Copyright Arrows Logo 3D Periodic Editor  3D Molecular And Reaction Editor   Expert Editor   Microsoft Quantum Editor   EMSL Aerosol Workshop Editor   Manual

Results from an EMSL Arrows Calculation

EMSL Arrows is a revolutionary approach to materials and chemical simulations that uses NWChem and chemical computational databases to make materials and chemical modeling accessible via a broad spectrum of digital communications including posts to web APIs, social networks, and traditional email.

Molecular modeling software has previously been extremely complex, making it prohibative to all but experts in the field, yet even experts can struggle to perform calculations. This service is designed to be used by experts and non-experts alike. Experts can carry out and keep track of large numbers of complex calculations with diverse levels of theories present in their workflows. Additionally, due to a streamlined and easy-to-use input, non-experts can carry out a wide variety of molecular modeling calculations previously not accessible to them.



The id(s) for emsiles = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{dft} xc{pbe} basis{6-31G*} solvation_type{COSMO} ^{0} are: 11633 
Use id=% instead of esmiles to print other entries.

mformula     = C7H6N2O5
iupac        = 4-methyl-3,5-dinitrophenol
PubChem      = 46156
PubChem LCSS = 46156
cas          = 264-594-5
synonyms     = 3,5-Dinitro-p-cresol; p-CRESOL, 3,5-DINITRO-; EINECS 264-594-5; 63989-82-2; AC1L2FH3; 4-methyl-3,5-dinitrophenol; SCHEMBL11273954; CTK8J7965; MolPort-006-133-202; AKOS004121770; MCULE-6898436842; LS-55391; OR049346; OR118703

Search Links to Other Online Resources (may not be available):
 - Google Structure Search
 - EPA CompTox Database
 - Chemical Entities of Biological Interest (ChEBI)
 - NIH ChemIDplus - A TOXNET DATABASE
 - The Human Metabolome Database (HMDB)
 - OECD eChemPortal
 - Google Scholar



+==================================================+
||              Molecular Calculation             ||
+==================================================+

Id     = 11633

NWOutput = Link to NWChem Output (download)

Datafiles:
mo_orbital_nwchemarrows-2020-11-16-21-28-108384.out-228880-2020-11-16-21:37:2 (download)
homo-restricted.cube-228880-2020-11-16-21:37:2 (download)
lumo-restricted.cube-228880-2020-11-16-21:37:2 (download)
cosmo.xyz-228880-2020-11-16-21:37:2 (download)

image_resset: api/image_reset/11633

Calculation performed by node003.local
Numbers of cpus used for calculation = 24
Calculation walltime = 1260.100000 seconds (0 days 0 hours 21 minutes 0 seconds)


+----------------+
| Energetic Data |
+----------------+

Id       = 11633 
iupac    = 4-methyl-3,5-dinitrophenol
mformula = C7H6N2O5
inchi    = InChI=1S/C7H6N2O5/c1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h2-3,10H,1H3
inchikey = HTAMNOAYOHLVPQ-UHFFFAOYSA-N
esmiles  = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{dft} xc{pbe} basis{6-31G*} solvation_type{COSMO} ^{0}
calculation_type = ovc
theory           = dft
xc               = pbe
basis            = 6-31G*
charge,mult      = 0 1
energy           =    -754.983730 Hartrees
enthalpy correct.=       0.147020 Hartrees
entropy          =        112.015 cal/mol-K
solvation energy =        -13.566 kcal/mol  solvation_type = COSMO
Sitkoff cavity dispersion          =          2.634 kcal/mol
Honig cavity dispersion            =          8.870 kcal/mol
ASA solvent accesible surface area =        354.804 Angstrom2
ASA solvent accesible volume       =        337.489 Angstrom3



+-----------------+
| Structural Data |
+-----------------+

JSmol: an open-source HTML5 viewer for chemical structures in 3D


  Number of Atoms = 20
 
  Units are Angstrom for bonds and degrees for angles

      Type          I     J     K     L     M      Value
      ----------- ----- ----- ----- ----- ----- ----------
    1 Stretch        C1    C2                      1.50989
    2 Stretch        C1   H15                      1.10160
    3 Stretch        C1   H16                      1.10140
    4 Stretch        C1   H17                      1.09539
    5 Stretch        C2    C3                      1.41738
    6 Stretch        C2    C7                      1.41798
    7 Stretch        C3    C4                      1.40085
    8 Stretch        C3   N12                      1.48808
    9 Stretch        C4    C5                      1.39945
   10 Stretch        C4   H18                      1.09354
   11 Stretch        C5    C6                      1.40220
   12 Stretch        C5   O11                      1.36224
   13 Stretch        C6    C7                      1.39679
   14 Stretch        C6   H19                      1.09173
   15 Stretch        C7    N8                      1.48879
   16 Stretch        N8    O9                      1.23948
   17 Stretch        N8   O10                      1.23876
   18 Stretch       O11   H20                      0.97955
   19 Stretch       N12   O13                      1.23915
   20 Stretch       N12   O14                      1.24161
   21 Bend           C2    C1   H15              111.10663
   22 Bend           C2    C1   H16              110.26002
   23 Bend           C2    C1   H17              111.07744
   24 Bend          H15    C1   H16              106.08312
   25 Bend          H15    C1   H17              108.35178
   26 Bend          H16    C1   H17              109.82223
   27 Bend           C1    C2    C3              123.82932
   28 Bend           C1    C2    C7              123.14724
   29 Bend           C3    C2    C7              112.99140
   30 Bend           C2    C3    C4              124.19989
   31 Bend           C2    C3   N12              121.48042
   32 Bend           C4    C3   N12              114.31887
   33 Bend           C3    C4    C5              119.83060
   34 Bend           C3    C4   H18              118.12356
   35 Bend           C5    C4   H18              122.04584
   36 Bend           C4    C5    C6              118.75530
   37 Bend           C4    C5   O11              123.63508
   38 Bend           C6    C5   O11              117.60963
   39 Bend           C5    C6    C7              119.45793
   40 Bend           C5    C6   H19              120.48279
   41 Bend           C7    C6   H19              120.05660
   42 Bend           C2    C7    C6              124.67277
   43 Bend           C2    C7    N8              121.55485
   44 Bend           C6    C7    N8              113.77234
   45 Bend           C7    N8    O9              117.91655
   46 Bend           C7    N8   O10              116.68144
   47 Bend           O9    N8   O10              125.35500
   48 Bend           C5   O11   H20              108.67354
   49 Bend           C3   N12   O13              118.38877
   50 Bend           C3   N12   O14              117.01441
   51 Bend          O13   N12   O14              124.59178
   52 Dihedral       C1    C2    C3    C4        178.77233
   53 Dihedral       C1    C2    C3   N12         -1.57678
   54 Dihedral       C1    C2    C7    C6       -175.88400
   55 Dihedral       C1    C2    C7    N8          4.18965
   56 Dihedral       C2    C3    C4    C5         -2.39706
   57 Dihedral       C2    C3    C4   H18        177.60745
   58 Dihedral       C2    C3   N12   O13         22.24830
   59 Dihedral       C2    C3   N12   O14       -158.53044
   60 Dihedral       C2    C7    C6    C5         -3.35561
   61 Dihedral       C2    C7    C6   H19        177.23632
   62 Dihedral       C2    C7    N8    O9         44.24596
   63 Dihedral       C2    C7    N8   O10       -138.11283
   64 Dihedral       C3    C2    C1   H15         50.97098
   65 Dihedral       C3    C2    C1   H16        -66.35275
   66 Dihedral       C3    C2    C1   H17        171.66555
   67 Dihedral       C3    C2    C7    C6          2.12664
   68 Dihedral       C3    C2    C7    N8       -177.79971
   69 Dihedral       C3    C4    C5    C6          1.14190
   70 Dihedral       C3    C4    C5   O11       -178.86306
   71 Dihedral       C4    C3    C2    C7          0.77743
   72 Dihedral       C4    C3   N12   O13       -158.06857
   73 Dihedral       C4    C3   N12   O14         21.15270
   74 Dihedral       C4    C5    C6    C7          1.55620
   75 Dihedral       C4    C5    C6   H19       -179.03831
   76 Dihedral       C4    C5   O11   H20         -0.04717
   77 Dihedral       C5    C4    C3   N12        177.92966
   78 Dihedral       C5    C6    C7    N8        176.57581
   79 Dihedral       C6    C5    C4   H18       -178.86279
   80 Dihedral       C6    C5   O11   H20        179.94792
   81 Dihedral       C6    C7    N8    O9       -135.68785
   82 Dihedral       C6    C7    N8   O10         41.95336
   83 Dihedral       C7    C2    C1   H15       -131.23369
   84 Dihedral       C7    C2    C1   H16        111.44258
   85 Dihedral       C7    C2    C1   H17        -10.53912
   86 Dihedral       C7    C2    C3   N12       -179.57168
   87 Dihedral       C7    C6    C5   O11       -178.43913
   88 Dihedral       N8    C7    C6   H19         -2.83226
   89 Dihedral      O11    C5    C4   H18          1.13225
   90 Dihedral      O11    C5    C6   H19          0.96635
   91 Dihedral      N12    C3    C4   H18         -2.06583

 
+-----------------+
| Eigenvalue Data |
+-----------------+

Id       = 11633
iupac    = 4-methyl-3,5-dinitrophenol
mformula = C7H6N2O5
InChI    = InChI=1S/C7H6N2O5/c1-4-6(8(11)12)2-5(10)3-7(4)9(13)14/h2-3,10H,1H3
smiles   = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C
esmiles  = Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{dft} xc{pbe} basis{6-31G*} solvation_type{COSMO} ^{0}
theory   = dft
xc       = pbe
basis    = 6-31G*
charge   = 0
mult     = 1
solvation_type = COSMO

twirl webpage  = TwirlMol Link
image webpage  = GIF Image Link

          Eigevalue Spectra
                ----  ----   13.84 eV                                      
                ----  ----                                                 
                ----  ----                                                 
                ----  ----                                                 
                ----------                                                 
                ----------                                                 
                                                                           
                ----  ----                                                 
                ----  ----                                                 
                ----  ----                                                 
                -- -- -- -                                                 
                ----------                                                 
                --- -- ---                                                 
                ----  ----                                                 
                ----------                                                 
                                                                           
                ----  ----                                                 
                                                                           
                                                                           
                ----  ---- LUMO=  -3.48 eV                                 
                                                                           
HOMO=  -5.80 eV ++++++++++                                                 
                ++++++++++                                                 
                ++ ++ ++ +                                                 
                +++ ++ +++                                                 
                ++++  ++++                                                 
                +++ ++ +++                                                 
                ++++++++++                                                 
                ++++  ++++                                                 
                ++ ++ ++ +                                                 
                ++++  ++++                                                 
                ++++  ++++                                                 
                ++++++++++                                                 
                ++++++++++                                                 
                ++++++++++                                                 
                ++++++++++                                                 
                                                                           
                ++++++++++                                                 
                ++++++++++                                                 
                                                                           
                ++++++++++                                                 
                                                                           
                                                                           
                                                                           
                +++ ++ +++                                                 
                                                                           
                                                                           
                                                                           
                                                                           
      -31.05 eV ++++  ++++                                                 



spin            eig      occ
----------------------------
restricted   -31.05     2.00
restricted   -30.93     2.00
restricted   -26.69     2.00
restricted   -26.67     2.00
restricted   -26.52     2.00
restricted   -22.38     2.00
restricted   -20.61     2.00
restricted   -19.68     2.00
restricted   -18.51     2.00
restricted   -17.41     2.00
restricted   -16.76     2.00
restricted   -15.24     2.00
restricted   -14.72     2.00
restricted   -14.13     2.00
restricted   -13.57     2.00
restricted   -13.28     2.00
restricted   -13.04     2.00
restricted   -12.96     2.00
restricted   -12.74     2.00
restricted   -12.40     2.00
restricted   -12.00     2.00
restricted   -11.62     2.00
restricted   -10.54     2.00
restricted   -10.21     2.00
restricted    -9.96     2.00
restricted    -9.61     2.00
restricted    -9.31     2.00
restricted    -9.05     2.00
restricted    -8.38     2.00
restricted    -7.90     2.00
restricted    -7.78     2.00
restricted    -7.61     2.00
restricted    -7.42     2.00
restricted    -7.20     2.00
restricted    -6.78     2.00
restricted    -6.63     2.00
restricted    -5.80     2.00
restricted    -3.48     0.00
restricted    -3.37     0.00
restricted    -1.21     0.00
restricted    -1.03     0.00
restricted     1.12     0.00
restricted     1.75     0.00
restricted     2.31     0.00
restricted     2.69     0.00
restricted     2.94     0.00
restricted     3.26     0.00
restricted     3.99     0.00
restricted     4.33     0.00
restricted     4.48     0.00
restricted     4.90     0.00
restricted     5.11     0.00
restricted     5.51     0.00
restricted     5.77     0.00
restricted     6.79     0.00
restricted     6.92     0.00
restricted     7.29     0.00
restricted     7.58     0.00
restricted     9.60     0.00
restricted    10.42     0.00
restricted    10.64     0.00
restricted    11.01     0.00
restricted    12.25     0.00
restricted    12.36     0.00
restricted    12.62     0.00
restricted    13.38     0.00
restricted    13.56     0.00
restricted    13.84     0.00

 
+----------------------------------------+
| Vibrational Density of States Analysis |
+----------------------------------------+

Total number of frequencies = 60
Total number of negative frequencies = 0
Number of lowest frequencies = 16 (frequency threshold = 500 )
Exact dos norm = 54.000

Generating vibrational DOS
Generating model vibrational DOS to have a proper norm
10.00 54.00 15.99 54.00


50.00 53.53 15.53 54.00


100.00 52.92 14.92 54.00


Generating IR Spectra
Writing vibrational density of states (DOS) to vdos.dat
Writing model vibrational density of states (DOS_FIXED) to vdos-model.dat

Writing IR spectra to irdos.dat
Temperature= 298.15 

zero-point correction to energy                 =   83.842 kcal/mol (  0.133611)
vibrational contribution to enthalpy correction =   89.888 kcal/mol (  0.143245)
vibrational contribution to Entropy             =   38.523 cal/mol-k

hindered rotor enthalpy correction              =    0.000 kcal/mol (  0.000000)
hindered rotor entropy correction               =    0.000 cal/mol-k





DOS sigma = 10.000000
  -       vibrational DOS enthalpy correction =   0.143248 kcal/mol (  89.890 kcal/mol)
  - model vibrational DOS enthalpy correction =   0.143252 kcal/mol (  89.892 kcal/mol)
  -       vibrational DOS Entropy             =   0.000062 (  38.734 cal/mol-k)
  - model vibrational DOS Entropy             =   0.000062 (  38.741 cal/mol-k)

  - original      gas Energy       =  -754.983730 (-473759.440 kcal/mol)

  - original      gas Enthalpy     =  -754.836710 (-473667.183 kcal/mol, delta=   0.000)
  - unajusted DOS gas Enthalpy     =  -754.836707 (-473667.181 kcal/mol, delta=   0.002)
  - model     DOS gas Enthalpy     =  -754.836703 (-473667.179 kcal/mol, delta=   0.005)

  - original      gas Entropy      =     0.000179 ( 112.015 cal/mol-k,delta=   0.000)
  - unajusted DOS gas Entropy      =     0.000179 ( 112.225 cal/mol-k,delta=   0.210)
  - model     DOS gas Entropy      =     0.000179 ( 112.233 cal/mol-k,delta=   0.218)

  - original       gas Free Energy =  -754.889932 (-473700.581 kcal/mol, delta=   0.000)
  - unadjusted DOS gas Free Energy =  -754.890029 (-473700.641 kcal/mol, delta=  -0.061)
  - model      DOS gas Free Energy =  -754.890029 (-473700.641 kcal/mol, delta=  -0.060)

  - original       sol Free Energy =  -754.911551 (-473714.147 kcal/mol)
  - unadjusted DOS sol Free Energy =  -754.911648 (-473714.207 kcal/mol)
  - model      DOS sol Free Energy =  -754.911647 (-473714.207 kcal/mol)

DOS sigma = 50.000000
  -       vibrational DOS enthalpy correction =   0.142937 kcal/mol (  89.695 kcal/mol)
  - model vibrational DOS enthalpy correction =   0.143463 kcal/mol (  90.024 kcal/mol)
  -       vibrational DOS Entropy             =   0.000061 (  38.249 cal/mol-k)
  - model vibrational DOS Entropy             =   0.000063 (  39.284 cal/mol-k)

  - original      gas Energy       =  -754.983730 (-473759.440 kcal/mol)

  - original      gas Enthalpy     =  -754.836710 (-473667.183 kcal/mol, delta=   0.000)
  - unajusted DOS gas Enthalpy     =  -754.837018 (-473667.376 kcal/mol, delta=  -0.193)
  - model     DOS gas Enthalpy     =  -754.836493 (-473667.047 kcal/mol, delta=   0.137)

  - original      gas Entropy      =     0.000179 ( 112.015 cal/mol-k,delta=   0.000)
  - unajusted DOS gas Entropy      =     0.000178 ( 111.741 cal/mol-k,delta=  -0.274)
  - model     DOS gas Entropy      =     0.000180 ( 112.776 cal/mol-k,delta=   0.761)

  - original       gas Free Energy =  -754.889932 (-473700.581 kcal/mol, delta=   0.000)
  - unadjusted DOS gas Free Energy =  -754.890110 (-473700.692 kcal/mol, delta=  -0.111)
  - model      DOS gas Free Energy =  -754.890076 (-473700.671 kcal/mol, delta=  -0.090)

  - original       sol Free Energy =  -754.911551 (-473714.147 kcal/mol)
  - unadjusted DOS sol Free Energy =  -754.911728 (-473714.258 kcal/mol)
  - model      DOS sol Free Energy =  -754.911695 (-473714.237 kcal/mol)

DOS sigma = 100.000000
  -       vibrational DOS enthalpy correction =   0.142610 kcal/mol (  89.489 kcal/mol)
  - model vibrational DOS enthalpy correction =   0.143827 kcal/mol (  90.253 kcal/mol)
  -       vibrational DOS Entropy             =   0.000057 (  36.052 cal/mol-k)
  - model vibrational DOS Entropy             =   0.000061 (  38.330 cal/mol-k)

  - original      gas Energy       =  -754.983730 (-473759.440 kcal/mol)

  - original      gas Enthalpy     =  -754.836710 (-473667.183 kcal/mol, delta=   0.000)
  - unajusted DOS gas Enthalpy     =  -754.837345 (-473667.582 kcal/mol, delta=  -0.398)
  - model     DOS gas Enthalpy     =  -754.836128 (-473666.818 kcal/mol, delta=   0.365)

  - original      gas Entropy      =     0.000179 ( 112.015 cal/mol-k,delta=   0.000)
  - unajusted DOS gas Entropy      =     0.000175 ( 109.544 cal/mol-k,delta=  -2.471)
  - model     DOS gas Entropy      =     0.000178 ( 111.822 cal/mol-k,delta=  -0.193)

  - original       gas Free Energy =  -754.889932 (-473700.581 kcal/mol, delta=   0.000)
  - unadjusted DOS gas Free Energy =  -754.889393 (-473700.242 kcal/mol, delta=   0.338)
  - model      DOS gas Free Energy =  -754.889259 (-473700.158 kcal/mol, delta=   0.423)

  - original       sol Free Energy =  -754.911551 (-473714.147 kcal/mol)
  - unadjusted DOS sol Free Energy =  -754.911012 (-473713.808 kcal/mol)
  - model      DOS sol Free Energy =  -754.910877 (-473713.724 kcal/mol)



Normal Mode    Frequency (cm-1)     IR Intensity (arbitrary)
-----------    ----------------     ------------------------
          1              -0.000                        0.070
          2              -0.000                        0.179
          3               0.000                        0.540
          4               0.000                        0.168
          5               0.000                        0.082
          6               0.000                        2.300
          7              32.150                        0.015
          8              53.750                        0.929
          9              73.600                        0.782
         10             151.600                        0.035
         11             173.030                        1.496
         12             177.150                        2.454
         13             197.080                        2.134
         14             235.000                        0.935
         15             310.750                        3.147
         16             318.520                        0.375
         17             347.990                        2.464
         18             387.880                        3.333
         19             396.800                        5.931
         20             403.040                       23.342
         21             432.520                        1.576
         22             468.040                        3.881
         23             538.200                        2.628
         24             545.800                        1.702
         25             607.680                        1.004
         26             671.390                        0.945
         27             717.480                       12.471
         28             731.100                        1.455
         29             749.520                        4.873
         30             771.060                        0.211
         31             791.060                        8.022
         32             835.910                        4.785
         33             867.030                        3.980
         34             880.320                       23.094
         35             980.490                        5.800
         36             996.680                        9.402
         37            1034.060                        4.565
         38            1072.030                        1.622
         39            1173.390                       19.925
         40            1189.880                        6.943
         41            1210.690                       29.492
         42            1292.530                       25.299
         43            1332.440                      107.684
         44            1346.620                       22.806
         45            1359.770                        6.618
         46            1367.040                       69.954
         47            1420.660                        6.273
         48            1448.950                       13.652
         49            1469.890                        5.513
         50            1483.920                       36.383
         51            1577.570                        3.446
         52            1605.360                       36.905
         53            1621.310                       40.335
         54            1655.440                        0.488
         55            3018.180                        4.931
         56            3067.230                        2.470
         57            3136.380                        0.683
         58            3148.760                        1.435
         59            3174.020                        1.472
         60            3627.760                       14.567


No Hindered Rotor Data


+-------------------------------------+
| Reactions Contained in the Database |
+-------------------------------------+

Reactions Containing INCHIKEY = HTAMNOAYOHLVPQ-UHFFFAOYSA-N

Reactionid    Erxn(gas)    Hrxn(gas)    Grxn(gas)   delta_Solv     Grxn(aq) ReactionType             Reaction
     21620      327.659      320.477      313.638     -295.145       18.493 AB --> A + B             "TNT-4-OH --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C ^{-1} + [H] ^{1}"
     21619      327.659      320.477      313.638     -295.145       18.493 AB --> A + B             "TNT-4-OH --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C ^{-1} + [H] ^{1}"
     20716       -1.968       -1.960       -3.629        0.000       -3.629 EA + BCD --> AB + CDE    "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
     20480       20.107       19.156       18.298        0.444       18.743 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     20479       20.107       19.156       18.298        0.444       18.743 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     20478       20.107       19.156       18.298        0.444       18.743 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     20477       20.107       19.156       18.298        0.444       18.743 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     20359      -53.135      -52.859      -55.729       14.850      -40.879 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> TNT-4-OH solvation_type{COSMO-SMD:acetone} + nitrite solvation_type{COSMO-SMD:acetone}"
     20358      -47.358      -46.917      -49.701        0.000      -49.701 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw} + O=N[O-] theory{pspw}"
     20322      -50.850      -50.577      -52.654       23.427      -29.226 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
     20233      -54.421      -54.152      -57.022       24.340      -32.682 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> TNT-4-OH solvation_type{COSMO-SMD:o-cresol} + nitrite solvation_type{COSMO-SMD:o-cresol}"
     20207       -2.221       -2.219       -3.963       -0.074       -4.038 EA + BCD --> AB + CDE    "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
     20171       -1.190       -1.279       -2.131        4.538        2.407 EA + BCD --> AB + CDE    "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
     20152      -51.490      -51.274      -53.683       27.010      -26.673 AB + C --> AC + B        "TNT xc{pbe} solvation_type{COSMO-SMD:methanol} + hydroxide xc{pbe} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD:methanol} + nitrite xc{pbe} solvation_type{COSMO-SMD:methanol}"
     20149      -54.632      -54.405      -56.421       31.856      -24.565 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
     20148      -61.488      -61.419      -64.231       24.117      -40.114 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
     20147      -51.017      -50.737      -53.291        0.000      -53.291 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{pspw4} + hydroxide ^{-1} theory{pspw4} --> Oc1cc(O)c(c(c1)N(=O)=O)C theory{pspw4} + O=[N]=O ^{-1} theory{pspw4}"
     20113      -50.850      -50.577      -52.654       30.597      -22.056 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
     20112       -0.803       -0.742       -2.687        0.000       -2.687 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
     20111      -47.895      -47.456      -50.524        0.000      -50.524 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + [OH-] theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=N[O-] theory{pspw4}"
     20110      -54.421      -54.153      -57.023       28.340      -28.683 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O solvation_type{COSMO-SMD} + [OH-] solvation_type{COSMO-SMD} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O solvation_type{COSMO-SMD} + O=N[O-] solvation_type{COSMO-SMD}"
     20013       -2.828       -2.854       -4.012        0.000       -4.012 EA + BCD --> AB + CDE    "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
     19902      -52.474      -52.848      -54.908       45.934       -8.974 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
     19896       -2.968       -3.470       -5.156        1.224       -3.932 EA + BCD --> AB + CDE    "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
     19851       -4.053       -4.219       -6.003        1.365       -4.638 EA + BCD --> AB + CDE    "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
     19758      -64.482      -62.739      -51.927       51.388       -0.539 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
     19711      -70.571      -68.041      -57.292       51.724       -5.568 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{m06-2x}"
     19690      -57.697      -58.024      -60.957       21.754      -39.203 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O=N[O-] xc{m06-2x}"
     19612      -51.490      -51.275      -53.685       29.590      -24.094 AB + C --> AC + B        "TNT xc{pbe} + [OH-] xc{pbe} --> TNT-4-OH xc{pbe} + nitrite xc{pbe}"
     18718       20.367       19.746       19.852       -1.712       18.140 EA + BCD --> AB + CDE    "TNT-4-OH --> [O][CH]1=CC(=C(C(=C1)N(=O)=O)C)N(=O)=O"
     18294      -48.434      -48.154      -50.230       30.537      -19.693 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
     17493       53.390       53.134       55.156      -29.926       25.230 AB + C --> AC + B        "Cc1c(O)cc(O)cc1N(=O)=O + O=N[O-] --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-]"
     17202        0.008       -0.721       -1.844        5.092        3.248 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
     17201        0.008       -0.721       -1.844        5.092        3.248 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
     17200        0.008       -0.721       -1.844        5.092        3.248 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
     17199        0.008       -0.721       -1.844        5.092        3.248 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(Cl)cc(O)cc1N(=O)=O + O=N(=O)Cl"
     17184       20.107       19.114       18.562        0.214       18.776 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     17183       20.107       19.114       18.562        0.214       18.776 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     17182       20.107       19.114       18.562        0.214       18.776 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     17181       20.107       19.114       18.562        0.214       18.776 AB + CD --> AD + BC      "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + ClCl --> Cc1c(N(=O)=O)cc(Cl)cc1N(=O)=O + OCl"
     16512      -58.235      -58.032      -60.692       28.350      -32.342 AB + C --> AC + B        "TNT xc{pbe0} solvation_type{COSMO-SMD} + hydroxide xc{pbe0} solvation_type{COSMO-SMD} --> TNT-4-OH xc{pbe0} solvation_type{COSMO-SMD} + nitrite xc{pbe0} solvation_type{COSMO-SMD}"
     16431      -59.037      -58.822      -61.390       27.550      -33.840 AB + C --> AC + B        "TNT xc{pbe} solvation_type{COSMO-SMD} + hydroxide xc{pbe} solvation_type{COSMO-SMD} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD} + nitrite xc{pbe} solvation_type{COSMO-SMD}"
     14760       20.367       19.746       19.852       -1.712       18.140 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O --> CC1=C(N(=O)=O)CC(=O)C=C1N(=O)=O"
     14717      -53.156      -52.796      -54.296       26.265      -28.031 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + [OH-] theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=N[O-] theory{ccsd(t)}"
     13478      -53.390      -53.134      -55.156       29.926      -25.230 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(O)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
     13473       -4.059       -4.188       -5.876        1.293       -4.583 EA + BCD --> AB + CDE    "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
     13462       -1.190       -1.279       -2.131        4.468        2.337 EA + BCD --> AB + CDE    "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
     12445      -56.957      -56.636      -58.320       28.835      -29.485 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe0} + O=[N]=O ^{-1} xc{pbe0}"
     12417      -61.996      -60.282      -49.145       53.623        4.478 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe0}"
     11672      -52.318      -52.705      -53.948       49.770       -4.178 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O xc{pbe0}"
     11669      -54.955      -54.687      -57.040       26.204      -30.836 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O=N[O-] xc{pbe0}"
     11640      -67.282      -64.755      -53.837       55.961        2.124 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe0}"
     11579      -30.647      -30.979      -32.709       45.832       13.123 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe0} + O xc{pbe0}"
     11519      -54.421      -54.152      -57.022       25.370      -31.652 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:ethanol} + hydroxide solvation_type{COSMO-SMD:ethanol} --> TNT-4-OH solvation_type{COSMO-SMD:ethanol} + nitrite solvation_type{COSMO-SMD:ethanol}"
     11354      -54.421      -54.152      -57.022       15.290      -41.732 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:edc12} + hydroxide solvation_type{COSMO-SMD:edc12} --> TNT-4-OH solvation_type{COSMO-SMD:edc12} + nitrite solvation_type{COSMO-SMD:edc12}"
     11238      -53.565      -53.292      -56.162       24.340      -31.822 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> TNT-4-OH solvation_type{COSMO-SMD:o-cresol} + nitrite solvation_type{COSMO-SMD:o-cresol}"
     11237      -53.565      -53.292      -56.162       14.850      -41.312 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> TNT-4-OH solvation_type{COSMO-SMD:acetone} + nitrite solvation_type{COSMO-SMD:acetone}"
     10902      -62.518      -60.919      -49.619       52.924        3.305 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe}"
     10866      -61.488      -61.419      -64.231       29.967      -34.264 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
     10864      -69.399      -69.726      -70.391       53.901      -16.490 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc([O-])cc1N(=O)=O + O"
     10817      -70.572      -68.042      -57.292       57.574        0.282 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{m06-2x}"
     10701      -66.425      -64.151      -53.032       55.672        2.640 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe}"
     10693      -51.490      -51.269      -53.733       24.790      -28.944 AB + C --> AC + B        "TNT xc{pbe} + [OH-] xc{pbe} --> TNT-4-OH xc{pbe} + nitrite xc{pbe}"
     10692      -57.701      -57.963      -61.028       27.194      -33.834 AB + C --> AC + B        "TNT xc{m06-2x} + [OH-] xc{m06-2x} --> TNT-4-OH xc{m06-2x} + nitrite xc{m06-2x}"
     10691      -54.632      -54.404      -56.421       29.005      -27.415 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
     10655      -64.483      -62.739      -51.927       57.238        5.311 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
     10451       -2.970       -3.408       -5.229        0.734       -4.495 EA + BCD --> AB + CDE    "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
      9709      -55.347      -55.709      -56.516       49.169       -7.347 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + O xc{pbe}"
      9645      -52.474      -52.848      -54.908       51.784       -3.124 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
      9637      -67.282      -64.755      -53.837       56.021        2.184 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe0}"
      9378      -30.072      -30.528      -31.548       46.724       15.176 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
      8953      -59.555      -57.237      -47.295        0.000      -47.295 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O theory{pspw4} xc(pbe}"
      7872      -29.376      -29.915      -31.360       45.991       14.631 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
      7823      -30.647      -30.979      -32.709       45.892       13.183 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe0} + O xc{pbe0}"
      7822      -29.376      -29.917      -31.361       46.041       14.680 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O xc{pbe} + O xc{pbe}"
      7821      -52.477      -52.839      -54.878       51.785       -3.094 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O xc{m06-2x}"
      7816      -52.318      -52.705      -53.948       49.830       -4.118 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O xc{pbe0}"
      7764      -65.729      -63.537      -52.843       54.938        2.095 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O xc{pbe}"
      7688      -25.000      -25.513      -27.595        0.000      -27.595 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O theory{pspw4} xc(pbe} + O theory{pspw4} xc(pbe}"
      7687      -51.283      -52.052      -53.963        0.000      -53.963 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> [CH2-]c1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + O theory{pspw4} xc(pbe}"
      7646      -55.616      -53.708      -43.300        0.000      -43.300 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} xc(pbe} + [OH-] theory{pspw4} xc(pbe} --> CC1(O)C(N(=O)=O)=CC(O)=C[C-]1N(=O)=O theory{pspw4} xc(pbe}"
      7623       -5.741       -5.819       -5.704        4.228       -1.476 EA + BCD --> AB + CDE    "TNT-4-OH + water --> Oc1cc(O)c(c(c1)N(=O)=O)C + ON=O"
      7558       -1.025       -1.052       -2.187        0.184       -2.003 EA + BCD --> AB + CDE    "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
      6923      -54.421      -54.169      -56.623       28.810      -27.813 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O solvation_type{COSMO-SMD} + [OH-] solvation_type{COSMO-SMD} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O solvation_type{COSMO-SMD} + O=N[O-] solvation_type{COSMO-SMD}"
      6577      -39.920      -38.700      -38.749       22.697      -16.052 AB + C --> AC + B        "Sc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + [SH] ^{-1}"
      6496      -61.491      -61.410      -64.202       29.968      -34.234 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{m06-2x} + O=[N]=O ^{-1} xc{m06-2x}"
      6495      -56.957      -56.636      -58.320       28.895      -29.425 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe0} + O=[N]=O ^{-1} xc{pbe0}"
      6494      -53.936      -53.791      -56.232       28.272      -27.960 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> Oc1cc(O)c(c(c1)N(=O)=O)C xc{pbe} + O=[N]=O ^{-1} xc{pbe}"
      6493      -64.485      -62.730      -51.897       57.239        5.341 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{m06-2x}"
      6492      -61.753      -59.977      -48.904       53.494        4.590 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe0}"
      6491      -61.822      -60.306      -49.430       52.191        2.761 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C xc{pbe} + hydroxide ^{-1} xc{pbe} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1} xc{pbe}"
      6412       -2.968       -3.473       -5.161        1.870       -3.291 EA + BCD --> AB + CDE    "TNT xc{m06-2x} solvation_type{COSMO-SMD:methanol} + water xc{m06-2x} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{m06-2x} solvation_type{COSMO-SMD:methanol} + nitrous acid xc{m06-2x} solvation_type{COSMO-SMD:methanol}"
      6411       -2.221       -2.297       -3.997        2.740       -1.257 EA + BCD --> AB + CDE    "TNT xc{b3lyp} solvation_type{COSMO-SMD:methanol} + water xc{b3lyp} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{b3lyp} solvation_type{COSMO-SMD:methanol} + nitrous acid xc{b3lyp} solvation_type{COSMO-SMD:methanol}"
      6390      -57.697      -58.024      -60.957       28.170      -32.787 AB + C --> AC + B        "TNT xc{m06-2x} solvation_type{COSMO-SMD:methanol} + hydroxide xc{m06-2x} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{m06-2x} solvation_type{COSMO-SMD:methanol} + nitrite xc{m06-2x} solvation_type{COSMO-SMD:methanol}"
      6389      -51.490      -51.274      -53.683       27.110      -26.573 AB + C --> AC + B        "TNT xc{pbe} solvation_type{COSMO-SMD:methanol} + hydroxide xc{pbe} solvation_type{COSMO-SMD:methanol} --> TNT-4-OH xc{pbe} solvation_type{COSMO-SMD:methanol} + nitrite xc{pbe} solvation_type{COSMO-SMD:methanol}"
      6209      -54.421      -54.152      -57.022        8.950      -48.072 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:toluene} + hydroxide solvation_type{COSMO-SMD:toluene} --> TNT-4-OH solvation_type{COSMO-SMD:toluene} + nitrite solvation_type{COSMO-SMD:toluene}"
      6206      -54.421      -54.152      -57.022       27.980      -29.042 AB + C --> AC + B        "TNT solvation_type{COSMO-SMD:methanol} + hydroxide solvation_type{COSMO-SMD:methanol} --> TNT-4-OH solvation_type{COSMO-SMD:methanol} + nitrite solvation_type{COSMO-SMD:methanol}"
      5969      -61.247      -58.827      -47.398       56.483        9.084 A + B --> AB             "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> CC1=C(N(=O)=O)C(O)C(O)=C[C-]1N(=O)=O"
      5935      -29.909      -30.400      -30.743       47.393       16.650 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc(O)[c-]c1N(=O)=O + O"
      5817      -57.941      -57.674      -58.729       29.686      -29.043 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(O)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
      5727       -0.369       -0.434       -2.854        0.000       -2.854 EA + BCD --> AB + CDE    "TNT theory{pspw4} xc{pbe0} + water theory{pspw4} xc{pbe0} --> TNT-4-OH theory{pspw4} xc{pbe0} + nitrous acid theory{pspw4} xc{pbe0}"
      5689      -15.921      -17.075      -19.446        5.314      -14.132 AB + C --> AC + B        "TNT-4-OH + [SH-] ^{-1} --> Oc1cc(S)c(c(c1)N(=O)=O)C + O=[N]=O ^{-1}"
      5097      408.443      401.540      394.998     -257.634       38.764 AB --> A + B             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C mult{2} + [H] ^{1} + [SHE]"
      5096      408.443      401.540      394.998     -257.634       38.764 AB --> A + B             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc(N(=O)=O)c(c(c1)N(=O)=O)C mult{2} + [H] ^{1} + [SHE]"
      5056       -2.809       -2.853       -4.021        0.000       -4.021 EA + BCD --> AB + CDE    "TNT theory{pspw} + water theory{pspw} --> TNT-4-OH theory{pspw} + N(=O)O theory{pspw}"
      5043       -1.831       -1.817       -2.147        0.767       -1.380 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + O theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=NO theory{ccsd(t)}"
      5042       -0.663       -0.662       -2.359        0.000       -2.359 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
      5038        2.758        2.772        2.442        0.767        3.209 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + O theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=NO theory{mp2}"
      5002      -52.557      -53.011      -53.497       50.228       -3.269 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)[CH2] ^{-1} + O"
      4997       48.139       46.875       48.199       -8.330       39.869 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C --> [O]c1cc([N](=O)O)c(c(c1)N(=O)=O)C"
      4281       -2.967       -3.417       -5.258        0.733       -4.526 EA + BCD --> AB + CDE    "TNT xc{m06-2x} + water xc{m06-2x} --> TNT-4-OH xc{m06-2x} + N(=O)O xc{m06-2x}"
      3940      -52.102      -51.850      -55.468        0.000      -55.468 AB + C --> AC + B        "TNT theory{pspw4} xc{pbe0} + hydroxide theory{pspw4} xc{pbe0} --> TNT-4-OH theory{pspw4} xc{pbe0} + nitrite theory{pspw4} xc{pbe0}"
      3081      -56.170      -54.497      -42.973       53.382       10.410 A + B --> AB             "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C + hydroxide ^{-1} --> OC1=CC(=[C](C(=C1)N(=O)=O)(C)O)N(=O)=O ^{-1}"
      2419       -0.637       -0.591       -2.169        0.000       -2.169 EA + BCD --> AB + CDE    "TNT theory{pspw} xc{pbe0} + water theory{pspw} xc{pbe0} --> TNT-4-OH theory{pspw} xc{pbe0} + nitrous acid theory{pspw} xc{pbe0}"
      2418       -2.447        9.507       15.426        3.595       19.020 EA + BCD --> AB + CDE    "TNT xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> TNT-4-OH xc{pbe0} basis{6-31G*} + nitrous acid xc{pbe0} basis{6-31G*}"
      2304       -4.059       -4.187       -5.875        1.313       -4.562 EA + BCD --> AB + CDE    "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
      2179       -1.025       -1.051       -2.186        0.143       -2.043 EA + BCD --> AB + CDE    "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
      1962       -2.221       -2.219       -3.963       -0.144       -4.108 EA + BCD --> AB + CDE    "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"
      1264      -51.157      -50.817      -53.618        0.000      -53.618 AB + C --> AC + B        "Oc1cc(N(=O)=O)c(c(c1)N(=O)=O)C theory{pspw4} + hydroxide ^{-1} theory{pspw4} --> Oc1cc(O)c(c(c1)N(=O)=O)C theory{pspw4} + O=[N]=O ^{-1} theory{pspw4}"
      1214      -48.218      -47.811      -50.084        0.000      -50.084 AB + C --> AC + B        "TNT theory{pspw} + hydroxide theory{pspw} --> TNT-4-OH theory{pspw} + nitrite theory{pspw}"
      1183      -52.545      -52.314      -54.886       27.482      -27.404 AB + C --> AC + B        "TNT theory{dft} xc{blyp} parse_output{grxn(gas)} + hydroxide theory{dft} xc{blyp} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{blyp} parse_output{grxn(gas)} + nitrite theory{dft} xc{blyp} parse_output{grxn(gas)}"
      1164       -2.967       -3.417       -5.258        0.733       -4.526 EA + BCD --> AB + CDE    "TNT xc{m06-2x} parse_output{grxn(aq)} + water xc{m06-2x} parse_output{grxn(aq)} --> TNT-4-OH xc{m06-2x} parse_output{grxn(aq)} + N(=O)O xc{m06-2x} parse_output{grxn(aq)}"
      1163       -2.809       -2.853       -4.021        0.000       -4.021 EA + BCD --> AB + CDE    "TNT theory{pspw} parse_output{grxn(aq)} + water theory{pspw} parse_output{grxn(aq)} --> TNT-4-OH theory{pspw} parse_output{grxn(aq)} + N(=O)O theory{pspw} parse_output{grxn(aq)}"
      1155      -57.698      -57.972      -61.057       27.193      -33.864 AB + C --> AC + B        "TNT theory{dft} xc{m06-2x} parse_output{grxn(gas)} + hydroxide theory{dft} xc{m06-2x} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{m06-2x} parse_output{grxn(gas)} + nitrite theory{dft} xc{m06-2x} parse_output{grxn(gas)}"
      1154      -52.186      -51.883      -53.922       25.523      -28.399 AB + C --> AC + B        "TNT theory{dft} xc{pbe} parse_output{grxn(gas)} + hydroxide theory{dft} xc{pbe} parse_output{grxn(gas)} --> TNT-4-OH theory{dft} xc{pbe} parse_output{grxn(gas)} + nitrite theory{dft} xc{pbe} parse_output{grxn(gas)}"
       370       -2.887       -3.709       -6.472        1.215       -5.257 EA + BCD --> AB + CDE    "TNT xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> TNT-4-OH xc{pbe0} basis{6-31G*} + nitrous acid xc{pbe0} basis{6-31G*}"
       348       -4.059       -4.187       -5.875        1.313       -4.562 EA + BCD --> AB + CDE    "TNT xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> TNT-4-OH xc{pbe} basis{6-31G*} + nitrous acid xc{pbe} basis{6-31G*}"
       336       -1.025       -1.051       -2.186        0.143       -2.043 EA + BCD --> AB + CDE    "TNT xc{pbe0} + water xc{pbe0} --> TNT-4-OH xc{pbe0} + nitrous acid xc{pbe0}"
       335       -0.637       -0.591       -2.169        0.000       -2.169 EA + BCD --> AB + CDE    "TNT theory{pspw} xc{pbe0} + water theory{pspw} xc{pbe0} --> TNT-4-OH theory{pspw} xc{pbe0} + nitrous acid theory{pspw} xc{pbe0}"
       138      -53.156      -52.795      -54.296       26.345      -27.950 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + [OH-] theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=N[O-] theory{ccsd(t)}"
       137       -1.831       -1.817       -2.147        0.767       -1.380 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{ccsd(t)} + O theory{ccsd(t)} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{ccsd(t)} + O=NO theory{ccsd(t)}"
       136        2.758        2.772        2.442        0.767        3.209 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + O theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=NO theory{mp2}"
       135       -0.663       -0.662       -2.359        0.000       -2.359 EA + BCD --> AB + CDE    "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + O theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=NO theory{pspw4}"
       134      -47.755      -47.375      -50.196        0.000      -50.196 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw4} + [OH-] theory{pspw4} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw4} + O=N[O-] theory{pspw4}"
       133      -15.375      -14.981      -17.251        0.000      -17.251 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pspw} + O=N[O-] theory{pspw}"
       132      -65.996      -65.741      -69.320      966.667      897.347 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{pm3} + [OH-] theory{pm3} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{pm3} + O=N[O-] theory{pm3}"
       131      -52.186      -51.883      -53.922       25.534      -28.388 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe} + [OH-] xc{pbe} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe} + O=N[O-] xc{pbe}"
       130      -57.696      -57.969      -61.054       27.133      -33.921 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{m06-2x} + [OH-] xc{m06-2x} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{m06-2x} + O=N[O-] xc{m06-2x}"
       129      -49.153      -48.792      -50.293       26.345      -23.947 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O theory{mp2} + [OH-] theory{mp2} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O theory{mp2} + O=N[O-] theory{mp2}"
       128      -54.955      -54.688      -57.042       26.274      -30.768 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{pbe0} + O=N[O-] xc{pbe0}"
       127      -50.850      -50.577      -52.653       27.886      -24.767 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O xc{lda} + [OH-] xc{lda} --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O xc{lda} + O=N[O-] xc{lda}"
        15      -54.422      -54.074      -56.988       25.304      -31.685 AB + C --> AC + B        "Cc1c(N(=O)=O)cc(N(=O)=O)cc1N(=O)=O + [OH-] --> Cc1c(N(=O)=O)cc(O)cc1N(=O)=O + O=N[O-]"
         1       -2.221       -2.219       -3.963       -0.144       -4.108 EA + BCD --> AB + CDE    "TNT + water --> CC1=C(C=C(C=C1[N](=O)=O)O)[N](=O)=O + N(O)=O"


All requests to Arrows were successful.


Link to EMSL Arrows API
More information about EMSL Arrows

KEYWORDs - 
   reaction: :reaction
   chinese_room: :chinese_room
   molecule: :molecule
   nmr: :nmr
   predict: :predict
   submitesmiles: :submitesmiles
   nosubmitmissingesmiles
   resubmitmissingesmiles
   submitmachines: :submitmachines
   useallentries
   nomodelcorrect
   eigenvalues: :eigenvalues
   frequencies: :frequencies
   nwoutput: :nwoutput
   xyzfile: :xyzfile
   alleigs: :alleigs
   allfreqs: :allfreqs

   reactionenumerate:
      energytype:[erxn(gas) hrxn(gas) grxn(gas) delta_solvation grxn(aq)] :energytype
      energytype:[kcal/mol kj/mol ev cm-1 ry hartree au] :energytype
      tablereactions:
         reaction: ... :reaction
         reaction: ... :reaction
         ...
      :tablereactions
      tablemethods:
         method: ... :method
         method: ... :method
         ...
      :tablemethods
   :reactionenumerate


   rotatebonds
   xyzinput:
      label:  :label
      xyzdata:
       ... xyz data ...
      :xyzdata
   :xyzinput


   submitHf: :submitHf
   nmrexp: :nmrexp

   findreplace: old text | new text :findreplace

   listnwjobs
   fetchnwjob: :fetchnwjob
   pushnwjob: :pushnwjob

   printcsv: :printcsv
   printeig: :printeig
   printfreq: :printfreq
   printxyz: :printxyz
   printjobinfo: :printjobinfo
   printnwout: :printnwout
   badids: :badids
   hup_string: 
   database:
   table:
   request_table:
   listallesmiles
   queuecheck                              
This software service and its documentation were developed at the Environmental Molecular Sciences Laboratory (EMSL) at Pacific Northwest National Laboratory, a multiprogram national laboratory, operated for the U.S. Department of Energy by Battelle under Contract Number DE-AC05-76RL01830. Support for this work was provided by the Department of Energy Office of Biological and Environmental Research, and Department of Defense environmental science and technology program (SERDP). THE SOFTWARE SERVICE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE SERVICE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE SERVICE.