Copyright Arrows Logo 3D Periodic Editor  3D Molecular And Reaction Editor   Expert Editor   Microsoft Quantum Editor   EMSL Aerosol Workshop Editor   Manual

Results from an EMSL Arrows Calculation

EMSL Arrows is a revolutionary approach to materials and chemical simulations that uses NWChem and chemical computational databases to make materials and chemical modeling accessible via a broad spectrum of digital communications including posts to web APIs, social networks, and traditional email.

Molecular modeling software has previously been extremely complex, making it prohibative to all but experts in the field, yet even experts can struggle to perform calculations. This service is designed to be used by experts and non-experts alike. Experts can carry out and keep track of large numbers of complex calculations with diverse levels of theories present in their workflows. Additionally, due to a streamlined and easy-to-use input, non-experts can carry out a wide variety of molecular modeling calculations previously not accessible to them.



The id(s) for emsiles = CO theory{ccsd(t)} xc{unknown} basis{6-311++G(2d,2p)} solvation_type{COSMO} ^{0} theory_base{dft} xc_base{b3lyp} basis_base{6-311++G(2d,2p)} are: 11219 
Use id=% instead of esmiles to print other entries.

mformula     = C1H4O1
iupac        = methanol
PubChem      = 887
PubChem LCSS = 887
cas          = 67-56-1
kegg         = C00132 D02309
synonyms     = methanol; methyl alcohol; wood alcohol; carbinol; Wood spirit; Methylol; Wood naphtha; Methyl hydroxide; Pyroxylic spirit; Colonial Spirit; Columbian Spirit; Monohydroxymethane; Columbian spirits; Methylalkohol; 67-56-1; Alcool methylique; Methyl hydrate; Alcohol, methyl; MeOH; Bieleski's solution; CH3OH; Hydroxymethane; Metanolo; Alcool metilico; Colonial spirits; Metylowy alkohol; Pyroxylic spirits; Rcra waste number U154; Freers Elm Arrester; Surflo-B17; Wilbur-Ellis Smut-Guard; Eureka Products, Criosine; Coat-B1400; Metanol [Spanish]; Metanolo [Italian]; Caswell No. 552; Methylalkohol [German]; Carbonal; Pyro alcohol; Alkohol metylowy; Spirit of wood; Alcool metilico [Italian]; Metylowy alkohol [Polish]; MetOH; RCRA waste no. U154; Alcool methylique [French]; X-Cide 402 Industrial Bactericide; Ideal Concentrated Wood Preservative; Eureka Products Criosine Disinfectant; (14c)methanol; NSC 85232; UN1230; HSDB 93; CCRIS 2301; Methanol-water mixture; Methyl alcohol [NF]; CHEBI:17790; AI3-00409; EPA Pesticide Chemical Code 053801; UNII-Y4S76JWI15; Methanol solution; OKKJLVBELUTLKV-UHFFFAOYSA-N; EINECS 200-659-6; JandaJel(TM)-OH; Methyl alcohol (NF); NCGC00091172-01; DSSTox_CID_1731; DSSTox_RID_76297; DSSTox_GSID_21731; Methanol with 0.1% acetic acid; Methanol with 0.1% formic acid; Dimethyl sulfoxide:Methanol solution; Methanol, or methyl alcohol [UN1230] [Flammable liquid, Poison]; Methanol with 0.1% ammonium acetate; Methanol, or methyl alcohol [UN1230]  [Flammable liquid, Poison]; CAS-67-56-1; Methanol with 0.1% trifluoroacetic acid; 31648-08-5; MOH; Methylalcohol; Metanol; hydroxyl carbon; methanol-; Wood; primary alcohols; Methanol cluster; Methoxy Group; Methylic alcohol; a primary alcohol; JandaJel™-OH; Solutions, Bieleski's; Columbian     spirits; RFPDX@; HYDRANAL-Methanol dry; AC1O5DUN; long chain fatty alcohols; HYD-CH2; ACMC-1C6GT; bmse000294; Epitope ID:116865; AC1Q41DX; Methanol, or methyl alcohol; HYDRANAL(R)-Methanol dry; WLN: Q1; KSC272E0H; 40217_ALDRICH; 40296_ALDRICH; CHEMBL14688; M1770_SIGMA; M1775_SIGMA; 179957_ALDRICH; 24229_RIEDEL; 32213_RIEDEL; 322415_ALDRICH; 34485_RIEDEL; 34670_RIEDEL; 34671_RIEDEL; 34672_RIEDEL; 34741_RIEDEL; 34802_RIEDEL; 34885_RIEDEL; 34898_RIEDEL; 34940_RIEDEL; 34966_RIEDEL; 34974_RIEDEL; 40217_RIEDEL; 40296_RIEDEL; 414719_ALDRICH; 414816_ALDRICH; 494437_ALDRICH; 524565_ALDRICH; 524573_ALDRICH; 524581_ALDRICH; 632546_ALDRICH; 646377_ALDRICH; 650188_ALDRICH; 650609_ALDRICH; 662186_ALDRICH; 667390_ALDRICH; AC1L1A92; M1775_SIAL; Y4S76JWI15; 34485_FLUKA; 34670_FLUKA; 34671_FLUKA; 34672_FLUKA; 34741_FLUKA; 34802_FLUKA; 34966_FLUKA; 34974_FLUKA; 65542_FLUKA; 65554_FLUKA; 82762_FLUKA; CHEBI:15734; CHEBI:73312; CTK1H2203; HMDB01875; 414719_FLUKA; 414816_FLUKA; ADSJRDYXKYXFKM-UHFFFAOYSA-N; MolPort-000-871-956; OXYMETHYLENE BRIDGING GROUP; 24229_SIAL; 32213_SIAL; 34860_SIAL; 34885_SIAL; 34898_SIAL; 34940_SIAL; 65542_SIAL; KST-1A3746; LTBB002976; 154903_SIAL; 179337_SIAL; 179957_SIAL; 322415_SIAL; 439193_SIAL; 494437_SIAL; 632546_SIAL; 646377_SIAL; 650188_SIAL; 650609_SIAL; 662186_SIAL; 667390_SIAL; 676780_SIAL; NSC85232; Tox21_111094; Tox21_202523; 8292AF; ANW-42510; AR-1A0519; CB0177; InChI=1/CH4O/c1-2/h2H,1H; NSC-85232; AKOS000269045; LS-1564; RL04579; RTR-022695; UN 1230; NCGC00260072-01; AN-41892; HYDRANAL-Water-in-methanol Standard 5.00; TR-022695; FT-0623465; FT-0628297; M0097; M0628; C00132; D02309; HYDRANAL(R)-Water-in-methanol Standard 5.00; 300138X; 3B4-1055; I14-12647; A(3/4)(3/4)<<; UNII-N4G9GAT76C component OKKJLVBELUTLKV-UHFFFAOYSA-N; 9beta,11beta-Epoxy-17alpha,21-dihydroxy-16beta-methylene-pregna-1,4-diene-3,20-dione; 1173023-83-0; 54841-71-3; OMB; OME

Search Links to Other Online Resources (may not be available):
 - Google Structure Search
 - EPA CompTox Database
 - Chemical Entities of Biological Interest (ChEBI)
 - NIH ChemIDplus - A TOXNET DATABASE
 - The Human Metabolome Database (HMDB)
 - OECD eChemPortal
 - Google Scholar



+==================================================+
||              Molecular Calculation             ||
+==================================================+

Id     = 11219

NWOutput = Link to NWChem Output (download)

image_resset: api/image_reset/11219

Calculation performed by gorgon
Numbers of cpus used for calculation = 4
Calculation walltime = 379.700000 seconds (0 days 0 hours 6 minutes 19 seconds)


+----------------+
| Energetic Data |
+----------------+

Id       = 11219 
iupac    = methanol
mformula = C1H4O1
inchi    = InChI=1S/CH4O/c1-2/h2H,1H3
inchikey = OKKJLVBELUTLKV-UHFFFAOYSA-N
esmiles  = CO theory{ccsd(t)} xc{unknown} basis{6-311++G(2d,2p)} solvation_type{COSMO} ^{0} theory_base{dft} xc_base{b3lyp} basis_base{6-311++G(2d,2p)}
calculation_type = ovc
theory           = ccsd(t)
xc               = unknown
basis            = 6-311++G(2d,2p)
charge,mult      = 0 1
energy           =    -115.511115 Hartrees
enthalpy correct.=       0.055492 Hartrees
entropy          =         56.958 cal/mol-K
solvation energy =         -5.171 kcal/mol  solvation_type = COSMO
Sitkoff cavity dispersion          =          1.679 kcal/mol
Honig cavity dispersion            =          4.094 kcal/mol
ASA solvent accesible surface area =        163.771 Angstrom2
ASA solvent accesible volume       =        147.852 Angstrom3



+-----------------+
| Structural Data |
+-----------------+

JSmol: an open-source HTML5 viewer for chemical structures in 3D


  Number of Atoms = 6
 
  Units are Angstrom for bonds and degrees for angles

      Type          I     J     K     L     M      Value
      ----------- ----- ----- ----- ----- ----- ----------
    1 Stretch        C1    O2                      1.42418
    2 Stretch        C1    H3                      1.09353
    3 Stretch        C1    H4                      1.09353
    4 Stretch        C1    H5                      1.08744
    5 Stretch        O2    H6                      0.95993
    6 Bend           O2    C1    H3              111.99159
    7 Bend           O2    C1    H4              111.99154
    8 Bend           O2    C1    H5              106.69276
    9 Bend           H3    C1    H4              109.08239
   10 Bend           H3    C1    H5              108.47158
   11 Bend           H4    C1    H5              108.47144
   12 Bend           C1    O2    H6              108.91314
   13 Dihedral       H3    C1    O2    H6         61.45530
   14 Dihedral       H4    C1    O2    H6        -61.45654
   15 Dihedral       H5    C1    O2    H6        179.99948

 
+-----------------+
| Eigenvalue Data |
+-----------------+

Id       = 11219
iupac    = methanol
mformula = C1H4O1
InChI    = InChI=1S/CH4O/c1-2/h2H,1H3
smiles   = CO
esmiles  = CO theory{ccsd(t)} xc{unknown} basis{6-311++G(2d,2p)} solvation_type{COSMO} ^{0} theory_base{dft} xc_base{b3lyp} basis_base{6-311++G(2d,2p)}
theory   = ccsd(t)
xc       = unknown
basis    = 6-311++G(2d,2p)
charge   = 0
mult     = 1
solvation_type = COSMO

twirl webpage  = TwirlMol Link
image webpage  = GIF Image Link

          Eigevalue Spectra
                ----------   15.10 eV                                      
                ----------                                                 
                ----------                                                 
                ----  ----                                                 
                ----------                                                 
                                                                           
                -- -- -- -                                                 
                -- -- -- -                                                 
                ----  ----                                                 
                ----  ----                                                 
                7  - - - -                                                 
                ----  ----                                                 
                - - - - --                                                 
                -- -- -- -                                                 
                ----  ---- LUMO=  -0.19 eV                                 
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
HOMO=  -7.96 eV ++++++++++                                                 
                ++++++++++                                                 
                                                                           
                ++++++++++                                                 
                ++++  ++++                                                 
                ++++  ++++                                                 
                                                                           
                ++++++++++                                                 
                ++++++++++                                                 
                                                                           
                ++++  ++++                                                 
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
                ++++++++++                                                 
                                                                           
                                                                           
                ++++++++++                                                 
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
                                                                           
      -36.92 eV ++++++++++                                                 



spin            eig      occ
----------------------------
restricted   -28.05     2.00
restricted   -18.74     2.00
restricted   -14.06     2.00
restricted   -12.14     2.00
restricted   -11.87     2.00
restricted    -9.57     2.00
restricted    -7.96     2.00
restricted    -0.19     0.00
restricted     0.42     0.00
restricted     0.98     0.00
restricted     1.00     0.00
restricted     1.96     0.00
restricted     2.46     0.00
restricted     2.62     0.00
restricted     3.28     0.00
restricted     4.47     0.00
restricted     4.59     0.00
restricted     4.90     0.00
restricted     4.97     0.00
restricted     5.46     0.00
restricted     5.57     0.00
restricted     6.39     0.00
restricted     7.11     0.00
restricted     8.62     0.00
restricted    11.44     0.00
restricted    11.53     0.00
restricted    14.03     0.00
restricted   -36.92     2.00
restricted   -25.23     2.00
restricted   -18.81     2.00
restricted   -16.87     2.00
restricted   -16.16     2.00
restricted   -13.73     2.00
restricted   -12.28     2.00
restricted     1.07     0.00
restricted     1.72     0.00
restricted     1.96     0.00
restricted     2.16     0.00
restricted     3.40     0.00
restricted     4.00     0.00
restricted     4.34     0.00
restricted     4.96     0.00
restricted     7.36     0.00
restricted     7.46     0.00
restricted     7.85     0.00
restricted     7.90     0.00
restricted     8.44     0.00
restricted     8.78     0.00
restricted     9.19     0.00
restricted    10.33     0.00
restricted    12.53     0.00
restricted    15.10     0.00

 
+----------------------------------------+
| Vibrational Density of States Analysis |
+----------------------------------------+

Total number of frequencies = 18
Total number of negative frequencies = 0
Number of lowest frequencies = 1 (frequency threshold = 500 )
Exact dos norm = 12.000

Generating vibrational DOS
Generating model vibrational DOS to have a proper norm
10.00 12.00 1.00 12.00


50.00 12.00 1.00 12.00


100.00 12.00 1.00 12.00


Generating IR Spectra
Writing vibrational density of states (DOS) to vdos.dat
Writing model vibrational density of states (DOS_FIXED) to vdos-model.dat

Writing IR spectra to irdos.dat
Temperature= 298.15 

zero-point correction to energy                 =   32.126 kcal/mol (  0.051196)
vibrational contribution to enthalpy correction =   32.453 kcal/mol (  0.051717)
vibrational contribution to Entropy             =    1.668 cal/mol-k

hindered rotor enthalpy correction              =    0.000 kcal/mol (  0.000000)
hindered rotor entropy correction               =    0.000 cal/mol-k





DOS sigma = 10.000000
  -       vibrational DOS enthalpy correction =   0.051717 kcal/mol (  32.453 kcal/mol)
  - model vibrational DOS enthalpy correction =   0.051718 kcal/mol (  32.453 kcal/mol)
  -       vibrational DOS Entropy             =   0.000003 (   1.669 cal/mol-k)
  - model vibrational DOS Entropy             =   0.000003 (   1.670 cal/mol-k)

  - original      gas Energy       =  -115.511115 (-72484.319 kcal/mol)

  - original      gas Enthalpy     =  -115.455623 (-72449.497 kcal/mol, delta=   0.000)
  - unajusted DOS gas Enthalpy     =  -115.455623 (-72449.497 kcal/mol, delta=   0.000)
  - model     DOS gas Enthalpy     =  -115.455622 (-72449.496 kcal/mol, delta=   0.001)

  - original      gas Entropy      =     0.000091 (  56.958 cal/mol-k,delta=   0.000)
  - unajusted DOS gas Entropy      =     0.000091 (  56.959 cal/mol-k,delta=   0.001)
  - model     DOS gas Entropy      =     0.000091 (  56.960 cal/mol-k,delta=   0.002)

  - original       gas Free Energy =  -115.482686 (-72466.479 kcal/mol, delta=   0.000)
  - unadjusted DOS gas Free Energy =  -115.482686 (-72466.479 kcal/mol, delta=  -0.000)
  - model      DOS gas Free Energy =  -115.482686 (-72466.479 kcal/mol, delta=  -0.000)

  - original       sol Free Energy =  -115.490927 (-72471.650 kcal/mol)
  - unadjusted DOS sol Free Energy =  -115.490927 (-72471.650 kcal/mol)
  - model      DOS sol Free Energy =  -115.490927 (-72471.650 kcal/mol)

DOS sigma = 50.000000
  -       vibrational DOS enthalpy correction =   0.051722 kcal/mol (  32.456 kcal/mol)
  - model vibrational DOS enthalpy correction =   0.051722 kcal/mol (  32.456 kcal/mol)
  -       vibrational DOS Entropy             =   0.000003 (   1.705 cal/mol-k)
  - model vibrational DOS Entropy             =   0.000003 (   1.705 cal/mol-k)

  - original      gas Energy       =  -115.511115 (-72484.319 kcal/mol)

  - original      gas Enthalpy     =  -115.455623 (-72449.497 kcal/mol, delta=   0.000)
  - unajusted DOS gas Enthalpy     =  -115.455618 (-72449.493 kcal/mol, delta=   0.004)
  - model     DOS gas Enthalpy     =  -115.455618 (-72449.493 kcal/mol, delta=   0.004)

  - original      gas Entropy      =     0.000091 (  56.958 cal/mol-k,delta=   0.000)
  - unajusted DOS gas Entropy      =     0.000091 (  56.996 cal/mol-k,delta=   0.038)
  - model     DOS gas Entropy      =     0.000091 (  56.996 cal/mol-k,delta=   0.038)

  - original       gas Free Energy =  -115.482686 (-72466.479 kcal/mol, delta=   0.000)
  - unadjusted DOS gas Free Energy =  -115.482698 (-72466.487 kcal/mol, delta=  -0.008)
  - model      DOS gas Free Energy =  -115.482698 (-72466.487 kcal/mol, delta=  -0.008)

  - original       sol Free Energy =  -115.490927 (-72471.650 kcal/mol)
  - unadjusted DOS sol Free Energy =  -115.490939 (-72471.658 kcal/mol)
  - model      DOS sol Free Energy =  -115.490939 (-72471.658 kcal/mol)

DOS sigma = 100.000000
  -       vibrational DOS enthalpy correction =   0.051738 kcal/mol (  32.466 kcal/mol)
  - model vibrational DOS enthalpy correction =   0.051740 kcal/mol (  32.467 kcal/mol)
  -       vibrational DOS Entropy             =   0.000003 (   1.839 cal/mol-k)
  - model vibrational DOS Entropy             =   0.000003 (   1.842 cal/mol-k)

  - original      gas Energy       =  -115.511115 (-72484.319 kcal/mol)

  - original      gas Enthalpy     =  -115.455623 (-72449.497 kcal/mol, delta=   0.000)
  - unajusted DOS gas Enthalpy     =  -115.455602 (-72449.483 kcal/mol, delta=   0.013)
  - model     DOS gas Enthalpy     =  -115.455600 (-72449.482 kcal/mol, delta=   0.014)

  - original      gas Entropy      =     0.000091 (  56.958 cal/mol-k,delta=   0.000)
  - unajusted DOS gas Entropy      =     0.000091 (  57.130 cal/mol-k,delta=   0.172)
  - model     DOS gas Entropy      =     0.000091 (  57.132 cal/mol-k,delta=   0.174)

  - original       gas Free Energy =  -115.482686 (-72466.479 kcal/mol, delta=   0.000)
  - unadjusted DOS gas Free Energy =  -115.482746 (-72466.517 kcal/mol, delta=  -0.038)
  - model      DOS gas Free Energy =  -115.482745 (-72466.516 kcal/mol, delta=  -0.037)

  - original       sol Free Energy =  -115.490927 (-72471.650 kcal/mol)
  - unadjusted DOS sol Free Energy =  -115.490987 (-72471.688 kcal/mol)
  - model      DOS sol Free Energy =  -115.490986 (-72471.687 kcal/mol)



Normal Mode    Frequency (cm-1)     IR Intensity (arbitrary)
-----------    ----------------     ------------------------
          1               0.000                        0.491
          2               0.000                        0.053
          3               0.000                        7.903
          4               0.000                        0.032
          5               0.000                        2.267
          6               0.000                        0.416
          7             299.380                       42.494
          8            1039.630                       45.578
          9            1082.350                        1.668
         10            1175.380                        0.056
         11            1375.910                        9.393
         12            1482.580                        0.990
         13            1502.050                        1.199
         14            1513.360                        1.977
         15            3006.330                       20.833
         16            3044.260                       22.786
         17            3115.530                       10.775
         18            3846.500                       11.090


No Hindered Rotor Data


+-------------------------------------+
| Reactions Contained in the Database |
+-------------------------------------+

Reactions Containing INCHIKEY = OKKJLVBELUTLKV-UHFFFAOYSA-N

Reactionid    Erxn(gas)    Hrxn(gas)    Grxn(gas)   delta_Solv     Grxn(aq) ReactionType             Reaction
     21310      149.187      146.657      133.659       -6.432      127.227 AC + BD --> A + B + CD   "COC1=CC(O)[C-]([C-]=C1N(=O)=O)N(=O)=O ^{-1} mult{2} --> O=N(=O)C1=[C][C](C(C=[C]1)[O])N(=O)=O + CO ^{-1} mult{2}"
     21309      149.187      146.657      133.659       -6.432      127.227 AC + BD --> A + B + CD   "COC1=CC(O)[C-]([C-]=C1N(=O)=O)N(=O)=O ^{-1} mult{2} --> O=N(=O)C1=[C][C](C(C=[C]1)[O])N(=O)=O + CO ^{-1} mult{2}"
     21285       41.661       37.711       22.222       -2.838       19.384 AC + BD --> A + B + CD   "CO[C]1[CH]C(O)C(C=C1N(=O)=O)N(=O)=O --> O=N(=O)C1=CC(C([CH][C]1)[O])N(=O)=O + CO"
     21284       41.661       37.711       22.222       -2.838       19.384 AC + BD --> A + B + CD   "CO[C]1[CH]C(O)C(C=C1N(=O)=O)N(=O)=O --> O=N(=O)C1=CC(C([CH][C]1)[O])N(=O)=O + CO"
     21254      144.815      147.079      144.358      -24.895      119.463 AB + C --> AC + B        "COc1ccc(cc1N(=O)=O)[O] ^{-1} + [OH-] ^{-1} --> O=C1C=CC(=C([CH]1)N(=O)=O)[O] + CO ^{-2}"
     21000        7.745        8.171        7.749       -3.226        4.523 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
     20999        7.745        8.171        7.749       -3.226        4.523 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
     20998        7.745        8.171        7.749       -3.226        4.523 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
     20997        7.745        8.171        7.749       -3.226        4.523 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
     20996       10.878        9.772       10.637        3.182       13.819 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     20995       10.878        9.772       10.637        3.182       13.819 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     20994       10.878        9.772       10.637        3.182       13.819 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     20993       10.878        9.772       10.637        3.182       13.819 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     20954       -4.396       -4.313       -4.200        0.000       -4.200 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
     20953       -4.396       -4.313       -4.200        0.000       -4.200 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
     20952       -4.396       -4.313       -4.200        0.000       -4.200 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
     20951       -4.396       -4.313       -4.200        0.000       -4.200 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
     20877       -5.532       -5.634       -5.906        0.000       -5.906 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
     20876       -5.532       -5.634       -5.906        0.000       -5.906 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
     20875       -5.532       -5.634       -5.906        0.000       -5.906 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
     20874       -5.532       -5.634       -5.906        0.000       -5.906 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
     20768      -79.968      -79.705      -81.742       38.440      -43.302 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> DNAN-1-O- solvation_type{COSMO-SMD:acetone} + CO solvation_type{COSMO-SMD:acetone}"
     20705   431968.596   431946.096   431960.828       -1.160   431959.668 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     20704   431968.596   431946.096   431960.828       -1.160   431959.668 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     20703   431968.596   431946.096   431960.828       -1.160   431959.668 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     20702   431968.596   431946.096   431960.828       -1.160   431959.668 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     20695      -79.968      -79.705      -81.742       56.340      -25.402 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD} + hydroxide solvation_type{COSMO-SMD} --> DNAN-1-O- solvation_type{COSMO-SMD} + CO solvation_type{COSMO-SMD}"
     20675      -10.175      -11.694      -25.041       -8.640      -33.681 CABD --> AB + CD         "COC1(O)C=CC(N(=O)=O)=C[C-]1N(=O)=O --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 + CO"
     20674      -10.175      -11.694      -25.041       -8.640      -33.681 CABD --> AB + CD         "COC1(O)C=CC(N(=O)=O)=C[C-]1N(=O)=O --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 + CO"
     20673       -1.052       -0.299       -0.299        1.777        1.479 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
     20672       -1.052       -0.299       -0.299        1.777        1.479 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
     20671       -1.052       -0.299       -0.299        1.777        1.479 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
     20670       -1.052       -0.299       -0.299        1.777        1.479 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
     20669        9.739       11.608       11.033        0.000       11.033 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     20668        9.739       11.608       11.033        0.000       11.033 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     20667        9.739       11.608       11.033        0.000       11.033 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     20666        9.739       11.608       11.033        0.000       11.033 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     20601       18.057       16.573       18.804        0.153       18.957 AB + C --> AC + B        "methane + [OH] --> methanol + [H]"
     20562      -28.132      -20.429      -11.782       -2.542      -14.323 AB + CD --> CABD         "C=O + [H][H] --> CO"
     20561      -28.132      -20.429      -11.782       -2.542      -14.323 AB + CD --> CABD         "C=O + [H][H] --> CO"
     20551        9.537        8.515       -3.366        2.507       -0.859 AB + CD --> AD + BC      "methyl bromide + oxidane --> MeOH + hydrogen bromide"
     20530      -13.703      -13.575      -13.514        0.000      -13.514 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     20529      -13.703      -13.575      -13.514        0.000      -13.514 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     20528      -13.703      -13.575      -13.514        0.000      -13.514 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     20527      -13.703      -13.575      -13.514        0.000      -13.514 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     20521      -15.352      -15.643      -16.007        0.000      -16.007 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     20520      -15.352      -15.643      -16.007        0.000      -16.007 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     20519      -15.352      -15.643      -16.007        0.000      -16.007 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     20518      -15.352      -15.643      -16.007        0.000      -16.007 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     20504      -11.939      -11.674      -11.529        5.951       -5.578 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     20503      -11.939      -11.674      -11.529        5.951       -5.578 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     20502      -11.939      -11.674      -11.529        5.951       -5.578 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     20501      -11.939      -11.674      -11.529        5.951       -5.578 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     20472      -62.349      -59.330      -57.544       26.704      -30.841 AB + C --> AC + B        "CBr xc{b3lyp} basis{6-311++G(2d,2p)} + [OH] ^{-1} xc{b3lyp} basis{6-311++G(2d,2p)} --> CO xc{b3lyp} basis{6-311++G(2d,2p)} + [Br] ^{-1} xc{b3lyp} basis{6-311++G(2d,2p)}"
     20448       37.895       34.908       19.992        4.585       24.577 AC + BD --> A + B + CD   "COC1=C(N(=O)=O)C(O)C(N(=O)=O)=C[CH-]1 --> O=N(=O)C1=C=CC=C(N(=O)=O)C1[O-] + CO"
     20447       37.895       34.908       19.992        4.585       24.577 AC + BD --> A + B + CD   "COC1=C(N(=O)=O)C(O)C(N(=O)=O)=C[CH-]1 --> O=N(=O)C1=C=CC=C(N(=O)=O)C1[O-] + CO"
     20432      -72.124      -71.749      -73.426       51.958      -21.468 AB + C --> AC + B        "DNAN-2-OH xc{b3lyp} + hydroxide ^{-1} xc{b3lyp} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{b3lyp} + CO xc{b3lyp}"
     20419        9.195       10.836       10.002       -2.092        7.910 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     20418        9.195       10.836       10.002       -2.092        7.910 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     20417        9.195       10.836       10.002       -2.092        7.910 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     20416        9.195       10.836       10.002       -2.092        7.910 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     20393      -52.510      -52.453      -54.206       41.562      -12.644 AB + C --> AC + B        "COc1ccc(cc1O)O + hydroxide ^{-1} --> Oc1ccc(c(c1)O)[O] ^{-1} + CO"
     20382        4.964        6.516        5.727       -1.951        3.776 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     20381        4.964        6.516        5.727       -1.951        3.776 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     20380        4.964        6.516        5.727       -1.951        3.776 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     20379        4.964        6.516        5.727       -1.951        3.776 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     20374        4.983        3.335        4.811        1.749        6.560 AB + CD --> AD + BC      "ClC(C)(C)C + Ch3OH --> Cl + O(C(C)(C)C)C"
     20270      -16.473      -16.415      -16.403       -1.204      -17.607 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     20269      -16.473      -16.415      -16.403       -1.204      -17.607 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     20268      -16.473      -16.415      -16.403       -1.204      -17.607 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     20267      -16.473      -16.415      -16.403       -1.204      -17.607 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     20266      -10.929      -10.681      -10.495       -0.748      -11.243 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     20265      -10.929      -10.681      -10.495       -0.748      -11.243 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     20264      -10.929      -10.681      -10.495       -0.748      -11.243 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     20263      -10.929      -10.681      -10.495       -0.748      -11.243 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     20202      -11.588      -12.009      -11.330        0.894      -10.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20201      -11.588      -12.009      -11.330        0.894      -10.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20200      -11.588      -12.009      -11.330        0.894      -10.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20199      -11.588      -12.009      -11.330        0.894      -10.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20190       -5.802       -6.189       -6.011        0.394       -5.617 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20189       -5.802       -6.189       -6.011        0.394       -5.617 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20188       -5.802       -6.189       -6.011        0.394       -5.617 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20187       -5.802       -6.189       -6.011        0.394       -5.617 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20164       -7.546       -8.063       -7.495        1.066       -6.429 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20163       -7.546       -8.063       -7.495        1.066       -6.429 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20162       -7.546       -8.063       -7.495        1.066       -6.429 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20161       -7.546       -8.063       -7.495        1.066       -6.429 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     20122       -4.694       -4.612       -4.419        1.320       -3.099 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     20121       -4.694       -4.612       -4.419        1.320       -3.099 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     20120       -4.694       -4.612       -4.419        1.320       -3.099 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     20119       -4.694       -4.612       -4.419        1.320       -3.099 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     20074      145.361      147.236      144.620      -14.923      129.697 AB + C --> AC + B        "COc1cc(CNC(=O)CCCCC=CC(C)C)c[c]c1O ^{-1} + hydroxide ^{-1} --> O=C(NCc1c[c]c(c(c1)[O])O)CCCCC=CC(C)C + CO ^{-2}"
     20055       -3.839        0.896        0.099       49.886       49.985 AB + C --> AC + B        "CO[C]1=C([N](=O)[O])C([CH](=[CH2]C1O)N(=O)=O)O ^{-2} + hydroxide ^{-1} --> OC1CC(N(=O)=O)C(C(=C1[O])N(=O)=O)O ^{-1} + CO ^{-2}"
     20052      267.807      271.302      269.068     -104.373      164.695 AB + C --> AC + B        "CO[C]1=[CH2]C(O)[C](C(C=1[N](=O)[O])O)N(=O)=O ^{-2} mult{2} + hydroxide ^{-1} --> O=N(=O)[C]1C(O)[CH2]=[C](=C(C1O)N(=O)=O)[O] + CO ^{-3} mult{2}"
     20012       -8.728       -9.085       -8.863        0.749       -8.114 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20011       -8.728       -9.085       -8.863        0.749       -8.114 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20010       -8.728       -9.085       -8.863        0.749       -8.114 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20009       -8.728       -9.085       -8.863        0.749       -8.114 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20006       -4.913       -5.326       -4.022        0.455       -3.567 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20005       -4.913       -5.326       -4.022        0.455       -3.567 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20004       -4.913       -5.326       -4.022        0.455       -3.567 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     20003       -4.913       -5.326       -4.022        0.455       -3.567 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19990       14.646       10.506        9.150       29.403       38.554 AB + C --> AC + B        "CO + [F-] --> C[O-] + F"
     19984       12.979        7.834       10.720       -0.042       10.678 AB + CD --> AD + BC      "C xc{m06-2x} + CO xc{m06-2x} --> CCO xc{m06-2x} + [HH] xc{m06-2x}"
     19975      -79.968      -79.700      -81.824       56.490      -25.334 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD} + hydroxide solvation_type{COSMO-SMD} --> DNAN-1-O- solvation_type{COSMO-SMD} + CO solvation_type{COSMO-SMD}"
     19967       -8.731       -8.416       -8.270        4.983       -3.287 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
     19966       -8.731       -8.416       -8.270        4.983       -3.287 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
     19965       -8.731       -8.416       -8.270        4.983       -3.287 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
     19964       -8.731       -8.416       -8.270        4.983       -3.287 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
     19943      -40.655      -39.919      -40.076       -1.913      -41.988 AB + CD --> AD + BC      "CC xc{pbe} + OO xc{pbe} --> CO xc{pbe} + CO xc{pbe}"
     19937      466.746      458.707      448.940     -168.049      280.891 AB --> A + B             "CO --> [CH3] ^{-1} + [OH] ^{1}"
     19936      466.746      458.707      448.940     -168.049      280.891 AB --> A + B             "CO --> [CH3] ^{-1} + [OH] ^{1}"
     19932        0.732        0.597        1.687       -1.470        0.217 AB + CD --> AD + BC      "methyl fluoride xc{m06-2x} + oxidane xc{m06-2x} --> MeOH xc{m06-2x} + hydrogen fluoride xc{m06-2x}"
     19926       -8.120       -8.889       -8.426        1.220       -7.207 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19925       -8.120       -8.889       -8.426        1.220       -7.207 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19924       -8.120       -8.889       -8.426        1.220       -7.207 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19923       -8.120       -8.889       -8.426        1.220       -7.207 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19920        1.152       -0.759      -14.455       -5.886      -20.340 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{m06-2x} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{m06-2x} + CO xc{m06-2x}"
     19919        1.152       -0.759      -14.455       -5.886      -20.340 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{m06-2x} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{m06-2x} + CO xc{m06-2x}"
     19918        3.252        4.069        4.193        0.021        4.214 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
     19917        3.252        4.069        4.193        0.021        4.214 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
     19916        3.252        4.069        4.193        0.021        4.214 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
     19915        3.252        4.069        4.193        0.021        4.214 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
     19912       -9.523      -10.260       -9.832        1.347       -8.485 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19911       -9.523      -10.260       -9.832        1.347       -8.485 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19910       -9.523      -10.260       -9.832        1.347       -8.485 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19909       -9.523      -10.260       -9.832        1.347       -8.485 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19901      -52.170      -49.597      -47.923       14.693      -33.230 AB + C --> AC + B        "CCl xc{pbe} + [OH-] xc{pbe} --> CO xc{pbe} + [Cl-] xc{pbe}"
     19895       13.946       10.548       13.355       -0.011       13.344 AB + CD --> AD + BC      "C xc{pbe} + CO xc{pbe} --> CCO xc{pbe} + [HH] xc{pbe}"
     19888        9.138        9.473        9.039       -0.818        8.221 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19887        9.138        9.473        9.039       -0.818        8.221 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19886        9.138        9.473        9.039       -0.818        8.221 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19885        9.138        9.473        9.039       -0.818        8.221 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19859       -5.892       -6.278       -5.607        0.432       -5.175 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19858       -5.892       -6.278       -5.607        0.432       -5.175 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19857       -5.892       -6.278       -5.607        0.432       -5.175 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19856       -5.892       -6.278       -5.607        0.432       -5.175 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19855       -6.036       -5.195       -5.683        5.227       -0.456 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
     19854       -6.036       -5.195       -5.683        5.227       -0.456 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
     19853       -6.036       -5.195       -5.683        5.227       -0.456 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
     19852       -6.036       -5.195       -5.683        5.227       -0.456 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
     19844       14.957       15.791       15.143       -1.902       13.241 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19843       14.957       15.791       15.143       -1.902       13.241 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19842       14.957       15.791       15.143       -1.902       13.241 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19841       14.957       15.791       15.143       -1.902       13.241 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19837       -8.101       -8.544       -6.884        0.906       -5.978 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19836       -8.101       -8.544       -6.884        0.906       -5.978 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19835       -8.101       -8.544       -6.884        0.906       -5.978 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19834       -8.101       -8.544       -6.884        0.906       -5.978 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19822      -48.155      -55.013      -64.644        5.704      -58.939 AB --> A + B             "CO ^{-2} --> [CH3] ^{-1} + [OH] ^{-1}"
     19821      -48.155      -55.013      -64.644        5.704      -58.939 AB --> A + B             "CO ^{-2} --> [CH3] ^{-1} + [OH] ^{-1}"
     19810      -80.515      -80.246      -82.416       54.515      -27.901 AB + C --> AC + B        "DNAN theory{dft} xc{pbe} + hydroxide theory{dft} xc{pbe} --> DNAN-1-O- theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19807        1.180        1.175        2.143       -1.240        0.903 AB + CD --> AD + BC      "methyl fluoride xc{pbe} + oxidane xc{pbe} --> MeOH xc{pbe} + hydrogen fluoride xc{pbe}"
     19799      -46.729      -46.328      -46.357       -1.994      -48.351 AB + CD --> AD + BC      "CC xc{m06-2x} + OO xc{m06-2x} --> CO xc{m06-2x} + CO xc{m06-2x}"
     19798       13.178       14.538       13.843       -1.662       12.181 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19797       13.178       14.538       13.843       -1.662       12.181 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19796       13.178       14.538       13.843       -1.662       12.181 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19795       13.178       14.538       13.843       -1.662       12.181 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19793      -79.968      -79.705      -81.742       48.030      -33.712 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> DNAN-1-O- solvation_type{COSMO-SMD:o-cresol} + CO solvation_type{COSMO-SMD:o-cresol}"
     19788       -6.326       -6.810       -6.280        0.695       -5.585 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     19787       -6.326       -6.810       -6.280        0.695       -5.585 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     19786       -6.326       -6.810       -6.280        0.695       -5.585 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     19785       -6.326       -6.810       -6.280        0.695       -5.585 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     19772      -74.263      -74.078      -75.679       52.209      -23.470 AB + C --> AC + B        "DNAN-2-OH xc{pbe} + hydroxide ^{-1} xc{pbe} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{pbe} + CO xc{pbe}"
     19748      126.469      128.544      125.796      -41.142       84.655 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)N(=O)=O ^{-1} xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> O=N(=O)c1c[c]c(c(c1)N(=O)=O)[O] xc{m06-2x} + CO ^{-2} xc{m06-2x}"
     19742       -5.484       -6.713      -19.988       -5.720      -25.708 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe} + CO xc{pbe}"
     19741       -5.484       -6.713      -19.988       -5.720      -25.708 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe} + CO xc{pbe}"
     19739       -4.855       -5.662       -5.845        0.659       -5.186 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19738       -4.855       -5.662       -5.845        0.659       -5.186 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19737       -4.855       -5.662       -5.845        0.659       -5.186 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19736       -4.855       -5.662       -5.845        0.659       -5.186 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19731       99.874       93.934       84.188        0.402       84.590 AB --> A + B             "CO xc{pbe} --> [CH3] xc{pbe} + [OH] xc{pbe}"
     19730       99.874       93.934       84.188        0.402       84.590 AB --> A + B             "CO xc{pbe} --> [CH3] xc{pbe} + [OH] xc{pbe}"
     19727        0.974        0.995        1.976       -1.210        0.765 AB + CD --> AD + BC      "methyl fluoride + oxidane --> MeOH + hydrogen fluoride"
     19723       11.401       12.524       11.851       -2.271        9.580 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
     19722       11.401       12.524       11.851       -2.271        9.580 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
     19721       11.401       12.524       11.851       -2.271        9.580 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
     19720       11.401       12.524       11.851       -2.271        9.580 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
     19714      -59.365      -56.794      -55.008        9.893      -45.115 AB + C --> AC + B        "CCl xc{m06-2x} + [OH-] xc{m06-2x} --> CO xc{m06-2x} + [Cl-] xc{m06-2x}"
     19703      -55.366      -52.660      -50.969       32.010      -18.959 AB + C --> AC + B        "methyl chloride solvation_type{COSMO-SMD} + hydroxide solvation_type{COSMO-SMD} --> methanol solvation_type{COSMO-SMD} + chloride solvation_type{COSMO-SMD}"
     19702      -80.398      -80.058      -82.245       49.613      -32.632 AB + C --> AC + B        "DNAN xc{m06-2x} + hydroxide xc{m06-2x} --> DNAN-1-O- xc{m06-2x} + CO xc{m06-2x}"
     19687       -6.268       -7.400      -20.625       -5.892      -26.517 AC + BD --> A + B + CD   "COC1([O-])C=C[C-](N(=O)=O)C=C1[N+](=O)O xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe}"
     19686       -6.268       -7.400      -20.625       -5.892      -26.517 AC + BD --> A + B + CD   "COC1([O-])C=C[C-](N(=O)=O)C=C1[N+](=O)O xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe}"
     19685       -6.410       -6.732       -5.313        0.913       -4.399 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19684       -6.410       -6.732       -5.313        0.913       -4.399 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19683       -6.410       -6.732       -5.313        0.913       -4.399 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19682       -6.410       -6.732       -5.313        0.913       -4.399 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19665      -10.012      -10.381       -8.952        0.465       -8.488 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     19664      -10.012      -10.381       -8.952        0.465       -8.488 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     19663      -10.012      -10.381       -8.952        0.465       -8.488 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     19662      -10.012      -10.381       -8.952        0.465       -8.488 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     19659      -17.741      -17.527      -17.363       -0.570      -17.933 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19658      -17.741      -17.527      -17.363       -0.570      -17.933 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19657      -17.741      -17.527      -17.363       -0.570      -17.933 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19656      -17.741      -17.527      -17.363       -0.570      -17.933 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19655       -6.440       -6.812       -5.877        0.854       -5.022 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19654       -6.440       -6.812       -5.877        0.854       -5.022 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19653       -6.440       -6.812       -5.877        0.854       -5.022 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19652       -6.440       -6.812       -5.877        0.854       -5.022 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     19646      -80.515      -80.246      -82.416       54.515      -27.901 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
     19645      -80.515      -80.246      -82.416       54.515      -27.901 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
     19644      -80.515      -80.246      -82.416       54.515      -27.901 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
     19643      -80.515      -80.246      -82.416       54.515      -27.901 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
     19641      -71.551      -70.900      -72.878       46.301      -26.578 AB + C --> AC + B        "DNAN-2-OH xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{m06-2x} + CO xc{m06-2x}"
     19634      -80.398      -80.058      -82.245       49.613      -32.632 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
     19633      -80.398      -80.058      -82.245       49.613      -32.632 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
     19632      -80.398      -80.058      -82.245       49.613      -32.632 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
     19631      -80.398      -80.058      -82.245       49.613      -32.632 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
     19630       -8.153       -8.796       -8.455        1.200       -7.255 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19629       -8.153       -8.796       -8.455        1.200       -7.255 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19628       -8.153       -8.796       -8.455        1.200       -7.255 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19627       -8.153       -8.796       -8.455        1.200       -7.255 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     19590        9.195       10.809        9.946       -2.032        7.914 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     19589        9.195       10.809        9.946       -2.032        7.914 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     19588        9.195       10.809        9.946       -2.032        7.914 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     19587        9.195       10.809        9.946       -2.032        7.914 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     19455      -10.930      -10.693      -10.537       -0.679      -11.217 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     19454      -10.930      -10.693      -10.537       -0.679      -11.217 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     19453      -10.930      -10.693      -10.537       -0.679      -11.217 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     19452      -10.930      -10.693      -10.537       -0.679      -11.217 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     19406        9.138        9.484        9.081       -0.887        8.194 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19405        9.138        9.484        9.081       -0.887        8.194 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19404        9.138        9.484        9.081       -0.887        8.194 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19403        9.138        9.484        9.081       -0.887        8.194 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     19401       -4.694       -4.623       -4.461        1.389       -3.072 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     19400       -4.694       -4.623       -4.461        1.389       -3.072 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     19399       -4.694       -4.623       -4.461        1.389       -3.072 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     19398       -4.694       -4.623       -4.461        1.389       -3.072 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
     19368      -52.170      -49.586      -47.881       14.624      -33.256 AB + C --> AC + B        "CCl xc{pbe} + [OH-] xc{pbe} --> CO xc{pbe} + [Cl-] xc{pbe}"
     19321      -17.741      -17.539      -17.405       -0.501      -17.906 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19320      -17.741      -17.539      -17.405       -0.501      -17.906 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19319      -17.741      -17.539      -17.405       -0.501      -17.906 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19318      -17.741      -17.539      -17.405       -0.501      -17.906 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19306        9.740       11.600       11.054        0.000       11.054 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     19305        9.740       11.600       11.054        0.000       11.054 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     19304        9.740       11.600       11.054        0.000       11.054 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     19303        9.740       11.600       11.054        0.000       11.054 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     19302       10.913       11.887       11.209       -2.273        8.936 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     19301       10.913       11.887       11.209       -2.273        8.936 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     19300       10.913       11.887       11.209       -2.273        8.936 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     19299       10.913       11.887       11.209       -2.273        8.936 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     19295      -16.473      -16.427      -16.445       -1.135      -17.580 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19294      -16.473      -16.427      -16.445       -1.135      -17.580 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19293      -16.473      -16.427      -16.445       -1.135      -17.580 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19292      -16.473      -16.427      -16.445       -1.135      -17.580 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     19289      -15.333      -15.561      -15.721        0.000      -15.721 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     19288      -15.333      -15.561      -15.721        0.000      -15.721 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     19287      -15.333      -15.561      -15.721        0.000      -15.721 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     19286      -15.333      -15.561      -15.721        0.000      -15.721 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     18859       33.757       29.952       14.716        1.614       16.329 AC + BD --> A + B + CD   "COC1=C[CH](=C(C=C1N(=O)=O)N(=O)=O)O ^{-1} --> O=N(=O)C1=[CH]=[C](=C=CC1[O])N(=O)=O ^{-1} + CO"
     18858       33.757       29.952       14.716        1.614       16.329 AC + BD --> A + B + CD   "COC1=C[CH](=C(C=C1N(=O)=O)N(=O)=O)O ^{-1} --> O=N(=O)C1=[CH]=[C](=C=CC1[O])N(=O)=O ^{-1} + CO"
     18821       99.874       93.922       84.146        0.470       84.616 AB --> A + B             "CO xc{pbe} --> [CH3] xc{pbe} + [OH] xc{pbe}"
     18820       99.874       93.922       84.146        0.470       84.616 AB --> A + B             "CO xc{pbe} --> [CH3] xc{pbe} + [OH] xc{pbe}"
     18776      154.062      156.245      153.614      -34.812      118.802 AB + C --> AC + B        "COC1=C(C=C([C@@H]2[C@H]1O2)N(=O)=O)N(=O)=O ^{-1} mult{2} + [OH-] ^{-1} --> O=N(=O)C1=[CH]=C(N(=O)=O)C2C([C]1[O])O2 mult{2} + CO ^{-2}"
     18676       14.957       15.802       15.185       -1.971       13.214 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     18675       14.957       15.802       15.185       -1.971       13.214 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     18674       14.957       15.802       15.185       -1.971       13.214 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     18673       14.957       15.802       15.185       -1.971       13.214 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     18552      -15.310      -15.612      -15.887        0.000      -15.887 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     18551      -15.310      -15.612      -15.887        0.000      -15.887 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     18550      -15.310      -15.612      -15.887        0.000      -15.887 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     18549      -15.310      -15.612      -15.887        0.000      -15.887 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     18249       14.646       10.506        9.150       29.363       38.514 AB + C --> AC + B        "CO + [F-] --> C[O-] + F"
     18211        7.531        9.082        8.291       -1.991        6.300 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     18210        7.531        9.082        8.291       -1.991        6.300 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     18209        7.531        9.082        8.291       -1.991        6.300 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     18208        7.531        9.082        8.291       -1.991        6.300 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     18193        0.733        0.596        1.688       -1.520        0.168 AB + CD --> AD + BC      "methyl fluoride xc{m06-2x} + oxidane xc{m06-2x} --> MeOH xc{m06-2x} + hydrogen fluoride xc{m06-2x}"
     18190      -61.575      -60.656      -62.684       32.663      -30.021 AB + C --> AC + B        "CON(=O)=O + [OH-] --> O=N(=O)[O-] + CO"
     18189        9.716       11.651       11.220        0.000       11.220 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     18188        9.716       11.651       11.220        0.000       11.220 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     18187        9.716       11.651       11.220        0.000       11.220 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     18186        9.716       11.651       11.220        0.000       11.220 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
     18141      -11.683      -12.149      -12.756        1.160      -11.595 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18140      -11.683      -12.149      -12.756        1.160      -11.595 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18139      -11.683      -12.149      -12.756        1.160      -11.595 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18138      -11.683      -12.149      -12.756        1.160      -11.595 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18122       -8.477       -8.966       -8.459        0.975       -7.484 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18121       -8.477       -8.966       -8.459        0.975       -7.484 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18120       -8.477       -8.966       -8.459        0.975       -7.484 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18119       -8.477       -8.966       -8.459        0.975       -7.484 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18118      -19.337      -19.826      -19.226        1.037      -18.189 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18117      -19.337      -19.826      -19.226        1.037      -18.189 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18116      -19.337      -19.826      -19.226        1.037      -18.189 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18115      -19.337      -19.826      -19.226        1.037      -18.189 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{ccsd(t)} + CO theory{ccsd(t)} --> COC(=O)C(F)(F)F theory{ccsd(t)} + O theory{ccsd(t)}"
     18114       -6.959       -6.802       -5.170        0.000       -5.170 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18113       -6.959       -6.802       -5.170        0.000       -5.170 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18112       -6.959       -6.802       -5.170        0.000       -5.170 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18111       -6.959       -6.802       -5.170        0.000       -5.170 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18106       -4.984       -5.111       -3.056        0.000       -3.056 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18105       -4.984       -5.111       -3.056        0.000       -3.056 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18104       -4.984       -5.111       -3.056        0.000       -3.056 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18103       -4.984       -5.111       -3.056        0.000       -3.056 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     18096      -22.403      -17.749      -21.044       -2.769      -23.812 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [H][H] --> O=N(=O)c1cccc(N(=O)=O)c1 + CO"
     18095      -22.403      -17.749      -21.044       -2.769      -23.812 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [H][H] --> O=N(=O)c1cccc(N(=O)=O)c1 + CO"
     18094      -22.403      -17.749      -21.044       -2.769      -23.812 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [H][H] --> O=N(=O)c1cccc(N(=O)=O)c1 + CO"
     18093      -22.403      -17.749      -21.044       -2.769      -23.812 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [H][H] --> O=N(=O)c1cccc(N(=O)=O)c1 + CO"
     18003       -5.879       -6.436       -5.178        0.000       -5.178 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     18002       -5.879       -6.436       -5.178        0.000       -5.178 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     18001       -5.879       -6.436       -5.178        0.000       -5.178 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     18000       -5.879       -6.436       -5.178        0.000       -5.178 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17999       -5.866       -6.394       -4.827        0.000       -4.827 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17998       -5.866       -6.394       -4.827        0.000       -4.827 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17997       -5.866       -6.394       -4.827        0.000       -4.827 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17996       -5.866       -6.394       -4.827        0.000       -4.827 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17942       -6.411       -6.743       -5.355        0.982       -4.373 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17941       -6.411       -6.743       -5.355        0.982       -4.373 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17940       -6.411       -6.743       -5.355        0.982       -4.373 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17939       -6.411       -6.743       -5.355        0.982       -4.373 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17844       -7.028       -6.906       -5.294        0.000       -5.294 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17843       -7.028       -6.906       -5.294        0.000       -5.294 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17842       -7.028       -6.906       -5.294        0.000       -5.294 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17841       -7.028       -6.906       -5.294        0.000       -5.294 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17840       -9.524      -10.260       -9.833        1.397       -8.436 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17839       -9.524      -10.260       -9.833        1.397       -8.436 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17838       -9.524      -10.260       -9.833        1.397       -8.436 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17837       -9.524      -10.260       -9.833        1.397       -8.436 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17836       -5.193       -5.283       -3.032        0.000       -3.032 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17835       -5.193       -5.283       -3.032        0.000       -3.032 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17834       -5.193       -5.283       -3.032        0.000       -3.032 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17833       -5.193       -5.283       -3.032        0.000       -3.032 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17830       -7.004       -7.395       -7.012        1.337       -5.674 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17829       -7.004       -7.395       -7.012        1.337       -5.674 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17828       -7.004       -7.395       -7.012        1.337       -5.674 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17827       -7.004       -7.395       -7.012        1.337       -5.674 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17826       -4.856       -5.661       -5.846        0.709       -5.137 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17825       -4.856       -5.661       -5.846        0.709       -5.137 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17824       -4.856       -5.661       -5.846        0.709       -5.137 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17823       -4.856       -5.661       -5.846        0.709       -5.137 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17822       -4.913       -5.337       -4.064        0.524       -3.541 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17821       -4.913       -5.337       -4.064        0.524       -3.541 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17820       -4.913       -5.337       -4.064        0.524       -3.541 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17819       -4.913       -5.337       -4.064        0.524       -3.541 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17818       -4.971       -5.507       -6.085        0.585       -5.500 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17817       -4.971       -5.507       -6.085        0.585       -5.500 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17816       -4.971       -5.507       -6.085        0.585       -5.500 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17815       -4.971       -5.507       -6.085        0.585       -5.500 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17814       -6.417       -6.483       -4.478        0.000       -4.478 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17813       -6.417       -6.483       -4.478        0.000       -4.478 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17812       -6.417       -6.483       -4.478        0.000       -4.478 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17811       -6.417       -6.483       -4.478        0.000       -4.478 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17808       -1.459       -1.942       -0.380        0.000       -0.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17807       -1.459       -1.942       -0.380        0.000       -0.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17806       -1.459       -1.942       -0.380        0.000       -0.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17805       -1.459       -1.942       -0.380        0.000       -0.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17802       -0.319       -0.521        1.876        0.000        1.876 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17801       -0.319       -0.521        1.876        0.000        1.876 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17800       -0.319       -0.521        1.876        0.000        1.876 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17799       -0.319       -0.521        1.876        0.000        1.876 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw} + O theory{pspw}"
     17798       -6.269       -6.467       -4.812        0.000       -4.812 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)F theory{pspw} + O theory{pspw}"
     17797       -6.269       -6.467       -4.812        0.000       -4.812 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)F theory{pspw} + O theory{pspw}"
     17796       -6.269       -6.467       -4.812        0.000       -4.812 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)F theory{pspw} + O theory{pspw}"
     17795       -6.269       -6.467       -4.812        0.000       -4.812 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw} + CO theory{pspw} --> COC(=O)C(F)(F)F theory{pspw} + O theory{pspw}"
     17724       -5.141       -5.649       -6.358        0.604       -5.754 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17723       -5.141       -5.649       -6.358        0.604       -5.754 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17722       -5.141       -5.649       -6.358        0.604       -5.754 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17721       -5.141       -5.649       -6.358        0.604       -5.754 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17720       -7.118       -7.464       -7.045        1.238       -5.807 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17719       -7.118       -7.464       -7.045        1.238       -5.807 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17718       -7.118       -7.464       -7.045        1.238       -5.807 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17717       -7.118       -7.464       -7.045        1.238       -5.807 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F + O"
     17690       -6.467       -6.526       -4.395        0.000       -4.395 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17689       -6.467       -6.526       -4.395        0.000       -4.395 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17688       -6.467       -6.526       -4.395        0.000       -4.395 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17687       -6.467       -6.526       -4.395        0.000       -4.395 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17686       -6.982       -7.471       -7.372        1.177       -6.195 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17685       -6.982       -7.471       -7.372        1.177       -6.195 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17684       -6.982       -7.471       -7.372        1.177       -6.195 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17683       -6.982       -7.471       -7.372        1.177       -6.195 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17682       -8.121       -8.888       -8.427        1.269       -7.158 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17681       -8.121       -8.888       -8.427        1.269       -7.158 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17680       -8.121       -8.888       -8.427        1.269       -7.158 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17679       -8.121       -8.888       -8.427        1.269       -7.158 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17678       -6.440       -6.823       -5.919        0.923       -4.996 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17677       -6.440       -6.823       -5.919        0.923       -4.996 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17676       -6.440       -6.823       -5.919        0.923       -4.996 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17675       -6.440       -6.823       -5.919        0.923       -4.996 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17674      -13.825      -14.311      -13.667        0.653      -13.014 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17673      -13.825      -14.311      -13.667        0.653      -13.014 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17672      -13.825      -14.311      -13.667        0.653      -13.014 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17671      -13.825      -14.311      -13.667        0.653      -13.014 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17670       -8.101       -8.543       -6.885        0.956       -5.929 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17669       -8.101       -8.543       -6.885        0.956       -5.929 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17668       -8.101       -8.543       -6.885        0.956       -5.929 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17667       -8.101       -8.543       -6.885        0.956       -5.929 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17666       -5.892       -6.289       -5.649        0.501       -5.149 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17665       -5.892       -6.289       -5.649        0.501       -5.149 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17664       -5.892       -6.289       -5.649        0.501       -5.149 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17663       -5.892       -6.289       -5.649        0.501       -5.149 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17662       -1.476       -1.838       -0.220        0.000       -0.220 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17661       -1.476       -1.838       -0.220        0.000       -0.220 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17660       -1.476       -1.838       -0.220        0.000       -0.220 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17659       -1.476       -1.838       -0.220        0.000       -0.220 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17658       -6.747       -7.230       -6.893        1.191       -5.701 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17657       -6.747       -7.230       -6.893        1.191       -5.701 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17656       -6.747       -7.230       -6.893        1.191       -5.701 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17655       -6.747       -7.230       -6.893        1.191       -5.701 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17654       -8.154       -8.796       -8.456        1.250       -7.206 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17653       -8.154       -8.796       -8.456        1.250       -7.206 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17652       -8.154       -8.796       -8.456        1.250       -7.206 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17651       -8.154       -8.796       -8.456        1.250       -7.206 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17650       -8.728       -9.096       -8.905        0.818       -8.087 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17649       -8.728       -9.096       -8.905        0.818       -8.087 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17648       -8.728       -9.096       -8.905        0.818       -8.087 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17647       -8.728       -9.096       -8.905        0.818       -8.087 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17646       -0.317       -0.479        1.761        0.000        1.761 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17645       -0.317       -0.479        1.761        0.000        1.761 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17644       -0.317       -0.479        1.761        0.000        1.761 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17643       -0.317       -0.479        1.761        0.000        1.761 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17642       -6.255       -6.745       -6.228        0.714       -5.513 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17641       -6.255       -6.745       -6.228        0.714       -5.513 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17640       -6.255       -6.745       -6.228        0.714       -5.513 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17639       -6.255       -6.745       -6.228        0.714       -5.513 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17638       -7.546       -8.062       -7.496        1.116       -6.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17637       -7.546       -8.062       -7.496        1.116       -6.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17636       -7.546       -8.062       -7.496        1.116       -6.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17635       -7.546       -8.062       -7.496        1.116       -6.380 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17634       -5.802       -6.200       -6.053        0.463       -5.591 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17633       -5.802       -6.200       -6.053        0.463       -5.591 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17632       -5.802       -6.200       -6.053        0.463       -5.591 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17631       -5.802       -6.200       -6.053        0.463       -5.591 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)C(F)(F)F xc{pbe} + O xc{pbe}"
     17630       -6.220       -6.437       -4.727        0.000       -4.727 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17629       -6.220       -6.437       -4.727        0.000       -4.727 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17628       -6.220       -6.437       -4.727        0.000       -4.727 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17627       -6.220       -6.437       -4.727        0.000       -4.727 AB + CD --> AD + BC      "O=C(O)C(F)(F)F theory{pspw4} + CO theory{pspw4} --> COC(=O)C(F)(F)F theory{pspw4} + O theory{pspw4}"
     17626       -9.614      -10.087       -9.480        0.836       -8.644 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17625       -9.614      -10.087       -9.480        0.836       -8.644 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17624       -9.614      -10.087       -9.480        0.836       -8.644 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17623       -9.614      -10.087       -9.480        0.836       -8.644 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe0} + CO xc{pbe0} --> COC(=O)C(F)(F)F xc{pbe0} + O xc{pbe0}"
     17622      -11.588      -12.009      -11.331        0.944      -10.386 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17621      -11.588      -12.009      -11.331        0.944      -10.386 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17620      -11.588      -12.009      -11.331        0.944      -10.386 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17619      -11.588      -12.009      -11.331        0.944      -10.386 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{m06-2x} + CO xc{m06-2x} --> COC(=O)C(F)(F)F xc{m06-2x} + O xc{m06-2x}"
     17618      -10.012      -10.393       -8.994        0.533       -8.461 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     17617      -10.012      -10.393       -8.994        0.533       -8.461 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     17616      -10.012      -10.393       -8.994        0.533       -8.461 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     17615      -10.012      -10.393       -8.994        0.533       -8.461 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{pbe} + CO xc{pbe} --> COC(=O)C(F)(F)F xc{pbe} + O xc{pbe}"
     17614       -7.085       -7.546       -7.347        1.235       -6.112 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17613       -7.085       -7.546       -7.347        1.235       -6.112 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17612       -7.085       -7.546       -7.347        1.235       -6.112 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17611       -7.085       -7.546       -7.347        1.235       -6.112 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17610       -6.375       -6.831       -7.249        0.744       -6.505 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17609       -6.375       -6.831       -7.249        0.744       -6.505 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17608       -6.375       -6.831       -7.249        0.744       -6.505 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17607       -6.375       -6.831       -7.249        0.744       -6.505 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17606       -9.170       -9.632      -10.217        1.031       -9.187 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17605       -9.170       -9.632      -10.217        1.031       -9.187 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17604       -9.170       -9.632      -10.217        1.031       -9.187 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17603       -9.170       -9.632      -10.217        1.031       -9.187 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)C(F)(F)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17602       -6.296       -6.779       -6.157        0.907       -5.250 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17601       -6.296       -6.779       -6.157        0.907       -5.250 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17600       -6.296       -6.779       -6.157        0.907       -5.250 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17599       -6.296       -6.779       -6.157        0.907       -5.250 AB + CD --> AD + BC      "O=C(O)C(F)(F)F xc{b3lyp} + CO xc{b3lyp} --> COC(=O)C(F)(F)F xc{b3lyp} + O xc{b3lyp}"
     17592       -6.326       -6.810       -6.280        0.845       -5.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     17591       -6.326       -6.810       -6.280        0.845       -5.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     17590       -6.326       -6.810       -6.280        0.845       -5.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     17589       -6.326       -6.810       -6.280        0.845       -5.435 AB + CD --> AD + BC      "O=C(O)C(F)(F)C(F)(F)F + CO --> COC(=O)C(F)(F)C(F)(F)F + O"
     17576      -10.929      -10.693      -10.537       -0.719      -11.257 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     17575      -10.929      -10.693      -10.537       -0.719      -11.257 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     17574      -10.929      -10.693      -10.537       -0.719      -11.257 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     17573      -10.929      -10.693      -10.537       -0.719      -11.257 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
     17468        0.974        0.995        1.976       -1.250        0.725 AB + CD --> AD + BC      "methyl fluoride + oxidane --> MeOH + hydrogen fluoride"
     17255      -65.444      -65.159      -65.906       47.957      -17.950 AB + C --> AC + B        "COc1ccc(cc1O)S + [OH-] ^{-1} --> Sc1ccc(c(c1)O)[O] ^{-1} + CO"
     16987       12.320       13.475       12.873        0.000       12.873 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
     16986       12.320       13.475       12.873        0.000       12.873 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
     16985       12.320       13.475       12.873        0.000       12.873 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
     16984       12.320       13.475       12.873        0.000       12.873 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
     16848       -8.161       -7.944       -7.843        0.000       -7.843 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
     16847       -8.161       -7.944       -7.843        0.000       -7.843 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
     16846       -8.161       -7.944       -7.843        0.000       -7.843 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
     16845       -8.161       -7.944       -7.843        0.000       -7.843 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
     16783        1.057        1.137        2.274        0.000        2.274 AB + CD --> AD + BC      "methyl fluoride theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen fluoride theory{pspw4}"
     16782        8.603        9.585        8.909       -2.253        6.656 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     16781        8.603        9.585        8.909       -2.253        6.656 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     16780        8.603        9.585        8.909       -2.253        6.656 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     16779        8.603        9.585        8.909       -2.253        6.656 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
     16723     6830.834     6835.432     6839.449        0.000     6839.449 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16722     6830.834     6835.432     6839.449        0.000     6839.449 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16721     6830.834     6835.432     6839.449        0.000     6839.449 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16720     6830.834     6835.432     6839.449        0.000     6839.449 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16668       14.086       13.226       14.213        0.000       14.213 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16667       14.086       13.226       14.213        0.000       14.213 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16666       14.086       13.226       14.213        0.000       14.213 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16665       14.086       13.226       14.213        0.000       14.213 ABC + DE --> DBE + AC    "methyl iodide theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen iodide theory{pspw4}"
     16663       11.386       10.284       11.149        3.182       14.331 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     16662       11.386       10.284       11.149        3.182       14.331 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     16661       11.386       10.284       11.149        3.182       14.331 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     16660       11.386       10.284       11.149        3.182       14.331 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
     15559      -17.741      -17.539      -17.405       -0.541      -17.946 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     15558      -17.741      -17.539      -17.405       -0.541      -17.946 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     15557      -17.741      -17.539      -17.405       -0.541      -17.946 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     15556      -17.741      -17.539      -17.405       -0.541      -17.946 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
     15524       10.601       12.152       11.359       -1.881        9.478 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     15523       10.601       12.152       11.359       -1.881        9.478 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     15522       10.601       12.152       11.359       -1.881        9.478 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     15521       10.601       12.152       11.359       -1.881        9.478 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
     15451       13.179       14.549       13.885       -1.730       12.154 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     15450       13.179       14.549       13.885       -1.730       12.154 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     15449       13.179       14.549       13.885       -1.730       12.154 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     15448       13.179       14.549       13.885       -1.730       12.154 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
     14708      153.630      155.114      152.820      -39.917      112.903 AB + C --> AC + B        "COC1=CC=C([CH](=C1N(=O)=O)O)O ^{-1} + [OH-] ^{-1} --> OC1=[CH](O)C(=C(C=C1)[O])N(=O)=O + CO ^{-2}"
     14556       41.231       38.653       25.190        2.023       27.213 AC + BD --> A + B + CD   "COC1=CC=C([CH](=C1N(=O)=O)O)O ^{-1} --> O=N(=O)C1=[C]C=CC(=[CH]1[O])O ^{-1} + CO"
     14555       41.231       38.653       25.190        2.023       27.213 AC + BD --> A + B + CD   "COC1=CC=C([CH](=C1N(=O)=O)O)O ^{-1} --> O=N(=O)C1=[C]C=CC(=[CH]1[O])O ^{-1} + CO"
     14474      -40.509      -41.672      -54.610       -7.267      -61.877 AC + BD --> A + B + CD   "COC1=[CH](O)C=C(C=C1N(=O)=O)S ^{-1} --> [O][CH]1=[C]C(=CC(=C1)S)N(=O)=O ^{-1} + CO"
     14473      -40.509      -41.672      -54.610       -7.267      -61.877 AC + BD --> A + B + CD   "COC1=[CH](O)C=C(C=C1N(=O)=O)S ^{-1} --> [O][CH]1=[C]C(=CC(=C1)S)N(=O)=O ^{-1} + CO"
     14430      104.203      106.899      105.383       -8.919       96.464 AB + C --> AC + B        "COC1=C(O)C([CH](=[CH2]C1)N(=O)=O)O ^{-1} mult{2} + [OH-] ^{-1} --> O=N(=O)C1CCC(=C(C1O)O)[O] mult{2} + CO ^{-2}"
     12982        9.689       11.618       11.284        0.000       11.284 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
     12981        9.689       11.618       11.284        0.000       11.284 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
     12980        9.689       11.618       11.284        0.000       11.284 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
     12979        9.689       11.618       11.284        0.000       11.284 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
     12896        3.092        3.930        1.668       46.706       48.374 AB + C --> AC + B        "COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1[O] mult{2} + hydroxide ^{-1} --> O=C(NCC1=CC(=[C](=O)C=C1)[O])CCCCC=CC(C)C + CO ^{-1} mult{2}"
     12869      -15.308      -15.626      -15.923        0.000      -15.923 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     12868      -15.308      -15.626      -15.923        0.000      -15.923 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     12867      -15.308      -15.626      -15.923        0.000      -15.923 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     12866      -15.308      -15.626      -15.923        0.000      -15.923 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
     12853      -57.668      -57.452      -59.892        0.000      -59.892 AB + C --> AC + B        "COc1ccc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 theory{pspw} + CO theory{pspw}"
     12803        9.195       10.809        9.947       -2.082        7.865 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     12802        9.195       10.809        9.947       -2.082        7.865 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     12801        9.195       10.809        9.947       -2.082        7.865 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     12800        9.195       10.809        9.947       -2.082        7.865 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
     12686       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
     12685       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
     12684       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
     12683       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
     12605      -14.971      -14.773      -14.631       -0.479      -15.109 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12604      -14.971      -14.773      -14.631       -0.479      -15.109 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12603      -14.971      -14.773      -14.631       -0.479      -15.109 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12602      -14.971      -14.773      -14.631       -0.479      -15.109 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12596      -73.657      -73.271      -75.276       52.109      -23.167 AB + C --> AC + B        "DNAN-2-OH xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{pbe0} + CO xc{pbe0}"
     12564      118.302      120.484      117.384      -31.105       86.279 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)N(=O)=O ^{-1} xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> O=N(=O)c1c[c]c(c(c1)N(=O)=O)[O] xc{pbe0} + CO ^{-2} xc{pbe0}"
     12551       -8.771       -8.553       -8.415       -0.679       -9.094 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12550       -8.771       -8.553       -8.415       -0.679       -9.094 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12549       -8.771       -8.553       -8.415       -0.679       -9.094 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12548       -8.771       -8.553       -8.415       -0.679       -9.094 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12449      -81.034      -80.690      -82.855       55.285      -27.569 AB + C --> AC + B        "COc1ccc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe0} + CO xc{pbe0}"
     12443      -11.817       -0.554        5.405        8.131       13.536 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     12442      -11.817       -0.554        5.405        8.131       13.536 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     12441      -11.817       -0.554        5.405        8.131       13.536 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     12440      -11.817       -0.554        5.405        8.131       13.536 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
     12413       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
     12412       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
     12411       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
     12410       -7.701       -7.310       -7.925        0.000       -7.925 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
     12294      -52.170      -49.597      -47.923       31.420      -16.503 AB + C --> AC + B        "CCl xc{pbe} solvation_type{COSMO-SMD} + [OH-] xc{pbe} solvation_type{COSMO-SMD} --> CO xc{pbe} solvation_type{COSMO-SMD} + [Cl-] xc{pbe} solvation_type{COSMO-SMD}"
     12223      -17.163      -17.123      -17.098       -1.183      -18.281 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12222      -17.163      -17.123      -17.098       -1.183      -18.281 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12221      -17.163      -17.123      -17.098       -1.183      -18.281 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     12220      -17.163      -17.123      -17.098       -1.183      -18.281 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
     11665      -55.366      -52.660      -50.969       32.110      -18.859 AB + C --> AC + B        "methyl chloride solvation_type{COSMO-SMD} + hydroxide solvation_type{COSMO-SMD} --> methanol solvation_type{COSMO-SMD} + chloride solvation_type{COSMO-SMD}"
     11662       -3.698       -5.235      -18.540       -5.554      -24.094 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe0} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe0} + CO xc{pbe0}"
     11661       -3.698       -5.235      -18.540       -5.554      -24.094 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe0} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe0} + CO xc{pbe0}"
     11660      -15.353      -15.660      -16.036        0.000      -16.036 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11659      -15.353      -15.660      -16.036        0.000      -16.036 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11658      -15.353      -15.660      -16.036        0.000      -16.036 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11657      -15.353      -15.660      -16.036        0.000      -16.036 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11652      -56.369      -53.655      -51.955       15.103      -36.853 AB + C --> AC + B        "CCl xc{pbe0} + hydroxide xc{pbe0} --> CO xc{pbe0} + chloride xc{pbe0}"
     11650       -8.178       -7.587       -7.658        5.106       -2.552 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
     11649       -8.178       -7.587       -7.658        5.106       -2.552 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
     11648       -8.178       -7.587       -7.658        5.106       -2.552 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
     11647       -8.178       -7.587       -7.658        5.106       -2.552 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
     11623      -81.034      -80.690      -82.855       55.285      -27.569 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
     11622      -81.034      -80.690      -82.855       55.285      -27.569 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
     11621      -81.034      -80.690      -82.855       55.285      -27.569 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
     11620      -81.034      -80.690      -82.855       55.285      -27.569 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
     11608       95.497       89.143       79.359        0.403       79.762 AB --> A + B             "CO xc{pbe0} --> [CH3] xc{pbe0} + [OH] xc{pbe0}"
     11607       95.497       89.143       79.359        0.403       79.762 AB --> A + B             "CO xc{pbe0} --> [CH3] xc{pbe0} + [OH] xc{pbe0}"
     11552      -79.968      -79.705      -81.742       22.140      -59.602 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:toluene} + hydroxide solvation_type{COSMO-SMD:toluene} --> DNAN-1-O- solvation_type{COSMO-SMD:toluene} + CO solvation_type{COSMO-SMD:toluene}"
     11551      -80.397      -80.138      -82.176       48.060      -34.116 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:o-cresol} + hydroxide solvation_type{COSMO-SMD:o-cresol} --> DNAN-1-O- solvation_type{COSMO-SMD:o-cresol} + CO solvation_type{COSMO-SMD:o-cresol}"
     11550      -79.968      -79.705      -81.742       38.270      -43.472 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:edc12} + hydroxide solvation_type{COSMO-SMD:edc12} --> DNAN-1-O- solvation_type{COSMO-SMD:edc12} + CO solvation_type{COSMO-SMD:edc12}"
     11549      -80.397      -80.138      -82.176       38.440      -43.736 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:acetone} + hydroxide solvation_type{COSMO-SMD:acetone} --> DNAN-1-O- solvation_type{COSMO-SMD:acetone} + CO solvation_type{COSMO-SMD:acetone}"
     11548      -79.968      -79.705      -81.742       51.830      -29.912 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:ethanol} + hydroxide solvation_type{COSMO-SMD:ethanol} --> DNAN-1-O- solvation_type{COSMO-SMD:ethanol} + CO solvation_type{COSMO-SMD:ethanol}"
     11547      -79.968      -79.705      -81.742       54.850      -26.892 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD:methanol} + hydroxide solvation_type{COSMO-SMD:methanol} --> DNAN-1-O- solvation_type{COSMO-SMD:methanol} + CO solvation_type{COSMO-SMD:methanol}"
     11546      -79.968      -79.700      -81.824       56.590      -25.234 AB + C --> AC + B        "DNAN solvation_type{COSMO-SMD} + hydroxide solvation_type{COSMO-SMD} --> DNAN-1-O- solvation_type{COSMO-SMD} + CO solvation_type{COSMO-SMD}"
     11514       -8.192       -8.044       -8.050        0.000       -8.050 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
     11513       -8.192       -8.044       -8.050        0.000       -8.050 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
     11512       -8.192       -8.044       -8.050        0.000       -8.050 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
     11511       -8.192       -8.044       -8.050        0.000       -8.050 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
     11282       95.875       89.444       79.561        0.000       79.561 AB --> A + B             "CO theory{pspw} xc{pbe} --> [CH3] theory{pspw} xc{pbe} + [OH] theory{pspw} xc{pbe}"
     11281       95.875       89.444       79.561        0.000       79.561 AB --> A + B             "CO theory{pspw} xc{pbe} --> [CH3] theory{pspw} xc{pbe} + [OH] theory{pspw} xc{pbe}"
     11225      -46.448      -43.635      -41.790        0.000      -41.790 AB + C --> AC + B        "CCl theory{pspw} + hydroxide theory{pspw} --> CO theory{pspw} + chloride theory{pspw}"
     11218      -13.710      -13.548      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11217      -13.710      -13.548      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11216      -13.710      -13.548      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11215      -13.710      -13.548      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
     11184       -4.407       -4.302       -4.205        0.000       -4.205 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
     11183       -4.407       -4.302       -4.205        0.000       -4.205 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
     11182       -4.407       -4.302       -4.205        0.000       -4.205 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
     11181       -4.407       -4.302       -4.205        0.000       -4.205 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
     10872        8.383       10.635       11.567      -15.409       -3.842 AB + CD --> AD + BC      "C[O-] + O --> [OH-] + CO"
     10871        8.383       10.635       11.567      -15.409       -3.842 AB + CD --> AD + BC      "C[O-] + O --> [OH-] + CO"
     10870        8.383       10.635       11.567      -15.409       -3.842 AB + CD --> AD + BC      "C[O-] + O --> [OH-] + CO"
     10869        8.383       10.635       11.567      -15.409       -3.842 AB + CD --> AD + BC      "C[O-] + O --> [OH-] + CO"
     10848      -81.034      -80.689      -82.873       55.346      -27.527 AB + C --> AC + B        "COc1ccc(N(=O)=O)cc1N(=O)=O xc{pbe0} + [OH-] xc{pbe0} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe0} + CO xc{pbe0}"
      9672      -98.822      -98.546     -100.083       56.803      -43.280 AB + C --> AC + B        "CO[C]1=[CH]=C=[C](C(C=1[N](=O)[O])O)N(=O)=O + hydroxide ^{-1} --> O=N(=O)C1=[C]C=[C](=C(C1O)N(=O)=O)[O] ^{-1} + CO"
      8020        6.567        4.691        4.870        6.410       11.280 AB + C --> AC + B        "O[O-] + CO --> OO + C[O-]"
      7993       -8.730       -8.405       -8.227        4.914       -3.314 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      7992       -8.730       -8.405       -8.227        4.914       -3.314 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      7991       -8.730       -8.405       -8.227        4.914       -3.314 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      7990       -8.730       -8.405       -8.227        4.914       -3.314 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      7959      -21.849      -21.307      -21.328       -0.101      -21.429 AB + CD --> AD + BC      "CN + OO --> NO + CO"
      7951      -44.070      -43.294      -43.475       -2.185      -45.660 AB + CD --> AD + BC      "CC + OO --> CO + CO"
      7895        1.180        1.186        2.185       -1.308        0.877 AB + CD --> AD + BC      "methyl fluoride xc{pbe} + oxidane xc{pbe} --> MeOH xc{pbe} + hydrogen fluoride xc{pbe}"
      7659        1.153       -0.759      -14.454       -5.936      -20.389 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{m06-2x} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{m06-2x} + CO xc{m06-2x}"
      7658        1.153       -0.759      -14.454       -5.936      -20.389 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{m06-2x} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{m06-2x} + CO xc{m06-2x}"
      7657       -3.698       -5.233      -18.558       -5.554      -24.112 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe0} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe0} + CO xc{pbe0}"
      7656       -3.698       -5.233      -18.558       -5.554      -24.112 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe0} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe0} + CO xc{pbe0}"
      7655       -5.484       -6.701      -19.946       -5.789      -25.735 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe} + CO xc{pbe}"
      7654       -5.484       -6.701      -19.946       -5.789      -25.735 CABD --> AB + CD         "COC1(O)C=C[C-](N(=O)=O)C=C1N(=O)=O xc{pbe} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe} + CO xc{pbe}"
      7583       -8.178       -7.586       -7.676        5.106       -2.570 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7582       -8.178       -7.586       -7.676        5.106       -2.570 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7581       -8.178       -7.586       -7.676        5.106       -2.570 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7580       -8.178       -7.586       -7.676        5.106       -2.570 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7463       12.800       13.653       13.035       -1.991       11.044 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7462       12.800       13.653       13.035       -1.991       11.044 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7461       12.800       13.653       13.035       -1.991       11.044 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7460       12.800       13.653       13.035       -1.991       11.044 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7429       10.108       11.475       10.807       -1.711        9.096 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O xc{pbe} + C xc{pbe} --> C(Cl)(Cl)Cl xc{pbe} + CO xc{pbe}"
      7428       10.108       11.475       10.807       -1.711        9.096 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O xc{pbe} + C xc{pbe} --> C(Cl)(Cl)Cl xc{pbe} + CO xc{pbe}"
      7427       10.108       11.475       10.807       -1.711        9.096 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O xc{pbe} + C xc{pbe} --> C(Cl)(Cl)Cl xc{pbe} + CO xc{pbe}"
      7426       10.108       11.475       10.807       -1.711        9.096 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O xc{pbe} + C xc{pbe} --> C(Cl)(Cl)Cl xc{pbe} + CO xc{pbe}"
      7328       13.946       10.537       13.312        0.058       13.371 AB + CD --> AD + BC      "C xc{pbe} + CO xc{pbe} --> CCO xc{pbe} + [HH] xc{pbe}"
      7319       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      7318       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      7317       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      7316       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      7299      -10.242       -9.663       -9.913        7.672       -2.241 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      7298      -10.242       -9.663       -9.913        7.672       -2.241 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      7297      -10.242       -9.663       -9.913        7.672       -2.241 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      7296      -10.242       -9.663       -9.913        7.672       -2.241 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      7289        9.138        9.484        9.081       -0.927        8.154 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7288        9.138        9.484        9.081       -0.927        8.154 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7287        9.138        9.484        9.081       -0.927        8.154 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7286        9.138        9.484        9.081       -0.927        8.154 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      7279       92.986       86.730       76.986        0.602       77.588 AB --> A + B             "CO --> [CH3] + [OH]"
      7278       92.986       86.730       76.986        0.602       77.588 AB --> A + B             "CO --> [CH3] + [OH]"
      7272      -40.654      -39.896      -39.991       -2.050      -42.042 AB + CD --> AD + BC      "CC xc{pbe} + OO xc{pbe} --> CO xc{pbe} + CO xc{pbe}"
      7260      -10.622       -7.855       -6.152        0.871       -5.281 AB + C --> AC + B        "CCl + [OH] --> CO + [Cl]"
      7045      -46.728      -46.329      -46.355       -2.093      -48.449 AB + CD --> AD + BC      "CC xc{m06-2x} + OO xc{m06-2x} --> CO xc{m06-2x} + CO xc{m06-2x}"
      7042        7.655        5.096        5.547        6.571       12.118 AB + C --> AC + B        "O[O-] + CO --> OO + C[O-]"
      7041       -8.178       -7.584       -7.675        5.066       -2.609 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7040       -8.178       -7.584       -7.675        5.066       -2.609 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7039       -8.178       -7.584       -7.675        5.066       -2.609 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      7038       -8.178       -7.584       -7.675        5.066       -2.609 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      6976       71.699       66.191       68.704        8.029       76.733 AB + CD --> AD + BC      "CO + CO --> COOC + [H][H]"
      6960      126.468      128.543      125.796      -35.292       90.504 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)N(=O)=O ^{-1} xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> O=N(=O)c1c[c]c(c(c1)N(=O)=O)[O] xc{m06-2x} + CO ^{-2} xc{m06-2x}"
      6959      117.528      119.622      117.472      -34.713       82.760 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)N(=O)=O ^{-1} xc{pbe} + hydroxide ^{-1} xc{pbe} --> O=N(=O)c1c[c]c(c(c1)N(=O)=O)[O] xc{pbe} + CO ^{-2} xc{pbe}"
      6925      -60.721      -61.359      -64.171       47.613      -16.557 AB + C --> AC + B        "COC1=[CH]=[CH2][CH](=[CH]=C1O)N(=O)=O + hydroxide ^{-1} --> O=N(=O)[CH]1=[CH]=C(C(=[CH]=[CH2]1)[O])O ^{-1} + CO"
      6920      130.699      133.295      131.650      -40.296       91.354 AB + C --> AC + B        "DNAN-6-OH- ^{-1} + hydroxide ^{-1} --> O=N(=O)C1=CC(O)C(=C([CH]1)N(=O)=O)[O] + CO ^{-2}"
      6900      173.815      175.392      172.909      -34.462      138.447 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)O ^{-1} + hydroxide ^{-1} --> Oc1c[c]c(c(c1)N(=O)=O)[O] + CO ^{-2}"
      6897       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      6896       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      6895       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      6894       -8.040       -7.503       -7.411        4.802       -2.609 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      6861      -10.376       -9.949      -15.988        1.317      -14.671 A + B + CD --> AC + BD   "O[Na] + COc1ccccc1 --> [Na]Oc1ccccc1 + CO"
      6860      -10.376       -9.949      -15.988        1.317      -14.671 A + B + CD --> AC + BD   "O[Na] + COc1ccccc1 --> [Na]Oc1ccccc1 + CO"
      6853       -8.124       -7.598       -7.882        4.328       -3.554 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      6852       -8.124       -7.598       -7.882        4.328       -3.554 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      6851       -8.124       -7.598       -7.882        4.328       -3.554 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      6850       -8.124       -7.598       -7.882        4.328       -3.554 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      6777       -8.730       -8.403       -8.226        4.863       -3.362 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      6776       -8.730       -8.403       -8.226        4.863       -3.362 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      6775       -8.730       -8.403       -8.226        4.863       -3.362 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      6774       -8.730       -8.403       -8.226        4.863       -3.362 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      6766       39.468       36.761       21.544        1.666       23.210 AC + BD --> A + B + CD   "COC1=C(N(=O)=O)C(O)C(N(=O)=O)=C[CH-]1 --> O=N(=O)C1=C=CC=C(N(=O)=O)C1[O-] + CO"
      6765       39.468       36.761       21.544        1.666       23.210 AC + BD --> A + B + CD   "COC1=C(N(=O)=O)C(O)C(N(=O)=O)=C[CH-]1 --> O=N(=O)C1=C=CC=C(N(=O)=O)C1[O-] + CO"
      6739      -71.550      -70.901      -72.878       52.101      -20.777 AB + C --> AC + B        "DNAN-2-OH xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{m06-2x} + CO xc{m06-2x}"
      6738      -73.656      -73.270      -75.294       52.169      -23.125 AB + C --> AC + B        "DNAN-2-OH xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{pbe0} + CO xc{pbe0}"
      6737      -74.263      -74.066      -75.637       52.140      -23.497 AB + C --> AC + B        "DNAN-2-OH xc{pbe} + hydroxide ^{-1} xc{pbe} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{pbe} + CO xc{pbe}"
      6712       90.445       90.500       77.279       -2.997       74.282 AB + C --> AC + B        "COC1=[C]C=C([CH](=C1N(=O)=O)O)N(=O)=O ^{-2} --> O=N(=O)[C]1=[CH]=C=[C](=C(C=1)N(=O)=O)[O] + CO ^{-2}"
      6709      118.302      120.484      117.384      -31.045       86.339 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)N(=O)=O ^{-1} xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> O=N(=O)c1c[c]c(c(c1)N(=O)=O)[O] xc{pbe0} + CO ^{-2} xc{pbe0}"
      6619      -81.034      -80.689      -82.873       55.346      -27.527 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
      6618      -81.034      -80.689      -82.873       55.346      -27.527 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
      6617      -81.034      -80.689      -82.873       55.346      -27.527 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
      6616      -81.034      -80.689      -82.873       55.346      -27.527 AB + CD --> AD + BC      "DNAN xc{pbe0} + hydroxide ^{-1} xc{pbe0} --> CO xc{pbe0} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe0}"
      6526       33.757       29.995       14.484       -2.287       12.197 AC + BD --> A + B + CD   "COC1=CC(O)C(N(=O)=O)=C[C-]1N(=O)=O --> O=N(=O)C1=C=CC([O-])C(N(=O)=O)=C1 + CO"
      6525       33.757       29.995       14.484       -2.287       12.197 AC + BD --> A + B + CD   "COC1=CC(O)C(N(=O)=O)=C[C-]1N(=O)=O --> O=N(=O)C1=C=CC([O-])C(N(=O)=O)=C1 + CO"
      6524       42.449       40.480       29.389       -7.483       21.906 AC + BD --> A + B + CD   "COC1=C(N(=O)=O)[CH-]C(N(=O)=O)=CC1O --> O=N(=O)C1=CC([O-])[C+]=C(N(=O)=O)[CH-]1 + CO"
      6523       42.449       40.480       29.389       -7.483       21.906 AC + BD --> A + B + CD   "COC1=C(N(=O)=O)[CH-]C(N(=O)=O)=CC1O --> O=N(=O)C1=CC([O-])[C+]=C(N(=O)=O)[CH-]1 + CO"
      6269      -81.473      -81.065      -83.648       49.242      -34.406 AB + C --> AC + B        "COC1=[CH]=[CH2][CH](=[CH]=C1N(=O)=O)N(=O)=O + hydroxide ^{-1} --> O=N(=O)[CH]1=[CH]=[C](=[N](=O)=O)C(=[CH]=[CH2]1)[O] ^{-1} + CO"
      5999      -48.155      -55.014      -64.645        0.484      -64.160 AB --> A + B             "CO ^{-2} --> [CH3] ^{-1} + [OH] ^{-1}"
      5998      -48.155      -55.014      -64.645        0.484      -64.160 AB --> A + B             "CO ^{-2} --> [CH3] ^{-1} + [OH] ^{-1}"
      5869      -10.176      -11.709      -24.903       -6.060      -30.963 CABD --> AB + CD         "COC1(O)C=CC(N(=O)=O)=C[C-]1N(=O)=O --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 + CO"
      5868      -10.176      -11.709      -24.903       -6.060      -30.963 CABD --> AB + CD         "COC1(O)C=CC(N(=O)=O)=C[C-]1N(=O)=O --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 + CO"
      5857      466.747      458.706      448.939     -173.269      275.670 AB --> A + B             "CO --> [CH3] ^{-1} + [OH] ^{1}"
      5856      466.747      458.706      448.939     -173.269      275.670 AB --> A + B             "CO --> [CH3] ^{-1} + [OH] ^{1}"
      5846      -72.124      -71.782      -73.620       52.078      -21.542 AB + C --> AC + B        "DNAN-2-OH xc{b3lyp} + hydroxide ^{-1} xc{b3lyp} --> O=N(=O)c1ccc(c(c1)O)[O] ^{-1} xc{b3lyp} + CO xc{b3lyp}"
      5844      123.683      125.977      123.724      -36.035       87.690 AB + C --> AC + B        "COc1[c]cc(cc1N(=O)=O)N(=O)=O ^{-1} xc{b3lyp} + hydroxide ^{-1} xc{b3lyp} --> O=N(=O)c1c[c]c(c(c1)N(=O)=O)[O] xc{b3lyp} + CO ^{-2} xc{b3lyp}"
      5838      -80.398      -80.059      -82.245       55.413      -26.832 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
      5837      -80.398      -80.059      -82.245       55.413      -26.832 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
      5836      -80.398      -80.059      -82.245       55.413      -26.832 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
      5835      -80.398      -80.059      -82.245       55.413      -26.832 AB + CD --> AD + BC      "DNAN xc{m06-2x} + hydroxide ^{-1} xc{m06-2x} --> CO xc{m06-2x} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{m06-2x}"
      5834      -80.515      -80.235      -82.374       54.446      -27.928 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
      5833      -80.515      -80.235      -82.374       54.446      -27.928 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
      5832      -80.515      -80.235      -82.374       54.446      -27.928 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
      5831      -80.515      -80.235      -82.374       54.446      -27.928 AB + CD --> AD + BC      "DNAN xc{pbe} + hydroxide ^{-1} xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1} xc{pbe}"
      5795       -0.669       -0.196       -1.019        0.558       -0.461 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      5794       -0.669       -0.196       -1.019        0.558       -0.461 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      5793       -0.669       -0.196       -1.019        0.558       -0.461 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      5792       -0.669       -0.196       -1.019        0.558       -0.461 AB + CD --> AD + BC      "COc1c[c]c(cc1N(=O)=O)N(=O)=O ^{-1} + water --> [O][N](=O)c1[c]cc(c(c1)[N](=O)[O])O ^{-1} + CO"
      5677        2.521        2.914        1.862       -2.143       -0.281 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      5676        2.521        2.914        1.862       -2.143       -0.281 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      5675        2.521        2.914        1.862       -2.143       -0.281 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      5674        2.521        2.914        1.862       -2.143       -0.281 AB + CD --> AD + BC      "COc1ccc(cc1N(=O)=O)O + water --> Oc1ccc(c(c1)N(=O)=O)O + CO"
      5630      217.918      215.617      215.694     -165.024       50.670 AB + C --> AC + B        "CO + O --> C[O-] + [OH3+]"
      5629      280.609      275.210      265.608     -171.796       93.812 AB --> A + B             "CO --> [OH-] + [CH3+]"
      5628      280.609      275.210      265.608     -171.796       93.812 AB --> A + B             "CO --> [OH-] + [CH3+]"
      5627      280.609      275.210      265.608     -171.796       93.812 AC + BD --> A + B + CD   "O + CO --> [OH-] + [CH3+] + O"
      5626      280.609      275.210      265.608     -171.796       93.812 AC + BD --> A + B + CD   "O + CO --> [OH-] + [CH3+] + O"
      5540      -40.699      -41.013      -42.980       29.917      -13.063 AB + C --> AC + B        "guaiacol + Hydroxide ^{-1} --> Oc1ccccc1[O] ^{-1} + CO"
      5095      -52.510      -52.453      -54.204       41.802      -12.402 AB + C --> AC + B        "COc1ccc(cc1O)O + hydroxide ^{-1} --> Oc1ccc(c(c1)O)[O] ^{-1} + CO"
      5059      -14.062      -13.997      -13.982        0.000      -13.982 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      5058      -14.062      -13.997      -13.982        0.000      -13.982 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      5057      -14.062      -13.997      -13.982        0.000      -13.982 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      5026       -8.771       -8.554       -8.397       -0.679       -9.076 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
      5025       -8.771       -8.554       -8.397       -0.679       -9.076 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
      5024       -8.771       -8.554       -8.397       -0.679       -9.076 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
      5023       -3.569       -3.781       -4.421        0.000       -4.421 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      5022       -3.569       -3.781       -4.421        0.000       -4.421 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      5021       -3.569       -3.781       -4.421        0.000       -4.421 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      5020      -14.670      -14.465      -14.327       -0.561      -14.888 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      5019      -14.670      -14.465      -14.327       -0.561      -14.888 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      5018      -14.670      -14.465      -14.327       -0.561      -14.888 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      4996       -1.063       -0.250        0.684        1.985        2.670 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
      4995       -1.063       -0.250        0.684        1.985        2.670 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
      4994       -1.063       -0.250        0.684        1.985        2.670 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
      4993       -1.063       -0.250        0.684        1.985        2.670 AB + CD --> AD + BC      "CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O + O([2H])[2H] --> CO + CCCCCC(CC(=O)CCc1ccc(c(c1)O)O)O"
      4983      -46.438      -43.675      -41.895        0.000      -41.895 AB + C --> AC + B        "CCl theory{pspw} + hydroxide theory{pspw} --> CO theory{pspw} + chloride theory{pspw}"
      4976      -13.988      -13.922      -13.893        0.000      -13.893 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      4975      -13.988      -13.922      -13.893        0.000      -13.893 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      4974      -13.988      -13.922      -13.893        0.000      -13.893 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      4920      -13.704      -13.568      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      4919      -13.704      -13.568      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      4918      -13.704      -13.568      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      4911      -13.720      -13.508      -13.431        0.000      -13.431 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      4910      -13.720      -13.508      -13.431        0.000      -13.431 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      4909      -13.720      -13.508      -13.431        0.000      -13.431 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      4908      -13.720      -13.508      -13.431        0.000      -13.431 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      4901        3.157        3.661        2.737        0.000        2.737 AB + CD --> AD + BC      "C=C(CC)OC theory{pspw4} + O theory{pspw4} --> C=C(O)CC theory{pspw4} + CO theory{pspw4}"
      4900        3.157        3.661        2.737        0.000        2.737 AB + CD --> AD + BC      "C=C(CC)OC theory{pspw4} + O theory{pspw4} --> C=C(O)CC theory{pspw4} + CO theory{pspw4}"
      4899        3.157        3.661        2.737        0.000        2.737 AB + CD --> AD + BC      "C=C(CC)OC theory{pspw4} + O theory{pspw4} --> C=C(O)CC theory{pspw4} + CO theory{pspw4}"
      4898        3.157        3.661        2.737        0.000        2.737 AB + CD --> AD + BC      "C=C(CC)OC theory{pspw4} + O theory{pspw4} --> C=C(O)CC theory{pspw4} + CO theory{pspw4}"
      4886       -5.406       -6.014       -4.554        0.000       -4.554 AB + CD --> AD + BC      "CO theory{pspw4} + O=N(=O)O theory{pspw4} --> CON(=O)=O theory{pspw4} + O theory{pspw4}"
      4885       -5.406       -6.014       -4.554        0.000       -4.554 AB + CD --> AD + BC      "CO theory{pspw4} + O=N(=O)O theory{pspw4} --> CON(=O)=O theory{pspw4} + O theory{pspw4}"
      4884       -5.406       -6.014       -4.554        0.000       -4.554 AB + CD --> AD + BC      "CO theory{pspw4} + O=N(=O)O theory{pspw4} --> CON(=O)=O theory{pspw4} + O theory{pspw4}"
      4883       -5.406       -6.014       -4.554        0.000       -4.554 AB + CD --> AD + BC      "CO theory{pspw4} + O=N(=O)O theory{pspw4} --> CON(=O)=O theory{pspw4} + O theory{pspw4}"
      4881      -14.971      -14.774      -14.613       -0.479      -15.092 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      4880      -14.971      -14.774      -14.613       -0.479      -15.092 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      4879      -14.971      -14.774      -14.613       -0.479      -15.092 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      4843      -60.356      -60.298      -62.747       42.741      -20.006 AB + C --> AC + B        "COc1ccc(cc1N(=O)=O)O + hydroxide ^{-1} --> Oc1ccc(c(c1)N(=O)=O)[O] ^{-1} + CO"
      4819       -8.772       -8.543       -8.387       -0.700       -9.086 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
      4818       -8.772       -8.543       -8.387       -0.700       -9.086 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
      4817       -8.772       -8.543       -8.387       -0.700       -9.086 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
      4813       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      4812       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      4811       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      4810       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
      4805       -3.424       -3.633       -4.407        0.000       -4.407 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      4804       -3.424       -3.633       -4.407        0.000       -4.407 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      4803       -3.424       -3.633       -4.407        0.000       -4.407 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      4411      -64.498      -64.343      -66.387       46.554      -19.833 AB + C --> AC + B        "COc1ccc(cc1)[N+]([O-])=O + hydroxide ^{-1} --> [O]c1ccc(cc1)N(=O)=O ^{-1} + CO"
      4410       -4.868       -4.773       -4.625        1.223       -3.402 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OCC(Cl)CCl + CCl"
      4409       -4.868       -4.773       -4.625        1.223       -3.402 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OCC(Cl)CCl + CCl"
      4408       -4.868       -4.773       -4.625        1.223       -3.402 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OCC(Cl)CCl + CCl"
      4287       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
      4286       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
      4285       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
      4284       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
      3925        6.076        5.917        6.992       -1.730        5.262 AB + CD --> AD + BC      "O theory{dft} xc{blyp} basis{6-31G*} + CF theory{dft} xc{blyp} basis{6-31G*} --> CO theory{dft} xc{blyp} basis{6-31G*} + F- theory{dft} xc{blyp} basis{6-31G*}"
      3320       -6.268       -7.389      -20.583       -5.961      -26.544 AC + BD --> A + B + CD   "COC1([O-])C=C[C-](N(=O)=O)C=C1[N+](=O)O xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe}"
      3319       -6.268       -7.389      -20.583       -5.961      -26.544 AC + BD --> A + B + CD   "COC1([O-])C=C[C-](N(=O)=O)C=C1[N+](=O)O xc{pbe} --> CO xc{pbe} + O=N(=O)c1ccc([O-])c(N(=O)=O)c1 xc{pbe}"
      3307       -4.545       -4.557       -4.501        0.000       -4.501 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} xc{lda} + CO theory{pspw4} xc{lda} --> OCC(Cl)CCl theory{pspw4} xc{lda} + CCl theory{pspw4} xc{lda}"
      3306       -4.545       -4.557       -4.501        0.000       -4.501 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} xc{lda} + CO theory{pspw4} xc{lda} --> OCC(Cl)CCl theory{pspw4} xc{lda} + CCl theory{pspw4} xc{lda}"
      3305       -4.545       -4.557       -4.501        0.000       -4.501 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} xc{lda} + CO theory{pspw4} xc{lda} --> OCC(Cl)CCl theory{pspw4} xc{lda} + CCl theory{pspw4} xc{lda}"
      3297      -79.968      -79.715      -81.709       54.651      -27.058 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [OH-] --> CO + O=N(=O)c1ccc([O-])c(N(=O)=O)c1"
      3296      -79.968      -79.715      -81.709       54.651      -27.058 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [OH-] --> CO + O=N(=O)c1ccc([O-])c(N(=O)=O)c1"
      3295      -79.968      -79.715      -81.709       54.651      -27.058 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [OH-] --> CO + O=N(=O)c1ccc([O-])c(N(=O)=O)c1"
      3294      -79.968      -79.715      -81.709       54.651      -27.058 AB + CD --> AD + BC      "COc1ccc(N(=O)=O)cc1N(=O)=O + [OH-] --> CO + O=N(=O)c1ccc([O-])c(N(=O)=O)c1"
      3289      -51.608      -51.753      -63.494        2.441      -61.052 AC + BD --> A + B + CD   "COC1([O-])C=C[C-](N(=O)=O)C=C1[N+](=O)O --> CO + O=N(=O)c1ccc([O-])c(N(=O)=O)c1"
      3288      -51.608      -51.753      -63.494        2.441      -61.052 AC + BD --> A + B + CD   "COC1([O-])C=C[C-](N(=O)=O)C=C1[N+](=O)O --> CO + O=N(=O)c1ccc([O-])c(N(=O)=O)c1"
      3267       -3.829       -3.740       -3.614        1.294       -2.320 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{ccsd(t)} + CO theory{ccsd(t)} --> OCC(Cl)CCl theory{ccsd(t)} + CCl theory{ccsd(t)}"
      3266       -3.829       -3.740       -3.614        1.294       -2.320 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{ccsd(t)} + CO theory{ccsd(t)} --> OCC(Cl)CCl theory{ccsd(t)} + CCl theory{ccsd(t)}"
      3265       -3.829       -3.740       -3.614        1.294       -2.320 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{ccsd(t)} + CO theory{ccsd(t)} --> OCC(Cl)CCl theory{ccsd(t)} + CCl theory{ccsd(t)}"
      3245       -8.202       -8.004       -7.946        0.000       -7.946 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      3244       -8.202       -8.004       -7.946        0.000       -7.946 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      3243       -8.202       -8.004       -7.946        0.000       -7.946 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      3242       -8.202       -8.004       -7.946        0.000       -7.946 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      3221       -4.396       -4.304       -4.183        0.000       -4.183 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
      3220       -4.396       -4.304       -4.183        0.000       -4.183 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
      3219       -4.396       -4.304       -4.183        0.000       -4.183 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
      3218       -4.396       -4.304       -4.183        0.000       -4.183 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
      3217       -5.532       -5.625       -5.888        0.000       -5.888 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
      3216       -5.532       -5.625       -5.888        0.000       -5.888 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
      3215       -5.532       -5.625       -5.888        0.000       -5.888 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
      3214       -5.532       -5.625       -5.888        0.000       -5.888 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
      3213       -8.161       -7.953       -7.854        0.000       -7.854 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
      3212       -8.161       -7.953       -7.854        0.000       -7.854 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
      3211       -8.161       -7.953       -7.854        0.000       -7.854 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
      3208       -4.417       -4.262       -4.101        0.000       -4.101 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
      3207       -4.417       -4.262       -4.101        0.000       -4.101 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
      3206       -4.417       -4.262       -4.101        0.000       -4.101 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
      3205       -4.417       -4.262       -4.101        0.000       -4.101 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
      3172       -4.694       -4.623       -4.461        1.349       -3.112 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
      3171       -4.694       -4.623       -4.461        1.349       -3.112 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
      3170       -4.694       -4.623       -4.461        1.349       -3.112 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
      3033      -62.349      -59.329      -57.543       26.763      -30.780 AB + C --> AC + B        "CBr xc{b3lyp} basis{6-311++G(2d,2p)} + [OH] ^{-1} xc{b3lyp} basis{6-311++G(2d,2p)} --> CO xc{b3lyp} basis{6-311++G(2d,2p)} + [Br] ^{-1} xc{b3lyp} basis{6-311++G(2d,2p)}"
      2836      -16.136      -16.411      -16.544        0.000      -16.544 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      2835      -16.136      -16.411      -16.544        0.000      -16.544 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      2834      -16.136      -16.411      -16.544        0.000      -16.544 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      2833      -15.310      -15.642      -15.956        0.000      -15.956 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      2832      -15.310      -15.642      -15.956        0.000      -15.956 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      2831      -15.310      -15.642      -15.956        0.000      -15.956 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      2830      -15.363      -15.620      -15.932        0.000      -15.932 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      2829      -15.363      -15.620      -15.932        0.000      -15.932 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      2828      -15.363      -15.620      -15.932        0.000      -15.932 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      2827      -15.363      -15.620      -15.932        0.000      -15.932 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      2826      -15.981      -16.245      -16.370        0.000      -16.370 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      2825      -15.981      -16.245      -16.370        0.000      -16.370 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      2824      -15.981      -16.245      -16.370        0.000      -16.370 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      2806      -17.163      -17.125      -17.080       -1.183      -18.263 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      2805      -17.163      -17.125      -17.080       -1.183      -18.263 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      2804      -17.163      -17.125      -17.080       -1.183      -18.263 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      2800      -16.473      -16.426      -16.445       -1.175      -17.620 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      2799      -16.473      -16.426      -16.445       -1.175      -17.620 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      2798      -16.473      -16.426      -16.445       -1.175      -17.620 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      2796        7.745        8.139        7.747       -3.447        4.301 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
      2795        7.745        8.139        7.747       -3.447        4.301 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
      2794        7.745        8.139        7.747       -3.447        4.301 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
      2777        7.267        6.418        7.303        1.744        9.047 AB + CD --> AD + BC      "CCl + oxidane --> CO + hydrogen chloride"
      2654      -24.415      -19.691      -23.568       -5.577      -29.144 AB + CD --> AD + BC      "4-Hydroxy-3-methoxybenzaldehyde + hydrogen gas --> 4-Hydroxybenzaldehyde + methanol"
      2653      -24.415      -19.691      -23.568       -5.577      -29.144 AB + CD --> AD + BC      "4-Hydroxy-3-methoxybenzaldehyde + hydrogen gas --> 4-Hydroxybenzaldehyde + methanol"
      2652      -24.415      -19.691      -23.568       -5.577      -29.144 AB + CD --> AD + BC      "4-Hydroxy-3-methoxybenzaldehyde + hydrogen gas --> 4-Hydroxybenzaldehyde + methanol"
      2651      -24.415      -19.691      -23.568       -5.577      -29.144 AB + CD --> AD + BC      "4-Hydroxy-3-methoxybenzaldehyde + hydrogen gas --> 4-Hydroxybenzaldehyde + methanol"
      2617       13.626        7.586       10.563        0.000       10.563 AB + CD --> AD + BC      "C theory{pspw4} + CO theory{pspw4} --> CCO theory{pspw4} + [HH] theory{pspw4}"
      2615       12.979        7.834       10.719        0.008       10.727 AB + CD --> AD + BC      "C xc{m06-2x} + CO xc{m06-2x} --> CCO xc{m06-2x} + [HH] xc{m06-2x}"
      2595        9.699       11.578       11.180        0.000       11.180 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
      2594        9.699       11.578       11.180        0.000       11.180 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
      2593        9.699       11.578       11.180        0.000       11.180 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
      2532        3.317        3.979        3.511       -0.228        3.284 AB + CD --> AD + BC      "OCCl theory{ccsd(t)} + C theory{ccsd(t)} --> CCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2531        3.317        3.979        3.511       -0.228        3.284 AB + CD --> AD + BC      "OCCl theory{ccsd(t)} + C theory{ccsd(t)} --> CCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2530        3.317        3.979        3.511       -0.228        3.284 AB + CD --> AD + BC      "OCCl theory{ccsd(t)} + C theory{ccsd(t)} --> CCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2529       11.332       12.316       11.657       -2.234        9.422 AB + CD --> AD + BC      "OC(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClCCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2528       11.332       12.316       11.657       -2.234        9.422 AB + CD --> AD + BC      "OC(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClCCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2527       11.332       12.316       11.657       -2.234        9.422 AB + CD --> AD + BC      "OC(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClCCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2526       11.402       12.523       11.852       -2.321        9.531 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
      2525       11.402       12.523       11.852       -2.321        9.531 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
      2524       11.402       12.523       11.852       -2.321        9.531 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
      2477       10.913       11.890       11.209       -2.175        9.035 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
      2476       10.913       11.890       11.209       -2.175        9.035 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
      2475       10.913       11.890       11.209       -2.175        9.035 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
      2474       12.800       13.656       13.038       -1.982       11.056 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2473       12.800       13.656       13.038       -1.982       11.056 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2472       12.800       13.656       13.038       -1.982       11.056 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2471       12.321       13.484       12.884        0.000       12.884 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
      2470       12.321       13.484       12.884        0.000       12.884 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
      2469       12.321       13.484       12.884        0.000       12.884 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
      2468        9.342       10.887       10.116       -1.982        8.134 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClC(Cl)Cl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2467        9.342       10.887       10.116       -1.982        8.134 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClC(Cl)Cl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2466        9.342       10.887       10.116       -1.982        8.134 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClC(Cl)Cl theory{ccsd(t)} + CO theory{ccsd(t)}"
      2465        9.201       10.818        9.957       -2.072        7.884 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
      2464        9.201       10.818        9.957       -2.072        7.884 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
      2463        9.201       10.818        9.957       -2.072        7.884 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
      2462       10.107       11.478       10.810       -1.702        9.108 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2461       10.107       11.478       10.810       -1.702        9.108 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2460       10.107       11.478       10.810       -1.702        9.108 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClC(Cl)Cl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2459        9.715       11.665       11.256        0.000       11.256 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
      2458        9.715       11.665       11.256        0.000       11.256 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
      2457        9.715       11.665       11.256        0.000       11.256 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
      2410        0.733        0.593        1.685       -1.530        0.155 AB + CD --> AD + BC      "methyl fluoride xc{m06-2x} + oxidane xc{m06-2x} --> MeOH xc{m06-2x} + hydrogen fluoride xc{m06-2x}"
      2352        1.961        1.975        2.955       -1.271        1.684 AB + CD --> AD + BC      "methyl fluoride + oxidane --> MeOH + hydrogen fluoride"
      2351        9.138        9.487        9.084       -0.918        8.166 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2350        9.138        9.487        9.084       -0.918        8.166 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2349        9.138        9.487        9.084       -0.918        8.166 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      2344       12.234       11.133       12.003        3.141       15.144 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
      2343       12.234       11.133       12.003        3.141       15.144 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
      2342       12.234       11.133       12.003        3.141       15.144 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
      2341       -7.303       -6.675       -6.944        0.000       -6.944 AB + CD --> AD + BC      "DNAN xc{pbe0} theory{pspw} + water xc{pbe0} theory{pspw} --> 2,4-dinitrophenol xc{pbe0} theory{pspw} + methanol xc{pbe0} theory{pspw}"
      2340       -7.303       -6.675       -6.944        0.000       -6.944 AB + CD --> AD + BC      "DNAN xc{pbe0} theory{pspw} + water xc{pbe0} theory{pspw} --> 2,4-dinitrophenol xc{pbe0} theory{pspw} + methanol xc{pbe0} theory{pspw}"
      2339       -7.303       -6.675       -6.944        0.000       -6.944 AB + CD --> AD + BC      "DNAN xc{pbe0} theory{pspw} + water xc{pbe0} theory{pspw} --> 2,4-dinitrophenol xc{pbe0} theory{pspw} + methanol xc{pbe0} theory{pspw}"
      2338      -56.151      -53.127      -51.201        0.000      -51.201 AB + C --> AC + B        "CBr theory{pspw4} + [OH] ^{-1} theory{pspw4} --> CO theory{pspw4} + [Br] ^{-1} theory{pspw4}"
      2309       -6.036       -5.196       -5.682        5.177       -0.505 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
      2308       -6.036       -5.196       -5.682        5.177       -0.505 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
      2307       -6.036       -5.196       -5.682        5.177       -0.505 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
      2302      -10.651      -10.697      -12.811        5.163       -7.648 AB + CD --> AD + BC      "DNAN xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe0} basis{6-31G*} + methanol xc{pbe0} basis{6-31G*}"
      2301      -10.651      -10.697      -12.811        5.163       -7.648 AB + CD --> AD + BC      "DNAN xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe0} basis{6-31G*} + methanol xc{pbe0} basis{6-31G*}"
      2300      -10.651      -10.697      -12.811        5.163       -7.648 AB + CD --> AD + BC      "DNAN xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe0} basis{6-31G*} + methanol xc{pbe0} basis{6-31G*}"
      2287        1.180        1.188        2.187       -1.359        0.828 AB + CD --> AD + BC      "methyl fluoride xc{pbe} + oxidane xc{pbe} --> MeOH xc{pbe} + hydrogen fluoride xc{pbe}"
      2285       -8.089       -7.675       -8.233        0.000       -8.233 AB + CD --> AD + BC      "DNAN theory{pspw4} + water theory{pspw4} --> 2,4-dinitrophenol theory{pspw4} + methanol theory{pspw4}"
      2284       -8.089       -7.675       -8.233        0.000       -8.233 AB + CD --> AD + BC      "DNAN theory{pspw4} + water theory{pspw4} --> 2,4-dinitrophenol theory{pspw4} + methanol theory{pspw4}"
      2283       -8.089       -7.675       -8.233        0.000       -8.233 AB + CD --> AD + BC      "DNAN theory{pspw4} + water theory{pspw4} --> 2,4-dinitrophenol theory{pspw4} + methanol theory{pspw4}"
      2264       -8.178       -7.549       -7.728        7.035       -0.693 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      2263       -8.178       -7.549       -7.728        7.035       -0.693 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      2262       -8.178       -7.549       -7.728        7.035       -0.693 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
      2246        3.252        4.069        4.193       -0.029        4.165 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
      2245        3.252        4.069        4.193       -0.029        4.165 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
      2244        3.252        4.069        4.193       -0.029        4.165 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
      2233       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      2232       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      2231       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      2222      -11.817       -0.553        5.405        8.151       13.556 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
      2221      -11.817       -0.553        5.405        8.151       13.556 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
      2220      -11.817       -0.553        5.405        8.151       13.556 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
      2213        8.797        9.316        8.897        0.000        8.897 AB + CD --> AD + BC      "OCCl theory{pspw4} + C theory{pspw4} --> CCl theory{pspw4} + CO theory{pspw4}"
      2212        8.797        9.316        8.897        0.000        8.897 AB + CD --> AD + BC      "OCCl theory{pspw4} + C theory{pspw4} --> CCl theory{pspw4} + CO theory{pspw4}"
      2211        8.797        9.316        8.897        0.000        8.897 AB + CD --> AD + BC      "OCCl theory{pspw4} + C theory{pspw4} --> CCl theory{pspw4} + CO theory{pspw4}"
      2201       -8.730       -8.401       -8.255        7.114       -1.141 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      2200       -8.730       -8.401       -8.255        7.114       -1.141 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      2199       -8.730       -8.401       -8.255        7.114       -1.141 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
      2197        2.788        3.444        2.954       -0.149        2.805 AB + CD --> AD + BC      "OCCl xc{b3lyp} + C xc{b3lyp} --> CCl xc{b3lyp} + CO xc{b3lyp}"
      2196        2.788        3.444        2.954       -0.149        2.805 AB + CD --> AD + BC      "OCCl xc{b3lyp} + C xc{b3lyp} --> CCl xc{b3lyp} + CO xc{b3lyp}"
      2195        2.788        3.444        2.954       -0.149        2.805 AB + CD --> AD + BC      "OCCl xc{b3lyp} + C xc{b3lyp} --> CCl xc{b3lyp} + CO xc{b3lyp}"
      2194       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
      2193       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
      2192       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
      2180        0.977        1.271        2.416        0.000        2.416 AB + CD --> AD + BC      "methyl fluoride theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen fluoride theory{pspw4}"
      2168       13.946       10.540       13.315        0.067       13.383 AB + CD --> AD + BC      "C xc{pbe} + CO xc{pbe} --> CCO xc{pbe} + [HH] xc{pbe}"
      2156      -29.103      -18.693       -9.903        0.000       -9.903 AB + CD --> CABD         "C=O theory{pspw4} + [H][H] theory{pspw4} --> CO theory{pspw4}"
      2155      -29.103      -18.693       -9.903        0.000       -9.903 AB + CD --> CABD         "C=O theory{pspw4} + [H][H] theory{pspw4} --> CO theory{pspw4}"
      2154      -28.132      -20.411      -11.764       -2.442      -14.206 AB + CD --> CABD         "C=O + [H][H] --> CO"
      2153      -28.132      -20.411      -11.764       -2.442      -14.206 AB + CD --> CABD         "C=O + [H][H] --> CO"
      2109       -4.826       -5.483       -4.649       -0.411       -5.059 AB + CD --> AD + BC      "CO + O=N(=O)O --> CON(=O)=O + O"
      2108       -4.826       -5.483       -4.649       -0.411       -5.059 AB + CD --> AD + BC      "CO + O=N(=O)O --> CON(=O)=O + O"
      2107       -4.826       -5.483       -4.649       -0.411       -5.059 AB + CD --> AD + BC      "CO + O=N(=O)O --> CON(=O)=O + O"
      2106       -4.826       -5.483       -4.649       -0.411       -5.059 AB + CD --> AD + BC      "CO + O=N(=O)O --> CON(=O)=O + O"
      2084        8.035        9.573        8.780       -1.912        6.868 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
      2083        8.035        9.573        8.780       -1.912        6.868 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
      2082        8.035        9.573        8.780       -1.912        6.868 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
      2012      122.562      116.282      106.456        0.000      106.456 AB --> A + B             "CO theory{pspw4} xc{lda} --> [CH3] theory{pspw4} xc{lda} + [OH] theory{pspw4} xc{lda}"
      2011       95.865       89.484       79.665        0.000       79.665 AB --> A + B             "CO theory{pspw} xc{pbe} --> [CH3] theory{pspw} xc{pbe} + [OH] theory{pspw} xc{pbe}"
      2010       95.885       89.487       79.641        0.000       79.641 AB --> A + B             "CO theory{pspw4} xc{pbe} --> [CH3] theory{pspw4} xc{pbe} + [OH] theory{pspw4} xc{pbe}"
      2009       95.497       89.142       79.377        0.403       79.780 AB --> A + B             "CO xc{pbe0} --> [CH3] xc{pbe0} + [OH] xc{pbe0}"
      2006       99.874       93.921       84.144        0.450       84.595 AB --> A + B             "CO xc{pbe} --> [CH3] xc{pbe} + [OH] xc{pbe}"
      2005       -5.952       -5.946       -5.699        1.390       -4.309 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OC(CCl)CCl + CCl"
      2004       -5.952       -5.946       -5.699        1.390       -4.309 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OC(CCl)CCl + CCl"
      2003       -5.952       -5.946       -5.699        1.390       -4.309 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OC(CCl)CCl + CCl"
      1988      -41.464      -40.961      -41.119        0.000      -41.119 AB + CD --> AD + BC      "CC theory{pspw4} + OO theory{pspw4} --> CO theory{pspw4} + CO theory{pspw4}"
      1986       92.987       86.730       76.986        0.542       77.528 AB --> A + B             "CO --> [CH3] + [OH]"
      1955       15.753       12.007       14.837       -0.040       14.797 AB + CD --> AD + BC      "C + CO --> CCO + [HH]"
      1790       -8.202       -7.988       -7.929        0.000       -7.929 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      1789       -8.202       -7.988       -7.929        0.000       -7.929 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      1788       -8.202       -7.988       -7.929        0.000       -7.929 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      1782        4.981        3.326        4.887        1.789        6.676 AB + CD --> AD + BC      "ClC(C)(C)C + Ch3OH --> Cl + O(C(C)(C)C)C"
      1653       -8.202       -7.988       -7.929        0.000       -7.929 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)O theory{pspw} + CCl theory{pspw}"
      1648      122.562      116.282      106.456        0.000      106.456 AB --> A + B             "CO theory{pspw4} xc{lda} --> [CH3] theory{pspw4} xc{lda} + [OH] theory{pspw4} xc{lda}"
      1647       95.497       89.142       79.377        0.403       79.780 AB --> A + B             "CO xc{pbe0} --> [CH3] xc{pbe0} + [OH] xc{pbe0}"
      1646       99.874       93.921       84.144        0.450       84.595 AB --> A + B             "CO xc{pbe} --> [CH3] xc{pbe} + [OH] xc{pbe}"
      1645        0.733        0.593        1.685       -1.530        0.155 AB + CD --> AD + BC      "methyl fluoride xc{m06-2x} + oxidane xc{m06-2x} --> MeOH xc{m06-2x} + hydrogen fluoride xc{m06-2x}"
      1644       -3.424       -3.633       -4.407        0.000       -4.407 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      1643        1.180        1.188        2.187       -1.359        0.828 AB + CD --> AD + BC      "methyl fluoride xc{pbe} + oxidane xc{pbe} --> MeOH xc{pbe} + hydrogen fluoride xc{pbe}"
      1642       -3.569       -3.781       -4.421        0.000       -4.421 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      1641      -13.988      -13.922      -13.893        0.000      -13.893 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      1639      -14.062      -13.997      -13.982        0.000      -13.982 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      1638      -15.981      -16.245      -16.370        0.000      -16.370 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} xc{pbe0} + methanol theory{pspw4} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw4} xc{pbe0} + CCl theory{pspw4} xc{pbe0}"
      1637      -13.720      -13.492      -13.413        0.000      -13.413 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      1636       95.885       89.487       79.641        0.000       79.641 AB --> A + B             "CO theory{pspw4} xc{pbe} --> [CH3] theory{pspw4} xc{pbe} + [OH] theory{pspw4} xc{pbe}"
      1635       95.865       89.484       79.665        0.000       79.665 AB --> A + B             "CO theory{pspw} xc{pbe} --> [CH3] theory{pspw} xc{pbe} + [OH] theory{pspw} xc{pbe}"
      1634       92.987       86.730       76.986        0.542       77.528 AB --> A + B             "CO --> [CH3] + [OH]"
      1633       -8.771       -8.554       -8.397       -0.679       -9.076 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)O xc{pbe0} + CCl xc{pbe0}"
      1632       -8.772       -8.543       -8.387       -0.700       -9.086 AB + CD --> AD + BC      "C(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)O xc{pbe} + CCl xc{pbe}"
      1631       -8.161       -7.953       -7.854        0.000       -7.854 AB + CD --> AD + BC      "C(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)O theory{pspw4} + CCl theory{pspw4}"
      1630      -14.971      -14.774      -14.613       -0.479      -15.092 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      1629      -14.670      -14.465      -14.327       -0.561      -14.888 AB + CD --> AD + BC      "C(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      1628      -13.704      -13.568      -13.535        0.000      -13.535 AB + CD --> AD + BC      "C(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      1627      -17.163      -17.125      -17.080       -1.183      -18.263 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe0} + methanol xc{pbe0} --> C(Cl)(Cl)(Cl)O xc{pbe0} + CCl xc{pbe0}"
      1626      -16.136      -16.411      -16.544        0.000      -16.544 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} xc{pbe0} + methanol theory{pspw} xc{pbe0} --> C(Cl)(Cl)(Cl)O theory{pspw} xc{pbe0} + CCl theory{pspw} xc{pbe0}"
      1625      -16.473      -16.426      -16.445       -1.175      -17.620 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl xc{pbe} + methanol xc{pbe} --> C(Cl)(Cl)(Cl)O xc{pbe} + CCl xc{pbe}"
      1624      -15.310      -15.642      -15.956        0.000      -15.956 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw4} + methanol theory{pspw4} --> C(Cl)(Cl)(Cl)O theory{pspw4} + CCl theory{pspw4}"
      1623      -15.363      -15.604      -15.915        0.000      -15.915 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)Cl theory{pspw} + methanol theory{pspw} --> C(Cl)(Cl)(Cl)O theory{pspw} + CCl theory{pspw}"
      1622      -46.730      -46.355      -46.383       -2.083      -48.466 AB + CD --> AD + BC      "CC xc{m06-2x} + OO xc{m06-2x} --> CO xc{m06-2x} + CO xc{m06-2x}"
      1621      -40.655      -39.905      -39.999       -2.031      -42.030 AB + CD --> AD + BC      "CC xc{pbe} + OO xc{pbe} --> CO xc{pbe} + CO xc{pbe}"
      1620        0.977        1.271        2.416        0.000        2.416 AB + CD --> AD + BC      "methyl fluoride theory{pspw4} + oxidane theory{pspw4} --> MeOH theory{pspw4} + hydrogen fluoride theory{pspw4}"
      1619       -6.036       -5.196       -5.682        5.177       -0.505 AB + CD --> AD + BC      "DNAN xc{m06-2x} + water xc{m06-2x} --> 2,4-dinitrophenol xc{m06-2x} + methanol xc{m06-2x}"
      1618       -8.089       -7.675       -8.233        0.000       -8.233 AB + CD --> AD + BC      "DNAN theory{pspw4} + water theory{pspw4} --> 2,4-dinitrophenol theory{pspw4} + methanol theory{pspw4}"
      1617      -46.838      -43.987      -42.163        0.000      -42.163 AB + C --> AC + B        "CCl theory{pspw4} + [OH-] theory{pspw4} --> CO theory{pspw4} + [Cl-] theory{pspw4}"
      1616       12.979        7.834       10.719        0.008       10.727 AB + CD --> AD + BC      "C xc{m06-2x} + CO xc{m06-2x} --> CCO xc{m06-2x} + [HH] xc{m06-2x}"
      1615       13.946       10.540       13.315        0.067       13.383 AB + CD --> AD + BC      "C xc{pbe} + CO xc{pbe} --> CCO xc{pbe} + [HH] xc{pbe}"
      1614       13.626        7.586       10.563        0.000       10.563 AB + CD --> AD + BC      "C theory{pspw4} + CO theory{pspw4} --> CCO theory{pspw4} + [HH] theory{pspw4}"
      1613      -24.415      -19.691      -23.568       -5.577      -29.144 AB + CD --> AD + BC      "4-Hydroxy-3-methoxybenzaldehyde + hydrogen gas --> 4-Hydroxybenzaldehyde + methanol"
      1608        9.537        8.517       -3.364        2.567       -0.797 AB + CD --> AD + BC      "methyl bromide + oxidane --> MeOH + hydrogen bromide"
      1604        1.961        1.975        2.955       -1.271        1.684 AB + CD --> AD + BC      "methyl fluoride + oxidane --> MeOH + hydrogen fluoride"
      1597       12.234       11.133       12.003        3.141       15.144 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
      1591        4.981        3.326        4.887        1.789        6.676 AB + CD --> AD + BC      "ClC(C)(C)C + Ch3OH --> Cl + O(C(C)(C)C)C"
      1588       -8.040       -7.426       -7.395        7.262       -0.133 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
      1584      -39.988      -40.405      -42.740       31.755      -10.984 AB + C --> AC + B        "COc1ccccc1 + [OH-] --> [O-]c1ccccc1 + CO"
      1578        7.745        8.139        7.747       -3.447        4.301 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
      1575        7.267        6.418        7.303        1.744        9.047 AB + CD --> AD + BC      "CCl + oxidane --> CO + hydrogen chloride"
      1565      -63.171      -62.268      -64.297       30.212      -34.085 AB + C --> AC + B        "CON(=O)=O + [OH-] --> O=N(=O)[O-] + CO"
      1562       -4.827       -5.478       -4.641       -0.350       -4.991 AB + CD --> AD + BC      "CO + O=N(=O)O --> CON(=O)=O + O"
      1561       -4.868       -4.773       -4.625        1.223       -3.402 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OCC(Cl)CCl + CCl"
      1560       -5.952       -5.946       -5.699        1.390       -4.309 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OC(CCl)CCl + CCl"
      1557      -35.616      -31.915      -30.137        2.496      -27.641 AB + C --> AC + B        "CCl + [OH+] --> CO + [Cl+]"
      1554      -10.622       -7.855       -6.152        0.931       -5.221 AB + C --> AC + B        "CCl + [OH] --> CO + [Cl]"
      1548      -55.366      -52.660      -50.969       15.132      -35.837 AB + C --> AC + B        "CCl + [OH-] --> CO + [Cl-]"
      1544       15.753       12.007       14.837       -0.040       14.797 AB + CD --> AD + BC      "C + CO --> CCO + [HH]"
      1527        7.655        5.100        5.551        6.560       12.112 AB + C --> AC + B        "O[O-] + CO --> OO + C[O-]"
      1526       31.290       28.211       27.471       -0.635       26.836 AB + C --> AC + B        "[O-][O] + CO --> O[O] + C[O-]"
      1516        3.317        3.979        3.511       -0.228        3.284 AB + CD --> AD + BC      "OCCl theory{ccsd(t)} + C theory{ccsd(t)} --> CCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      1515       11.332       12.316       11.657       -2.234        9.422 AB + CD --> AD + BC      "OC(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClCCl theory{ccsd(t)} + CO theory{ccsd(t)}"
      1514        9.342       10.887       10.116       -1.982        8.134 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{ccsd(t)} + C theory{ccsd(t)} --> ClC(Cl)Cl theory{ccsd(t)} + CO theory{ccsd(t)}"
      1490       12.321       13.484       12.884        0.000       12.884 AB + CD --> AD + BC      "OC(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClCCl theory{pspw4} + CO theory{pspw4}"
      1478        3.252        4.069        4.193       -0.029        4.165 AB + CD --> AD + BC      "OCCl xc{m06-2x} + C xc{m06-2x} --> CCl xc{m06-2x} + CO xc{m06-2x}"
      1477        2.788        3.444        2.954       -0.149        2.805 AB + CD --> AD + BC      "OCCl xc{b3lyp} + C xc{b3lyp} --> CCl xc{b3lyp} + CO xc{b3lyp}"
      1476        9.138        9.487        9.084       -0.918        8.166 AB + CD --> AD + BC      "OCCl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> CCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      1475        8.797        9.316        8.897        0.000        8.897 AB + CD --> AD + BC      "OCCl theory{pspw4} + C theory{pspw4} --> CCl theory{pspw4} + CO theory{pspw4}"
      1474       11.402       12.523       11.852       -2.321        9.531 AB + CD --> AD + BC      "OC(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClCCl xc{m06-2x} + CO xc{m06-2x}"
      1473       10.913       11.890       11.209       -2.175        9.035 AB + CD --> AD + BC      "OC(Cl)Cl xc{b3lyp} + C xc{b3lyp} --> ClCCl xc{b3lyp} + CO xc{b3lyp}"
      1472       12.800       13.656       13.038       -1.982       11.056 AB + CD --> AD + BC      "OC(Cl)Cl theory{dft} xc{pbe} + C theory{dft} xc{pbe} --> ClCCl theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      1471        9.201       10.818        9.957       -2.072        7.884 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl xc{m06-2x} + C xc{m06-2x} --> ClC(Cl)Cl xc{m06-2x} + CO xc{m06-2x}"
      1470        9.715       11.665       11.256        0.000       11.256 AB + CD --> AD + BC      "OC(Cl)(Cl)Cl theory{pspw4} + C theory{pspw4} --> ClC(Cl)Cl theory{pspw4} + CO theory{pspw4}"
      1458     -113.421     -112.548     -114.628       56.938      -57.690 AB + C --> AC + B        "DNAN basis{6-31G*} + hydroxide basis{6-31G*} --> DNAN-1-O- basis{6-31G*} + CO basis{6-31G*}"
      1397        8.035        9.573        8.780       -1.912        6.868 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
      1303      -22.938      -21.712      -22.005       -0.261      -22.267 AB + CD --> AD + BC      "CN + OO --> NO + CO"
      1295      -45.158      -43.698      -44.152       -2.345      -46.497 AB + CD --> AD + BC      "CC + OO --> CO + CO"
      1191      -80.398      -80.059      -82.245       55.413      -26.832 AB + C --> AC + B        "DNAN xc{m06-2x} + hydroxide xc{m06-2x} --> DNAN-1-O- xc{m06-2x} + CO xc{m06-2x}"
      1185      -79.968      -79.715      -81.709       54.651      -27.058 AB + C --> AC + B        "DNAN + hydroxide --> DNAN-1-O- + CO"
      1181      -75.511      -75.371      -77.825        0.000      -77.825 AB + C --> AC + B        "DNAN theory{pspw4} + hydroxide theory{pspw4} --> DNAN-1-O- theory{pspw4} + CO theory{pspw4}"
      1180      -80.515      -80.235      -82.374       54.446      -27.928 AB + C --> AC + B        "DNAN theory{dft} xc{pbe} + hydroxide theory{dft} xc{pbe} --> DNAN-1-O- theory{dft} xc{pbe} + CO theory{dft} xc{pbe}"
      1179      -75.535      -75.331      -77.663        0.000      -77.663 AB + C --> AC + B        "DNAN theory{pspw4} + hydroxide theory{pspw4} --> DNAN-1-O- theory{pspw4} + CO theory{pspw4}"
      1167      -53.283      -50.570      -48.857       15.141      -33.717 AB + C --> AC + B        "CCl theory{ccsd(t)} parse_output{hrxn(gas)} + hydroxide theory{ccsd(t)} parse_output{hrxn(gas)} --> CO theory{ccsd(t)} parse_output{hrxn(gas)} + chloride theory{ccsd(t)} parse_output{hrxn(gas)}"
      1166      -56.369      -53.653      -51.973       15.163      -36.811 AB + C --> AC + B        "CCl xc{pbe0} parse_output{hrxn(gas)} + hydroxide xc{pbe0} parse_output{hrxn(gas)} --> CO xc{pbe0} parse_output{hrxn(gas)} + chloride xc{pbe0} parse_output{hrxn(gas)}"
      1165      -46.438      -43.691      -41.912        0.000      -41.912 AB + C --> AC + B        "CCl theory{pspw} parse_output{hrxn(gas)} + hydroxide theory{pspw} parse_output{hrxn(gas)} --> CO theory{pspw} parse_output{hrxn(gas)} + chloride theory{pspw} parse_output{hrxn(gas)}"
      1133       15.753       11.993       14.795        0.040       14.835 AB + CD --> AD + BC      "C + CO --> CCO + [HH]"
      1040      -56.137      -53.208      -51.422        0.000      -51.422 AB + C --> AC + B        "CBr theory{pspw4} + [OH] ^{-1} theory{pspw4} --> CO theory{pspw4} + [Br] ^{-1} theory{pspw4}"
       807      -79.968      -79.709      -81.678       54.581      -27.097 AB + CD --> AD + BC      "DNAN + hydroxide ^{-1} --> CO + O=N(=O)c1ccc(c(c1)N(=O)=O)[O] ^{-1}"
       781      -46.824      -44.068      -42.384        0.000      -42.384 AB + C --> AC + B        "CCl theory{pspw4} + [OH-] theory{pspw4} --> CO theory{pspw4} + [Cl-] theory{pspw4}"
       682       -8.040       -7.420       -7.368        7.182       -0.185 AB + CD --> AD + BC      "COc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] + O --> CO + [O-][N+](=O)c1ccc(c(c1)[N+](=O)[O-])O"
       676      -64.498      -64.338      -66.359       46.474      -19.885 AB + C --> AC + B        "COc1ccc(cc1)[N+]([O-])=O + hydroxide ^{-1} --> [O]c1ccc(cc1)N(=O)=O ^{-1} + CO"
       642       -5.420       -5.933       -4.333        0.000       -4.333 AB + CD --> AD + BC      "CO theory{pspw4} + O=N(=O)O theory{pspw4} --> CON(=O)=O theory{pspw4} + O theory{pspw4}"
       641       -4.827       -5.484       -4.669       -0.270       -4.939 AB + CD --> AD + BC      "CO + O=N(=O)O --> CON(=O)=O + O"
       596       -3.829       -3.740       -3.614        1.294       -2.320 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{ccsd(t)} + CO theory{ccsd(t)} --> OCC(Cl)CCl theory{ccsd(t)} + CCl theory{ccsd(t)}"
       562       -4.545       -4.557       -4.501        0.000       -4.501 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} xc{lda} + CO theory{pspw4} xc{lda} --> OCC(Cl)CCl theory{pspw4} xc{lda} + CCl theory{pspw4} xc{lda}"
       561       -4.417       -4.246       -4.084        0.000       -4.084 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw} + CO theory{pspw} --> OCC(Cl)CCl theory{pspw} + CCl theory{pspw}"
       557       -5.952       -5.952       -5.727        1.461       -4.266 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OC(CCl)CCl + CCl"
       556       -5.546       -5.544       -5.667        0.000       -5.667 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OC(CCl)CCl theory{pspw4} + CCl theory{pspw4}"
       555       -4.694       -4.623       -4.461        1.349       -3.112 AB + CD --> AD + BC      "ClCC(Cl)CCl xc{pbe} + CO xc{pbe} --> OCC(Cl)CCl xc{pbe} + CCl xc{pbe}"
       554       -4.868       -4.779       -4.653        1.294       -3.359 AB + CD --> AD + BC      "ClCC(Cl)CCl + CO --> OCC(Cl)CCl + CCl"
       553       -4.410       -4.223       -3.961        0.000       -3.961 AB + CD --> AD + BC      "ClCC(Cl)CCl theory{pspw4} + CO theory{pspw4} --> OCC(Cl)CCl theory{pspw4} + CCl theory{pspw4}"
       517        3.172        3.580        2.516        0.000        2.516 AB + CD --> AD + BC      "C=C(CC)OC theory{pspw4} + O theory{pspw4} --> C=C(O)CC theory{pspw4} + CO theory{pspw4}"
       515        7.745        8.145        7.774       -3.526        4.248 AB + CD --> AD + BC      "COC(C)=O + O --> CC(=O)O + CO"
       476      -10.622       -7.848       -6.124        0.860       -5.264 AB + C --> AC + B        "CCl + [OH] --> CO + [Cl]"
       472      -35.616      -31.909      -30.109        2.425      -27.684 AB + C --> AC + B        "CCl + [OH+] --> CO + [Cl+]"
       467      -63.171      -62.262      -64.270       30.133      -34.137 AB + C --> AC + B        "CON(=O)=O + [OH-] --> O=N(=O)[O-] + CO"
       422      -57.658      -57.492      -59.997        0.000      -59.997 AB + C --> AC + B        "COc1ccc(N(=O)=O)cc1N(=O)=O theory{pspw} + [OH-] theory{pspw} --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 theory{pspw} + CO theory{pspw}"
       414       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + water theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} --> CO theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None} + C1=C(C(=CC(=C1)[N](=O)=O)[N](=O)=O)O theory{pspw} xc{pbe} basis{100.0 Ry} solvation_type{None}"
       397      -39.988      -40.399      -42.712       31.675      -11.037 AB + C --> AC + B        "COc1ccccc1 + [OH-] --> [O-]c1ccccc1 + CO"
       374       -7.303       -6.675       -6.944        0.000       -6.944 AB + CD --> AD + BC      "DNAN xc{pbe0} theory{pspw} + water xc{pbe0} theory{pspw} --> 2,4-dinitrophenol xc{pbe0} theory{pspw} + methanol xc{pbe0} theory{pspw}"
       373      -10.651      -10.697      -12.811        5.163       -7.648 AB + CD --> AD + BC      "DNAN xc{pbe0} basis{6-31G*} + water xc{pbe0} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe0} basis{6-31G*} + methanol xc{pbe0} basis{6-31G*}"
       367      -11.817       -0.553        5.405        8.151       13.556 AB + CD --> AD + BC      "DNAN xc{pbe} basis{6-31G*} + water xc{pbe} basis{6-31G*} --> 2,4-dinitrophenol xc{pbe} basis{6-31G*} + methanol xc{pbe} basis{6-31G*}"
       364       -8.200       -7.765       -8.232        0.000       -8.232 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw4} + water xc{pbe} theory{pspw4} --> 2,4-dinitrophenol xc{pbe} theory{pspw4} + methanol xc{pbe} theory{pspw4}"
       346       -7.691       -7.350       -8.029        0.000       -8.029 AB + CD --> AD + BC      "DNAN xc{pbe} theory{pspw} + water xc{pbe} theory{pspw} --> 2,4-dinitrophenol xc{pbe} theory{pspw} + methanol xc{pbe} theory{pspw}"
       345       -8.730       -8.401       -8.255        7.114       -1.141 AB + CD --> AD + BC      "DNAN xc{pbe} + water xc{pbe} --> 2,4-dinitrophenol xc{pbe} + methanol xc{pbe}"
       344       -8.040       -7.420       -7.368        7.182       -0.185 AB + CD --> AD + BC      "DNAN + water --> 2,4-dinitrophenol + methanol"
       343       -8.178       -7.549       -7.728        7.035       -0.693 AB + CD --> AD + BC      "DNAN xc{pbe0} + water xc{pbe0} --> 2,4-dinitrophenol xc{pbe0} + methanol xc{pbe0}"
       300       10.107       11.478       10.810       -1.702        9.108 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O xc{pbe} + C xc{pbe} --> C(Cl)(Cl)Cl xc{pbe} + CO xc{pbe}"
       186      -59.365      -56.795      -55.007       15.693      -39.315 AB + C --> AC + B        "CCl xc{m06-2x} + [OH-] xc{m06-2x} --> CO xc{m06-2x} + [Cl-] xc{m06-2x}"
       177       12.234       11.139       12.030        3.061       15.092 ABC + DE --> DBE + AC    "methyl iodide + oxidane --> MeOH + hydrogen iodide"
       175        9.537        8.522       -6.346        2.487       -3.858 ABC + DE --> DBE + AC    "methyl bromide + oxidane --> MeOH + hydrogen bromide"
       174      -52.170      -49.586      -47.881       14.664      -33.216 AB + C --> AC + B        "CCl xc{pbe} + [OH-] xc{pbe} --> CO xc{pbe} + [Cl-] xc{pbe}"
       173      -51.921      -49.208      -47.496       15.141      -32.355 AB + C --> AC + B        "CCl theory{mp2} + [OH-] theory{mp2} --> CO theory{mp2} + [Cl-] theory{mp2}"
       172      -55.366      -52.654      -50.941       15.061      -35.880 AB + C --> AC + B        "CCl + [OH-] --> CO + [Cl-]"
       171        1.961        1.981       13.865       -1.351       12.515 AB + CD --> AD + BC      "methyl fluoride + oxidane --> MeOH + hydrogen fluoride"
       111        7.267        6.424        7.330        1.673        9.003 AB + CD --> AD + BC      "CCl + oxidane --> CO + hydrogen chloride"
        75        9.699       11.578       11.180        0.000       11.180 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O theory{pspw} + C theory{pspw} --> C(Cl)(Cl)Cl theory{pspw} + CO theory{pspw}"
        74       10.107       11.463       10.779       -1.800        8.978 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O xc{pbe} + C xc{pbe} --> C(Cl)(Cl)Cl xc{pbe} + CO xc{pbe}"
        73        8.035        9.579        8.808       -1.992        6.816 AB + CD --> AD + BC      "C(Cl)(Cl)(Cl)O + C --> C(Cl)(Cl)Cl + CO"
        58        4.981        3.320        4.859        1.869        6.728 AB + CD --> AD + BC      "ClC(C)(C)C + Ch3OH --> HCl + O(C(C)(C)C)C"
        25      -79.968      -79.709      -81.678       54.581      -27.097 AB + C --> AC + B        "COc1ccc(N(=O)=O)cc1N(=O)=O + [OH-] --> O=N(=O)c1ccc([O-])c(N(=O)=O)c1 + CO"


All requests to Arrows were successful.


Link to EMSL Arrows API
More information about EMSL Arrows

KEYWORDs - 
   reaction: :reaction
   chinese_room: :chinese_room
   molecule: :molecule
   nmr: :nmr
   predict: :predict
   submitesmiles: :submitesmiles
   nosubmitmissingesmiles
   resubmitmissingesmiles
   submitmachines: :submitmachines
   useallentries
   nomodelcorrect
   eigenvalues: :eigenvalues
   frequencies: :frequencies
   nwoutput: :nwoutput
   xyzfile: :xyzfile
   alleigs: :alleigs
   allfreqs: :allfreqs

   reactionenumerate:
      energytype:[erxn(gas) hrxn(gas) grxn(gas) delta_solvation grxn(aq)] :energytype
      energytype:[kcal/mol kj/mol ev cm-1 ry hartree au] :energytype
      tablereactions:
         reaction: ... :reaction
         reaction: ... :reaction
         ...
      :tablereactions
      tablemethods:
         method: ... :method
         method: ... :method
         ...
      :tablemethods
   :reactionenumerate


   rotatebonds
   xyzinput:
      label:  :label
      xyzdata:
       ... xyz data ...
      :xyzdata
   :xyzinput


   submitHf: :submitHf
   nmrexp: :nmrexp

   findreplace: old text | new text :findreplace

   listnwjobs
   fetchnwjob: :fetchnwjob
   pushnwjob: :pushnwjob

   printcsv: :printcsv
   printeig: :printeig
   printfreq: :printfreq
   printxyz: :printxyz
   printjobinfo: :printjobinfo
   printnwout: :printnwout
   badids: :badids
   hup_string: 
   database:
   table:
   request_table:
   listallesmiles
   queuecheck                              
This software service and its documentation were developed at the Environmental Molecular Sciences Laboratory (EMSL) at Pacific Northwest National Laboratory, a multiprogram national laboratory, operated for the U.S. Department of Energy by Battelle under Contract Number DE-AC05-76RL01830. Support for this work was provided by the Department of Energy Office of Biological and Environmental Research, and Department of Defense environmental science and technology program (SERDP). THE SOFTWARE SERVICE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE SERVICE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE SERVICE.