricted -1.03 0.00 restricted 1.12 0.00 restricted 1.75 0.00 restricted 2.31 0.00 restricted 2.69 0.00 restricted 2.94 0.00 restricted 3.26 0.00 restricted 3.99 0.00 restricted 4.33 0.00 restricted 4.48 0.00 restricted 4.90 0.00 restricted 5.11 0.00 restricted 5.51 0.00 restricted 5.77 0.00 restricted 6.79 0.00 restricted 6.92 0.00 restricted 7.29 0.00 restricted 7.58 0.00 restricted 9.60 0.00 restricted 10.42 0.00 restricted 10.64 0.00 restricted 11.01 0.00 restricted 12.25 0.00 restricted 12.36 0.00 restricted 12.62 0.00 restricted 13.38 0.00 restricted 13.56 0.00 restricted 13.84 0.00
+----------------------------------------+ | Vibrational Density of States Analysis | +----------------------------------------+ Total number of frequencies = 60 Total number of negative frequencies = 0 Number of lowest frequencies = 16 (frequency threshold = 500 ) Exact dos norm = 54.000 Generating vibrational DOS Generating model vibrational DOS to have a proper norm 10.00 54.00 15.99 54.00 50.00 53.53 15.53 54.00 100.00 52.92 14.92 54.00 Generating IR Spectra Writing vibrational density of states (DOS) to vdos.dat Writing model vibrational density of states (DOS_FIXED) to vdos-model.dat Writing IR spectra to irdos.dat Temperature= 298.15 zero-point correction to energy = 83.842 kcal/mol ( 0.133611) vibrational contribution to enthalpy correction = 89.888 kcal/mol ( 0.143245) vibrational contribution to Entropy = 38.523 cal/mol-k hindered rotor enthalpy correction = 0.000 kcal/mol ( 0.000000) hindered rotor entropy correction = 0.000 cal/mol-k
DOS sigma = 10.000000
- vibrational DOS enthalpy correction = 0.143248 kcal/mol ( 89.890 kcal/mol)
- model vibrational DOS enthalpy correction = 0.143252 kcal/mol ( 89.892 kcal/mol)
- vibrational DOS Entropy = 0.000062 ( 38.734 cal/mol-k)
- model vibrational DOS Entropy = 0.000062 ( 38.741 cal/mol-k)
- original gas Energy = -754.983730 (-473759.440 kcal/mol)
- original gas Enthalpy = -754.836710 (-473667.183 kcal/mol, delta= 0.000)
- unajusted DOS gas Enthalpy = -754.836707 (-473667.181 kcal/mol, delta= 0.002)
- model DOS gas Enthalpy = -754.836703 (-473667.179 kcal/mol, delta= 0.005)
- original gas Entropy = 0.000179 ( 112.015 cal/mol-k,delta= 0.000)
- unajusted DOS gas Entropy = 0.000179 ( 112.225 cal/mol-k,delta= 0.210)
- model DOS gas Entropy = 0.000179 ( 112.233 cal/mol-k,delta= 0.218)
- original gas Free Energy = -754.889932 (-473700.581 kcal/mol, delta= 0.000)
- unadjusted DOS gas Free Energy = -754.890029 (-473700.641 kcal/mol, delta= -0.061)
- model DOS gas Free Energy = -754.890029 (-473700.641 kcal/mol, delta= -0.060)
- original sol Free Energy = -754.911551 (-473714.147 kcal/mol)
- unadjusted DOS sol Free Energy = -754.911648 (-473714.207 kcal/mol)
- model DOS sol Free Energy = -754.911647 (-473714.207 kcal/mol)
DOS sigma = 50.000000
- vibrational DOS enthalpy correction = 0.142937 kcal/mol ( 89.695 kcal/mol)
- model vibrational DOS enthalpy correction = 0.143463 kcal/mol ( 90.024 kcal/mol)
- vibrational DOS Entropy = 0.000061 ( 38.249 cal/mol-k)
- model vibrational DOS Entropy = 0.000063 ( 39.284 cal/mol-k)
- original gas Energy = -754.983730 (-473759.440 kcal/mol)
- original gas Enthalpy = -754.836710 (-473667.183 kcal/mol, delta= 0.000)
- unajusted DOS gas Enthalpy = -754.837018 (-473667.376 kcal/mol, delta= -0.193)
- model DOS gas Enthalpy = -754.836493 (-473667.047 kcal/mol, delta= 0.137)
- original gas Entropy = 0.000179 ( 112.015 cal/mol-k,delta= 0.000)
- unajusted DOS gas Entropy = 0.000178 ( 111.741 cal/mol-k,delta= -0.274)
- model DOS gas Entropy = 0.000180 ( 112.776 cal/mol-k,delta= 0.761)
- original gas Free Energy = -754.889932 (-473700.581 kcal/mol, delta= 0.000)
- unadjusted DOS gas Free Energy = -754.890110 (-473700.692 kcal/mol, delta= -0.111)
- model DOS gas Free Energy = -754.890076 (-473700.671 kcal/mol, delta= -0.090)
- original sol Free Energy = -754.911551 (-473714.147 kcal/mol)
- unadjusted DOS sol Free Energy = -754.911728 (-473714.258 kcal/mol)
- model DOS sol Free Energy = -754.911695 (-473714.237 kcal/mol)
DOS sigma = 100.000000
- vibrational DOS enthalpy correction = 0.142610 kcal/mol ( 89.489 kcal/mol)
- model vibrational DOS enthalpy correction = 0.143827 kcal/mol ( 90.253 kcal/mol)
- vibrational DOS Entropy = 0.000057 ( 36.052 cal/mol-k)
- model vibrational DOS Entropy = 0.000061 ( 38.330 cal/mol-k)
- original gas Energy = -754.983730 (-473759.440 kcal/mol)
- original gas Enthalpy = -754.836710 (-473667.183 kcal/mol, delta= 0.000)
- unajusted DOS gas Enthalpy = -754.837345 (-473667.582 kcal/mol, delta= -0.398)
- model DOS gas Enthalpy = -754.836128 (-473666.818 kcal/mol, delta= 0.365)
- original gas Entropy = 0.000179 ( 112.015 cal/mol-k,delta= 0.000)
- unajusted DOS gas Entropy = 0.000175 ( 109.544 cal/mol-k,delta= -2.471)
- model DOS gas Entropy = 0.000178 ( 111.822 cal/mol-k,delta= -0.193)
- original gas Free Energy = -754.889932 (-473700.581 kcal/mol, delta= 0.000)
- unadjusted DOS gas Free Energy = -754.889393 (-473700.242 kcal/mol, delta= 0.338)
- model DOS gas Free Energy = -754.889259 (-473700.158 kcal/mol, delta= 0.423)
- original sol Free Energy = -754.911551 (-473714.147 kcal/mol)
- unadjusted DOS sol Free Energy = -754.911012 (-473713.808 kcal/mol)
- model DOS sol Free Energy = -754.910877 (-473713.724 kcal/mol)
Normal Mode Frequency (cm-1) IR Intensity (arbitrary)
----------- ---------------- ------------------------
1 -0.000 0.070
2 -0.000 0.179
3 0.000 0.540
4 0.000 0.168
5 0.000 0.082
6 0.000 2.300
7 32.150 0.015
8 53.750 0.929
9 73.600 0.782
10 151.600 0.035
11 173.030 1.496
12 177.150 2.454
13 197.080 2.134
14 235.000 0.935
15 310.750 3.147
16 318.520 0.375
17 347.990 2.464
18 387.880 3.333
19 396.800 5.931
20 403.040 23.342
21 432.520 1.576
22 468.040 3.881
23 538.200 2.628
24 545.800 1.702
25 607.680 1.004
26 671.390 0.945
27 717.480 12.471
28 731.100 1.455
29 749.520 4.873
30 771.060 0.211
31 791.060 8.022
32 835.910 4.785
33 867.030 3.980
34 880.320 23.094
35 980.490 5.800
36 996.680 9.402
37 1034.060 4.565
38 1072.030 1.622
39 1173.390 19.925
40 1189.880 6.943
41 1210.690 29.492
42 1292.530 25.299
43 1332.440 107.684
44 1346.620 22.806
45 1359.770 6.618
46 1367.040 69.954
47 1420.660 6.273
48 1448.950 13.652
49 1469.890 5.513
50 1483.920 36.383
51 1577.570 3.446
52 1605.360 36.905
53 1621.310 40.335
54 1655.440 0.488
55 3018.180 4.931
56 3067.230 2.470
57 3136.380 0.683
58 3148.760 1.435
59 3174.020 1.472
60 3627.760 14.567
No Hindered Rotor Data
+-------------------------------------+
| Reactions Contained in the Database |
+-------------------------------------+
Reactions Containing INCHIKEY = HTAMNOAYOHLVPQ-UHFFFAOYSA-N
Reactionid Erxn(gas) Hrxn(gas) Grxn(gas) delta_Solv Grxn(aq) ReactionType Reaction
20716 -1.968 -1.960 -3.629 0.000 -3.629 EA + BCD --> AB + CDE "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
20480 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20479 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20478 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20477 20.107 19.156 18.298 0.444 18.743 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
20359 -53.135 -52.859 -55.729 14.850 -40.879 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> TNT-4-OH solvation_type{COSMO-SMD:acetone} + nitrite solvation_type{COSMO-SMD:acetone}"
20358 -47.358 -46.917 -49.701 0.000 -49.701 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw} + O=N[O-] theory{pspw}"
20322 -50.850 -50.577 -52.654 23.427 -29.226 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
20233 -54.421 -54.152 -57.022 24.340 -32.682 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> TNT-4-OH solvation_type{COSMO-SMD:o-cresol} + nitrite solvation_type{COSMO-SMD:o-cresol}"
20207 -2.221 -2.219 -3.963 -0.074 -4.038 EA + BCD --> AB + CDE "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
20171 -1.190 -1.279 -2.131 4.538 2.407 EA + BCD --> AB + CDE "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
20152 -51.490 -51.274 -53.683 27.010 -26.673 AB + C --> AC + B "TNT xc{pbe} solvation_type{COSMO-SMD:methanol} + hydroxide xc{pbe} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD:methanol} + nitrite xc{pbe} solvation_type{COSMO-SMD:methanol}"
20149 -54.632 -54.405 -56.421 31.856 -24.565 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
20148 -61.488 -61.419 -64.231 24.117 -40.114 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
20147 -51.017 -50.737 -53.291 0.000 -53.291 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{pspw4} + hydroxide ^{-1} theory{pspw4} --> Oc1cc(O)c(c(c1)N(=O)=O)C theory{pspw4} + O=[N]=O ^{-1} theory{pspw4}"
20113 -50.850 -50.577 -52.654 30.597 -22.056 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
20112 -0.803 -0.742 -2.687 0.000 -2.687 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
20111 -47.895 -47.456 -50.524 0.000 -50.524 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + [OH-] theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=N[O-] theory{pspw4}"
20110 -54.421 -54.153 -57.023 28.340 -28.683 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O solvation_type{COSMO-SMD} + [OH-] solvation_type{COSMO-SMD} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O solvation_type{COSMO-SMD} + O=N[O-] solvation_type{COSMO-SMD}"
20013 -2.828 -2.854 -4.012 0.000 -4.012 EA + BCD --> AB + CDE "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
19902 -52.474 -52.848 -54.908 45.934 -8.974 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
19896 -2.968 -3.470 -5.156 1.224 -3.932 EA + BCD --> AB + CDE "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
19851 -4.053 -4.219 -6.003 1.365 -4.638 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
19758 -64.482 -62.739 -51.927 51.388 -0.539 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
19711 -70.571 -68.041 -57.292 51.724 -5.568 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{m06-2x}"
19690 -57.697 -58.024 -60.957 21.754 -39.203 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O=N[O-] xc{m06-2x}"
19612 -51.490 -51.275 -53.685 29.590 -24.094 AB + C --> AC + B "TNT xc{pbe} + [OH-] xc{pbe} --> TNT-4-OH xc{pbe} + nitrite xc{pbe}"
18718 20.367 19.746 19.852 -1.712 18.140 EA + BCD --> AB + CDE "TNT-4-OH --> [O][CH]1=CC(=C(C(=C1)N(=O)=O)C)N(=O)=O"
18294 -48.434 -48.154 -50.230 30.537 -19.693 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
17493 53.390 53.134 55.156 -29.926 25.230 AB + C --> AC + B "Cc1c(O)cc(O)cc1N(=O)=O + O=N[O-] --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-]"
17202 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17201 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17200 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17199 0.008 -0.721 -1.844 5.092 3.248 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
17184 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
17183 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
17182 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
17181 20.107 19.114 18.562 0.214 18.776 AB + CD --> AD + BC "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
16512 -58.235 -58.032 -60.692 28.350 -32.342 AB + C --> AC + B "TNT xc{pbe0} solvation_type{COSMO-SMD} + hydroxide xc{pbe0} solvation_type{COSMO-SMD} --> TNT-4-OH xc{pbe0} solvation_type{COSMO-SMD} + nitrite xc{pbe0} solvation_type{COSMO-SMD}"
16431 -59.037 -58.822 -61.390 27.550 -33.840 AB + C --> AC + B "TNT xc{pbe} solvation_type{COSMO-SMD} + hydroxide xc{pbe} solvation_type{COSMO-SMD} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD} + nitrite xc{pbe} solvation_type{COSMO-SMD}"
14760 20.367 19.746 19.852 -1.712 18.140 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O --> CC1=C(N(=O)=O)CC(=O)C=C1N(=O)=O"
14717 -53.156 -52.796 -54.296 26.265 -28.031 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + [OH-] theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=N[O-] theory{ccsd(t)}"
13478 -53.390 -53.134 -55.156 29.926 -25.230 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(O)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
13473 -4.059 -4.188 -5.876 1.293 -4.583 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
13462 -1.190 -1.279 -2.131 4.468 2.337 EA + BCD --> AB + CDE "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
12445 -56.957 -56.636 -58.320 28.835 -29.485 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe0} + O=[N]=O ^{-1} xc{pbe0}"
12417 -61.996 -60.282 -49.145 53.623 4.478 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe0}"
11672 -52.318 -52.705 -53.948 49.770 -4.178 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O xc{pbe0}"
11669 -54.955 -54.687 -57.040 26.204 -30.836 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O=N[O-] xc{pbe0}"
11640 -67.282 -64.755 -53.837 55.961 2.124 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe0}"
11579 -30.647 -30.979 -32.709 45.832 13.123 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe0} + O xc{pbe0}"
11519 -54.421 -54.152 -57.022 25.370 -31.652 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:ethanol} + hydroxide solvation_type{COSMO-SMD:ethanol} --> TNT-4-OH solvation_type{COSMO-SMD:ethanol} + nitrite solvation_type{COSMO-SMD:ethanol}"
11354 -54.421 -54.152 -57.022 15.290 -41.732 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:edc12} + hydroxide solvation_type{COSMO-SMD:edc12} --> TNT-4-OH solvation_type{COSMO-SMD:edc12} + nitrite solvation_type{COSMO-SMD:edc12}"
11238 -53.565 -53.292 -56.162 24.340 -31.822 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> TNT-4-OH solvation_type{COSMO-SMD:o-cresol} + nitrite solvation_type{COSMO-SMD:o-cresol}"
11237 -53.565 -53.292 -56.162 14.850 -41.312 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> TNT-4-OH solvation_type{COSMO-SMD:acetone} + nitrite solvation_type{COSMO-SMD:acetone}"
10902 -62.518 -60.919 -49.619 52.924 3.305 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe}"
10866 -61.488 -61.419 -64.231 29.967 -34.264 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
10864 -69.399 -69.726 -70.391 53.901 -16.490 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc([O-])cc1N(=O)=O + O"
10817 -70.572 -68.042 -57.292 57.574 0.282 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{m06-2x}"
10701 -66.425 -64.151 -53.032 55.672 2.640 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe}"
10693 -51.490 -51.269 -53.733 24.790 -28.944 AB + C --> AC + B "TNT xc{pbe} + [OH-] xc{pbe} --> TNT-4-OH xc{pbe} + nitrite xc{pbe}"
10692 -57.701 -57.963 -61.028 27.194 -33.834 AB + C --> AC + B "TNT xc{m06-2x} + [OH-] xc{m06-2x} --> TNT-4-OH xc{m06-2x} + nitrite xc{m06-2x}"
10691 -54.632 -54.404 -56.421 29.005 -27.415 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
10655 -64.483 -62.739 -51.927 57.238 5.311 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
10451 -2.970 -3.408 -5.229 0.734 -4.495 EA + BCD --> AB + CDE "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
9709 -55.347 -55.709 -56.516 49.169 -7.347 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + O xc{pbe}"
9645 -52.474 -52.848 -54.908 51.784 -3.124 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
9637 -67.282 -64.755 -53.837 56.021 2.184 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe0}"
9378 -30.072 -30.528 -31.548 46.724 15.176 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
8953 -59.555 -57.237 -47.295 0.000 -47.295 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O theory{pspw4} xc(pbe}"
7872 -29.376 -29.915 -31.360 45.991 14.631 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
7823 -30.647 -30.979 -32.709 45.892 13.183 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe0} + O xc{pbe0}"
7822 -29.376 -29.917 -31.361 46.041 14.680 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
7821 -52.477 -52.839 -54.878 51.785 -3.094 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
7816 -52.318 -52.705 -53.948 49.830 -4.118 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O xc{pbe0}"
7764 -65.729 -63.537 -52.843 54.938 2.095 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe}"
7688 -25.000 -25.513 -27.595 0.000 -27.595 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O theory{pspw4} xc(pbe} + O theory{pspw4} xc(pbe}"
7687 -51.283 -52.052 -53.963 0.000 -53.963 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + O theory{pspw4} xc(pbe}"
7646 -55.616 -53.708 -43.300 0.000 -43.300 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> CC1(O)C(N(=O)=O)=CC(O)=C[C-]1N(=O)=O theory{pspw4} xc(pbe}"
7623 -5.741 -5.819 -5.704 4.228 -1.476 EA + BCD --> AB + CDE "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
7558 -1.025 -1.052 -2.187 0.184 -2.003 EA + BCD --> AB + CDE "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
6923 -54.421 -54.169 -56.623 28.810 -27.813 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O solvation_type{COSMO-SMD} + [OH-] solvation_type{COSMO-SMD} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O solvation_type{COSMO-SMD} + O=N[O-] solvation_type{COSMO-SMD}"
6577 -39.920 -38.700 -38.749 22.697 -16.052 AB + C --> AC + B "Sc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + [SH] ^{-1}"
6496 -61.491 -61.410 -64.202 29.968 -34.234 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
6495 -56.957 -56.636 -58.320 28.895 -29.425 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe0} + O=[N]=O ^{-1} xc{pbe0}"
6494 -53.936 -53.791 -56.232 28.272 -27.960 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
6493 -64.485 -62.730 -51.897 57.239 5.341 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
6492 -61.753 -59.977 -48.904 53.494 4.590 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe0}"
6491 -61.822 -60.306 -49.430 52.191 2.761 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe}"
6412 -2.968 -3.473 -5.161 1.870 -3.291 EA + BCD --> AB + CDE "TNT xc{m06-2x} solvation_type{COSMO-SMD:methanol} + water xc{m06-2x} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{m06-2x} solvation_type{COSMO-SMD:methanol} + nitrous acid xc{m06-2x} solvation_type{COSMO-SMD:methanol}"
6411 -2.221 -2.297 -3.997 2.740 -1.257 EA + BCD --> AB + CDE "TNT xc{b3lyp} solvation_type{COSMO-SMD:methanol} + water xc{b3lyp} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{b3lyp} solvation_type{COSMO-SMD:methanol} + nitrous acid xc{b3lyp} solvation_type{COSMO-SMD:methanol}"
6390 -57.697 -58.024 -60.957 28.170 -32.787 AB + C --> AC + B "TNT xc{m06-2x} solvation_type{COSMO-SMD:methanol} + hydroxide xc{m06-2x} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{m06-2x} solvation_type{COSMO-SMD:methanol} + nitrite xc{m06-2x} solvation_type{COSMO-SMD:methanol}"
6389 -51.490 -51.274 -53.683 27.110 -26.573 AB + C --> AC + B "TNT xc{pbe} solvation_type{COSMO-SMD:methanol} + hydroxide xc{pbe} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD:methanol} + nitrite xc{pbe} solvation_type{COSMO-SMD:methanol}"
6209 -54.421 -54.152 -57.022 8.950 -48.072 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:toluene} + hydroxide solvation_type{COSMO-SMD:toluene} --> TNT-4-OH solvation_type{COSMO-SMD:toluene} + nitrite solvation_type{COSMO-SMD:toluene}"
6206 -54.421 -54.152 -57.022 27.980 -29.042 AB + C --> AC + B "TNT solvation_type{COSMO-SMD:methanol} + hydroxide solvation_type{COSMO-SMD:methanol} --> TNT-4-OH solvation_type{COSMO-SMD:methanol} + nitrite solvation_type{COSMO-SMD:methanol}"
5969 -61.247 -58.827 -47.398 56.483 9.084 A + B --> AB "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O"
5935 -29.909 -30.400 -30.743 47.393 16.650 AB + C --> AC + B "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O + O"
5817 -57.941 -57.674 -58.729 29.686 -29.043 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(O)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
5727 -0.369 -0.434 -2.854 0.000 -2.854 EA + BCD --> AB + CDE "TNT theory{pspw4} xc{pbe0} + water theory{pspw4} xc{pbe0} --> TNT-4-OH theory{pspw4} xc{pbe0} + nitrous acid theory{pspw4} xc{pbe0}"
5689 -15.921 -17.075 -19.446 5.314 -14.132 AB + C --> AC + B "TNT-4-OH + [SH-] ^{-1} --> Oc1cc(S)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
5097 408.443 401.540 394.998 -257.634 38.764 AB --> A + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C mult{2} + [H] ^{1} + [SHE]"
5096 408.443 401.540 394.998 -257.634 38.764 AB --> A + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C mult{2} + [H] ^{1} + [SHE]"
5056 -2.809 -2.853 -4.021 0.000 -4.021 EA + BCD --> AB + CDE "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
5043 -1.831 -1.817 -2.147 0.767 -1.380 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + O theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=NO theory{ccsd(t)}"
5042 -0.663 -0.662 -2.359 0.000 -2.359 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
5038 2.758 2.772 2.442 0.767 3.209 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + O theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=NO theory{mp2}"
5002 -52.557 -53.011 -53.497 50.228 -3.269 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)[CH2] ^{-1} + O"
4997 48.139 46.875 48.199 -8.330 39.869 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc([N](=O)O)c(c(c1)N(=O)=O)C"
4281 -2.967 -3.417 -5.258 0.733 -4.526 EA + BCD --> AB + CDE "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
3940 -52.102 -51.850 -55.468 0.000 -55.468 AB + C --> AC + B "TNT theory{pspw4} xc{pbe0} + hydroxide theory{pspw4} xc{pbe0} --> TNT-4-OH theory{pspw4} xc{pbe0} + nitrite theory{pspw4} xc{pbe0}"
3081 -56.170 -54.497 -42.973 53.382 10.410 A + B --> AB "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1}"
2419 -0.637 -0.591 -2.169 0.000 -2.169 EA + BCD --> AB + CDE "TNT theory{pspw} xc{pbe0} + water theory{pspw} xc{pbe0} --> TNT-4-OH theory{pspw} xc{pbe0} + nitrous acid theory{pspw} xc{pbe0}"
2418 -2.447 9.507 15.426 3.595 19.020 EA + BCD --> AB + CDE "TNT xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> TNT-4-OH xc{pbe0} basis{6-31G*} + nitrous acid xc{pbe0} basis{6-31G*}"
2304 -4.059 -4.187 -5.875 1.313 -4.562 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
2179 -1.025 -1.051 -2.186 0.143 -2.043 EA + BCD --> AB + CDE "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
1962 -2.221 -2.219 -3.963 -0.144 -4.108 EA + BCD --> AB + CDE "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
1264 -51.157 -50.817 -53.618 0.000 -53.618 AB + C --> AC + B "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{pspw4} + hydroxide ^{-1} theory{pspw4} --> Oc1cc(O)c(c(c1)N(=O)=O)C theory{pspw4} + O=[N]=O ^{-1} theory{pspw4}"
1214 -48.218 -47.811 -50.084 0.000 -50.084 AB + C --> AC + B "TNT theory{pspw} + hydroxide theory{pspw} --> TNT-4-OH theory{pspw} + nitrite theory{pspw}"
1183 -52.545 -52.314 -54.886 27.482 -27.404 AB + C --> AC + B "TNT theory{dft} xc{blyp} parse_output{grxn(gas)} + hydroxide theory{dft} xc{blyp} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{blyp} parse_output{grxn(gas)} + nitrite theory{dft} xc{blyp} parse_output{grxn(gas)}"
1164 -2.967 -3.417 -5.258 0.733 -4.526 EA + BCD --> AB + CDE "TNT xc{m06-2x} parse_output{grxn(aq)} + water xc{m06-2x} parse_output{grxn(aq)} --> TNT-4-OH xc{m06-2x} parse_output{grxn(aq)} + N(=O)O xc{m06-2x} parse_output{grxn(aq)}"
1163 -2.809 -2.853 -4.021 0.000 -4.021 EA + BCD --> AB + CDE "TNT theory{pspw} parse_output{grxn(aq)} + water theory{pspw} parse_output{grxn(aq)} --> TNT-4-OH theory{pspw} parse_output{grxn(aq)} + N(=O)O theory{pspw} parse_output{grxn(aq)}"
1155 -57.698 -57.972 -61.057 27.193 -33.864 AB + C --> AC + B "TNT theory{dft} xc{m06-2x} parse_output{grxn(gas)} + hydroxide theory{dft} xc{m06-2x} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{m06-2x} parse_output{grxn(gas)} + nitrite theory{dft} xc{m06-2x} parse_output{grxn(gas)}"
1154 -52.186 -51.883 -53.922 25.523 -28.399 AB + C --> AC + B "TNT theory{dft} xc{pbe} parse_output{grxn(gas)} + hydroxide theory{dft} xc{pbe} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{pbe} parse_output{grxn(gas)} + nitrite theory{dft} xc{pbe} parse_output{grxn(gas)}"
370 -2.887 -3.709 -6.472 1.215 -5.257 EA + BCD --> AB + CDE "TNT xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> TNT-4-OH xc{pbe0} basis{6-31G*} + nitrous acid xc{pbe0} basis{6-31G*}"
348 -4.059 -4.187 -5.875 1.313 -4.562 EA + BCD --> AB + CDE "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
336 -1.025 -1.051 -2.186 0.143 -2.043 EA + BCD --> AB + CDE "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
335 -0.637 -0.591 -2.169 0.000 -2.169 EA + BCD --> AB + CDE "TNT theory{pspw} xc{pbe0} + water theory{pspw} xc{pbe0} --> TNT-4-OH theory{pspw} xc{pbe0} + nitrous acid theory{pspw} xc{pbe0}"
138 -53.156 -52.795 -54.296 26.345 -27.950 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + [OH-] theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=N[O-] theory{ccsd(t)}"
137 -1.831 -1.817 -2.147 0.767 -1.380 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + O theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=NO theory{ccsd(t)}"
136 2.758 2.772 2.442 0.767 3.209 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + O theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=NO theory{mp2}"
135 -0.663 -0.662 -2.359 0.000 -2.359 EA + BCD --> AB + CDE "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
134 -47.755 -47.375 -50.196 0.000 -50.196 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + [OH-] theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=N[O-] theory{pspw4}"
133 -15.375 -14.981 -17.251 0.000 -17.251 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw} + O=N[O-] theory{pspw}"
132 -65.996 -65.741 -69.320 966.667 897.347 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pm3} + [OH-] theory{pm3} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pm3} + O=N[O-] theory{pm3}"
131 -52.186 -51.883 -53.922 25.534 -28.388 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + O=N[O-] xc{pbe}"
130 -57.696 -57.969 -61.054 27.133 -33.921 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O=N[O-] xc{m06-2x}"
129 -49.153 -48.792 -50.293 26.345 -23.947 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + [OH-] theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=N[O-] theory{mp2}"
128 -54.955 -54.688 -57.042 26.274 -30.768 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O=N[O-] xc{pbe0}"
127 -50.850 -50.577 -52.653 27.886 -24.767 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
15 -54.422 -54.074 -56.988 25.304 -31.685 AB + C --> AC + B "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + O=N[O-]"
1 -2.221 -2.219 -3.963 -0.144 -4.108 EA + BCD --> AB + CDE "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
All requests to Arrows were successful.
KEYWORDs -
reaction: :reaction
chinese_room: :chinese_room
molecule: :molecule
nmr: :nmr
predict: :predict
submitesmiles: :submitesmiles
nosubmitmissingesmiles
resubmitmissingesmiles
submitmachines: :submitmachines
useallentries
nomodelcorrect
eigenvalues: :eigenvalues
frequencies: :frequencies
nwoutput: :nwoutput
xyzfile: :xyzfile
alleigs: :alleigs
allfreqs: :allfreqs
reactionenumerate:
energytype:[erxn(gas) hrxn(gas) grxn(gas) delta_solvation grxn(aq)] :energytype
energytype:[kcal/mol kj/mol ev cm-1 ry hartree au] :energytype
tablereactions:
reaction: ... :reaction
reaction: ... :reaction
...
:tablereactions
tablemethods:
method: ... :method
method: ... :method
...
:tablemethods
:reactionenumerate
rotatebonds
xyzinput:
label: :label
xyzdata:
... xyz data ...
:xyzdata
:xyzinput
submitHf: :submitHf
nmrexp: :nmrexp
findreplace: old text | new text :findreplace
listnwjobs
fetchnwjob: :fetchnwjob
pushnwjob: :pushnwjob
printcsv: :printcsv
printeig: :printeig
printfreq: :printfreq
printxyz: :printxyz
printjobinfo: :printjobinfo
printnwout: :printnwout
badids: :badids
hup_string:
database:
table:
request_table:
listallesmiles
queuecheck
This software service and its documentation were developed at the Environmental Molecular Sciences Laboratory (EMSL) at Pacific Northwest National Laboratory, a multiprogram national laboratory, operated for the U.S. Department of Energy by Battelle under Contract Number DE-AC05-76RL01830. Support for this work was provided by the Department of Energy Office of Biological and Environmental Research, and Department of Defense environmental science and technology program (SERDP). THE SOFTWARE SERVICE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE SERVICE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE SERVICE.